when a polar bond is formed between 2 atoms which atom receives a partial positive charge

Answer: The empirical formula of the compound becomes [tex]C_5H_{10}O_2[/tex]

Explanation:

The empirical formula is the chemical formula of the simplest ratio of the number of atoms of each element present in a compound.

Let the mass of the compound be 100 g

Given values:

% of C = 58.8%

% of H = 9.87%

% of O = [100 - 58.8 - 9.87] = 31.33%

Mass of C = 58.8 g

Mass of H = 9.87 g

Mass of O = 31.33 g

The number of moles is defined as the ratio of the mass of a substance to its molar mass. The equation used is:

[tex]\text{Number of moles}=\frac{\text{Given mass}}{\text{Molar mass}}[/tex] ......(1)

To formulate the empirical formula, we need to follow some steps:

Molar mass of C = 12 g/mol

Molar mass of H = 1 g/mol

Molar mass of O = 16 g/mol

Putting values in equation 1, we get:

[tex]\text{Moles of C}=\frac{58.8g}{12g/mol}=4.9 mol[/tex]

[tex]\text{Moles of H}=\frac{9.87g}{1g/mol}=9.87 mol[/tex]

[tex]\text{Moles of O}=\frac{31.33g}{16g/mol}=1.96mol[/tex]

Calculating the mole fraction of each element by dividing the calculated moles by the least calculated number of moles that is 1.96 moles

[tex]\text{Mole fraction of C}=\frac{4.9}{1.96}=2.5[/tex]

[tex]\text{Mole fraction of H}=\frac{9.87}{1.96}=5.03\approx 5[/tex]

[tex]\text{Mole fraction of O}=\frac{1.96}{1.96}=1[/tex]

Converting the mole fraction into whole numbers by multiplying them with 2.

[tex]\text{Mole fraction of C}=2.5\times 2=5[/tex]

[tex]\text{Mole fraction of H}=5\times 2=10[/tex]

[tex]\text{Mole fraction of O}=1\times 2=2[/tex]

The ratio of C : H : O = 5 : 10 : 2

Hence, the empirical formula of the compound becomes [tex]C_5H_{10}O_2[/tex]

The empirical formula of the substance is[tex]C_5H_{10}O_2[/tex].

Explanation:

Given:

A compound made up of 58.8% of carbon, 9.87% hydrogen, and oxygen.

To find:

The empirical formula of this substance.

Solution

The percentage of carbon in a given substance by mass = 58.8%

The percentage of hydrogen in a given substance by mass = 9.87%

The percentage of oxygen in a given substance by mass :

[tex]= 100\%-58.8\%- 9.87\%=31.33\%[/tex]

Consider 100 grams of a substance.

In 100 grams of substance:

The mass of carbon =58.8% of 100 g = 58.8 g

The mass of hydrogen = 9.87% of 100 g = 9.87 g

The mass of oxygen = 31.33% of 100 g= 31.33 g

The moles of carbon [tex]=\frac{58.8 g}{12.0107 g/mol}=4.90 mol[/tex]

The moles of hydrogen[tex]=\frac{9.87g}{1.00784g/mol}=9.79 mol[/tex]

The moles of oxygen[tex]=\frac{31.33g}{15.999g/mol}=1.96 mol[/tex]

let the empirical formula of the substance = [tex]C_xH_yO_z[/tex]

The value of subscript x:

[tex]=\frac{4.90 mol}{1.96 mol}=2.5[/tex]

The value of subscript y:

[tex]=\frac{9.79mol}{1.96 mol}=5[/tex]

The value of subscript z:

[tex]=\frac{1.96mol}{1.96 mol}=1[/tex]

The empirical formula of a substance :

[tex]C_{2.5}H_5O_1=C_{\frac{25}{10}}H_5O_1=C_{25}H_{50}O_{10}[/tex]

Reducing to the lowest whole numbers:

[tex]C_{25}H_{50}O_{10}=C_5H_{10}O_2[/tex]

The empirical formula of the substance is [tex]C_5H_{10}O_2[/tex].

