Zeolites theoretically can be made magnetic by adding sodium ion to them. True or False

Answers

Answer 1

The statement "Zeolites theoretically can be made magnetic by adding sodium ion to them" is true.

Zeolites are a class of microporous, aluminosilicate minerals that are commonly used for water filtration and industrial applications. It has been found that when sodium ion is added to zeolites, the magnetic properties of the zeolite are enhanced.

This is due to the strong interaction between the sodium ion and the zeolite lattice, which creates a net dipole moment. This increases the magnetic susceptibility of the zeolite, making it magnetically responsive. In conclusion, it is true that zeolites can be made magnetic by adding sodium ion to them.

for such more question on sodium ion

https://brainly.com/question/1933786

#SPJ11


Related Questions

57.0 ml of 0.90 m solution of hcl was diluted by water. the ph of this diluted solution is 0.90. how much water was added to the original solution insert your answer rounded to 3 significant figure.

Answers

57.0 ml of 0.90 m solution of Hcl was diluted by water. the pH of this diluted solution is 0.90. 50.5 mL water was added to the original solution .

There are a few steps to solve this.

Here they are: First, calculate the initial concentration of HCl in the solution.

Molarity = moles of solute / volume of solution in liters.

The volume of the solution is 57.0 mL, which is 0.0570 L.

The molarity is 0.90 M. So,0.90 M = moles of HCl / 0.0570 L

Now we can solve for moles of HCl:

moles of HCl = 0.90 M x 0.0570 L = 0.0513 mol

Next, we need to use the pH to find the concentration of H+ ions.

pH = -log[H+]0.90 = -log[H+]

Solving for [H+],

we get:[H+] = 7.94 x 10^-1 M

Finally, we can use the concentration of H+ ions to find the new volume of the solution after dilution using the equation:[H+] x V = moles of HCl7.94 x 10^-1 M x V = 0.0513 mol

Solving for V,

we get: V = 6.47 x 10^-2 L

To find how much water was added,

we subtract the final volume from the initial volume:

Volume of water added = 57.0 mL - 6.47 mL = 50.5 mL (rounded to 3 significant figures)

Therefore, 50.5 mL of water was added to the original solution.

For more such questions on pH , Visit:

https://brainly.com/question/172153

#SPJ11

A gas mixture contains each of the following gases at the indicated partial pressures:
N2= 215 torr
O2= 102 torr
He= 117 torr
a) What is the total pressure of the mixture?
b) What mass of each gas is present in a 1.35 L sample of this mixture at 25.0 C ?

Answers

a) The total pressure of the mixture is 434 torr

b) The mass of each gas is, N₂ = 40.56 g, O₂ = 21.76 g, He = 3.20 g

a) The total pressure of the mixture is calculated by adding all the values of partial pressures of the N₂, O₂, and He

215 torrs of N₂ + 102 torr of O₂ + 117 torr of He

= 434 torr

Thus, the total pressure of the mixture is 434 torr

b) The mass of each gas in the 1.35 L sample of the mixture at 25.0 C can be calculated using the ideal gas law: PV = nRT.

The amount of each gas present is equal to the total moles of gas, n, in the sample.

n = (PV)/(RT)

where P is the partial pressure of the gas in the mixture,

V is the volume of the sample (1.35 L),

R is the ideal gas constant (0.08206 L atm mol⁻¹ K⁻¹), and

T is the temperature in Kelvin (298.15 K).

For N₂: n = (215 torr x 1.35 L)/(0.08206 L atm mol⁻¹ K⁻¹ x 298.15 K) = 1.45 moles
For O₂: n = (102 torr x 1.35 L)/(0.08206 L atm mol⁻¹ K⁻¹ x 298.15 K) = 0.68 moles
For He: n = (117 torr x 1.35 L)/(0.08206 L atm mol⁻¹ K⁻¹ x 298.15 K) = 0.80 moles

The mass of each gas is equal to the moles multiplied by the molar mass of the gas:

For N₂: 1.45 moles x 28.01 g/mol = 40.56 g
For O₂: 0.68 moles x 32.00 g/mol = 21.76 g
For He: 0.80 moles x 4.00 g/mol = 3.20 g

Thus, the mass of each gas is, N₂ = 40.56 g, O₂ = 21.76 g, He = 3.20 g.