Learn more about the empirical formula here:

brainly.com/question/1247523?referrer=searchResults

brainly.com/question/1363167?referrer=searchResults

Answer:

d. van der waals force

Explanation:

Van der Waals force :

the weakest intermolecular forceand consist of dipole-dipole force and dispersion force.

Answer:

Melting-point apparatus

☛ 299,792,458 meters per second.

Answer:

The correct answer is "-268.667°C".

Explanation:

Given:

Temperature,

= 4.483 K (below)

Now,

The formula of temperature conversion will be:

⇒ [tex]T(^{\circ} C)=T(K)-273.15[/tex]

By putting the values, we get

⇒            [tex]=4.483-273.15[/tex]

⇒            [tex]=-268.667^{\circ} C[/tex]

Thus the above is the correct answer.

Answer:

C₆H₆

Explanation:

Each border of the figure represents 1 atom of carbon. We have 6 borders = 6 atoms of carbon.

Each atom of carbon form 4 bonds. All the carbons are doing a double bond and a single bond with other carbons. That means are bonded 3 times. The other bond (That is not represented in the figure. See the image) comes from hydrogens. As we have 6 carbons that are bonded each 1 with one hydrogen. There are six hydrogens and the molecular formula is:

This structure is: Benzene

Answer:

Calculate the moles of N2 molecules in 3.94 grams of nitrogen.

Calculate the grams of N2 in 5.03 x 1020 moles of nitrogen molecules.

Explanation:

Calculate the moles of N2 molecules in 4.73 liters of nitrogen gas. FALSE. You can't make this conversion using only the conversion factor with units of g/mol. To convert liters to moles are necessaries pressure, temperature and volume of the gas to use PV = nRT

Calculate the grams of N2 in 10.58 liters of nitrogen gas. FALSE. As explained, you need, P,V and T to find the moles of the gas. With the moles you can find the mass using the conversion factor of 28.02g/mol

Calculate the moles of N2 molecules in 3.94 grams of nitrogen. TRUE. You can find the moles of N2 as follows:

3.94g N2 * (1mol/28.02g) = 0.14 moles of N2 molecules

Calculate the grams of N2 in 5.03 x 1020 moles of nitrogen molecules. TRUE. The mass in 5.03x10²⁰ moles of nitrogen molecules is:

5.03x10²⁰ moles * (28.02g/mol) = 1.4x10²²g of nitrogen.

Answer:

The correct options are a, b and d

Explanation:

A catalyst is a substance that increases the rate of a chemical reaction by reducing the activation energy. Le Catelier's  principle explains how a substance or an "action" can affect a reaction in equilibrium.

The principle states that when a change is made to the conditions of a reacting system at equilibrium, the position of the equilibrium moves to counteract the change made. These changes are change in temperature, pressure, volume and/or concentration. These changes will either cause the equilibrium to shift forward or backward.

However, the presence of a catalyst DOES NOT affect a chemical equilibrium/equilibrium constant nor does it affect the reaction quotient because the same amount of reactants and products are available just as in uncatalyzed reaction except that the reaction proceeds faster (which does not affect equilibrium).

The rate of reaction is given as the time required by the reactant to convert into the product. The addition of catalyst increases the rate of reaction, while the reaction quotient and the equilibrium remain unaffected.

A catalyst is a chemical or compound that adds to the reaction and lowers the activation energy by providing an alternative path to the reaction.

The catalyst takes part in the reaction but did not consume in the chemical reaction.

The equilibrium and the reaction quotient are dependent on the conversion of the reactant to the product. The catalyst is not used in the reaction and thus did not affect the reaction quotient or the equilibrium.

Hence, options A, B, and D are correct for the use of catalysts in the chemical reaction.

Learn more about catalysts, here:

https://brainly.com/question/17052831

Answer:

See explanation and image attached

Explanation:

Let us recall that the reaction in question is expected to happen by SN2 mechanism. This is because, the reaction occurs at secondary carbon atom and the attacking nucleophile (N3^-) is a good nucleophile.

The reaction occurs via a backside attack of the N3^- ion on (R)-2-chloropentane. This backside attack leads to inversion of configuration at the reaction centre to yield (S)-CH3CH(N3)CH2CH2CH3.

The images of the alkyl halide and nucleophile are shown in the image attached to this answer.

Answer:

Draw structures corresponding to the following IUPAC names:(a) (Z)-2-Ethyl-2-buten-1-ol (b) 3-Cyclohexen-1-ol(c) trans-3-Chlorocycloheptanol (d) 1,4-Pentanediol(e) 2,6-Dimethylphenol (f ) o-(2-Hydroxyethyl)phenol

Explanation:

According to IUPAC rules, the name of a compound is:

Prefix+root word+suffix

1) Select the longest carbon chain and it gives the root word.

2) The substituents give the prefix.

3) The functional group gives the secondary suffix and the type of carbon chain gives the primary suffix.

The structure of the given compounds are shown below:

Answer:

I) 1 mol of SO3(g)

2) 1 mol of CO2(g)

3) 3 mol of O2(g)

4) 1 mol of KBr(aq)

5) Seawater at 23°C

6) 1 mol of CCl4(g)

Explanation:

In molecules having greater numbers of atoms, there is an increase the number of ways by which the molecule vibrates thereby leading to a higher number of possible microstates and overall increase in entropy of the system. Hence, 1 mol of SO3(g) has a higher entropy than 1 mol of SO2.

Gases have a higher entropy than liquids and liquids have a higher entropy than gases.

Also, the greater the molecular weight of a molecule, the higher the entropy. Higher number of moles of a gas as well as the increase in temperature of a substance are also factors that lead to higher entropy.

Answer:

Benzoic acid= 37.16%

Naphthalene = 24.43%

3-Nitroaniline= 29.38%

Explanation:

Data given:

percentage recovery of benzonic acid = 9.75/26.24 * 100 = 37.16%

Percentage recovery of napthalene = 6.41/26.24 * 100 = 24.43%

Percentage recovery of 3-nitroaniline = 7.71/26.24 * 100 = 29.38%

Answer:

The lone pairs on nitrogen in dimethylacetamide reside in sp3 orbitals which are coplanar with the methyl groups

Explanation:

The compound dimethylacetamide consists of oxygen bearing two lone pairs of electrons and a nitrogen atom bearing a lone pair of electrons and has two methyl groups attached to the nitrogen atom.

The lone pair on the nitrogen atom is accommodated in an sp3 orbital of nitrogen as shown in the question. This sp3 orbital is coplanar with the two methyl groups.

Answer:

True.

Explanation:

The information presented in the question above regarding linoleic acid is true. Linoleic acid is, in fact, found in many oils and fats in the ester form. In addition, linoleic acid is considered a polyunsaturated fatty acid, due to the presence of two unsaturations in its composition. Its chemical formula is CH3-(CH2)4-CH=CH-CH2-CH=CH-(CH2)7COOH and it is an essential fatty acid for the human body, as it is essential in the composition of arachidonic acid that is responsible for building muscle, managing body fat thermogenesis, and regulating core protein synthesis.

Answer:

To transfer leftover solids to the filtration funnel and wash out crystals after recrystallization, ice cold methanol should be used (the mother liquor used for recrystallization).

Explanation:

Hope this helped

The question is incomplete, the complete question his;

Which straight chain alkane below would you predict to be the most viscous? Why? All are liquids exhibiting the general bonding pattern CH3-(CH2)n-CH3

C9H20

C10H22

C5H12

C6H14

C12H26

Answer:

C12H26

Explanation:

Generally, the viscosity of a liquid increases with increase in molecular mass of the substance.

Liquids of high molecular mass do not flow easily. This means that they posses high viscosity.

Thus, since C12H26 has the highest molecular mass among the options given in the question, C12H26 exhibits the greatest viscosity.

Answer:

the product and the reactant must be balanced

if u are required to give the mechanism if the reaction it must be written

Answer:

#6  8.67x10²⁴ atoms

#7  

1. Atom

2. Formula unit

3. Molecule

4. Ion

Explanation:

#6 First we calculate how many carbon moles are there in 7.00 moles of C₂F₂, keeping in mind that there are 2 C moles per C₂F₂ mol:

As for carbon dioxide, there are 0.400 C moles in 0.400 moles of CO₂.

We calculate the total number of C moles:

Finally we calculate the number of atoms in 14.4 C moles, using Avogadro's number:

#7

Answer:

D: Increasing temperature

Explanation:

From collision theory, we know that the more the increase in collisions, the faster the rate of the chemical reaction.

Now, the amount of solid solute in a solvent will change with a corresponding change in temperature. What we mean is that, the higher the temperature increases, the higher the number of collisions between the solvent molecules as well as leading to an increase in the solute particles which will mean an increase in the amount of the solid solute dissolved. The correct answer is option D.

Answer:

Increasing temperature.

Explanation:

Answer:

S + 2CO = SO2 + 2C

First, look for the amount of substance of sulfur:

n(S) = m / M

n(S) = 14.8 g/32 g / mol = 0.4625 mol

n(CO) = m (CO) / M (CO)

M(CO) = 12 + 16 = 28 g/mol

n(CO) = 19.9 g/28 g/mol = 0.71 mol

S in excess, so for calculating we take CO:

n(SO2) = n(CO)/2 = 0.71 mol/2 = 0.355 mol

m(SO2) = M(SO2)*n(SO2)

M(SO2) = 32 + 16*2 = 64 g/mol

m(SO2) = 64 g/mol * 0.355 mol = 22.74 g

Answer:

b. glass and charcoal

Explanation:

Step 1: Given data

Step 2: Determine which material will float in molten lead

Density is an intrinsic property of matter. Less dense materials float in more dense materials. The materials whose density is lower than that of lead and will therefore float on it are glass and charcoal.

The Urms refers to the root mean square speed of the gas. The order of increasing Urms for the gases shown in the question; NF3 < H2S < H2O < He.

The Urms refers to the root mean square speed of the gas. This is ultimately dependent on the relative molecular mass of the gases when they are maintained at the same temperature.

Now, let us look at the order of increasing Urms for the gases shown in the question; NF3 < H2S < H2O < He.

Learnmore about Urms: https://brainly.com/question/365923

Answer:

Copper iodide. I think

Answer:

hope it helps

Answer:

The student completed the experiment correctly and there were no errors in the experiment.

Explanation:

When a pea size amount of Ag is dropped into a solution of HCl, the following reaction occurs;

Ag(s) + 2HCl(aq) ----> AgCl(aq) + H2(g)

The gas H2 burns with a pop sound. The gas obtained does not react to litmus. The products of the reaction are expected.

Hence, the experiment was properly conducted and the student completed the experiment correctly and there were no errors in the experiment.

Answer:

1. not enough dye was added to the drink.

The wrong dye was added to the drink

the water in the drink is evaporating

2. Changing the compound changes the absorbance behavior.

3. Measure the absorbance for the same solution in different cuvette sizes and find the y-intercept.

Explanation:

When the beverage company adds dye to the drink, there should be standard quantity added to the drink so that the color of the drink remains constant. When too much dye is added to the drink, the color will get dark brown or black. When the color of drink get lighter than green this means dye is not added in required quantity.

Answer:

dispersion force

Explanation:

Answer:

D. Two scientists may have different underlying assumptions that lead them to different conclusions about the same thing.

Explanation:

It's all about how a person analyzes data. Some do it mathmatically while others do it logically. By doing it different ways, you may still come to the same conclusion, despite working at the problem in a different way.