Learn more about partial pressure here:

https://brainly.com/question/14119417

#SPJ11

20pcm3 og a gas has a pressure of 510mmhg what will be the volume of the pressure is increased to 780mmhg, assuming there is no change in temperature​

Answers

The volume of the gas will decrease from 20 cm³ to 13.08 cm³.

What is Boyle's law?

Boyle's law is a gas law that states that the product of the pressure and volume of a gas is constant at constant temperature.

What is the significance of assuming no change in temperature in this problem?

Assuming no change in temperature is significant because it allows us to apply Boyle's law to solve the problem. If the temperature were to change, we would need to use a different gas law, such as Charles's law or the combined gas law, to account for the change in temperature.

We can use Boyle's law to solve this problem, which states that the product of the pressure and volume of a gas is constant at constant temperature. Mathematically, we can express this as P₁V₁ = P₂V₂, where P₁ and V₁ are the initial pressure and volume, respectively, and P₂ and V₂ are the final pressure and volume, respectively.

Using this equation, we can solve for V₂:

P₁V₁ = P₂V₂

V₂ = (P₁V₁)/P₂

Substituting the given values, we get:

V₂ = (510 mmHg x 20 cm³) / 780 mmHg

V₂ = 13.08 cm³

Therefore, if the pressure is increased from 510 mmHg to 780 mmHg at constant temperature, the volume of the gas will decrease from 20 cm³ to 13.08 cm³.

Learn more about Boyle's law here:

https://brainly.com/question/30367133

#SPJ1

Tripling the concentration of a reactant increases the rate of a reaction nine times. With this knowledge, answer the following questions: (a) What is the order of the reaction with respect to that reactant?
(b) Increasing the concentration of a reactant by a factor of four increases the rate of a reaction four times. What is the order of the reaction with respect to that reactant?

Answers

Answer:

a) Tripling the concentration of a reactant increases the rate of a reaction nine times.the order of the reaction with respect to that reactant is 2

b)Increasing the concentration of a reactant by a factor of four increases the rate of a reaction four times.the order of the reaction with respect to that reactant is 1.

Explanation:

a) The order of the reaction with respect to that reactant is 2. The rate law of the reaction with the stoichiometric coefficients a, b, and c would be as follows:

rate = k[A]^x[B]^y[C]^z

Where k is the rate constant and x, y, and z are the orders of the reaction with respect to the corresponding reactants. When [A] is tripled, the rate increases nine times, indicating that the rate is proportional to [A]^2. Therefore, the order of the reaction with respect to [A] is 2.

b) The order of the reaction with respect to that reactant is 1. The rate law of the reaction with the stoichiometric coefficients a, b, and c would be as follows:

rate = k[A]^x[B]^y[C]^z

When [A] is quadrupled, the rate increases four times, indicating that the rate is proportional to [A]. Therefore, the order of the reaction with respect to [A] is 1.

To know more about concentration of a reactant refer here:https://brainly.com/question/4600091#
#SPJ11

Two protons are fired toward each other in a particle accelerator, with only the electrostatic force acting. Which of the following statements must be true about them as they move closer together? (There could be more than one correct choice.)
a. Their kinetic energy keeps increasing.
b. Their acceleration keeps decreasing.
c. Their kinetic energy keeps decreasing.
d. Their electric potential energy keeps decreasing.
e. Their electric potential energy keeps increasing.

Answers

When two protons are fired toward each other in a particle accelerator, with only the electrostatic force acting, then their kinetic energy keeps increasing, acceleration keeps decreasing, kinetic energy keeps decreasing, electric potential energy keeps decreasing.

How does the electrostatic force act?

The electrostatic force is a force that arises between electrically charged objects. It is the force exerted on a charged particle by other charged particles or electromagnetic fields. It is a fundamental force in nature that has an infinite range and can be either attractive or repulsive. The strength of the electrostatic force is proportional to the inverse square of the distance between the charged particles. As two charged particles move closer together, the force between them increases. Therefore, as the two protons move closer together, their kinetic energy and electric potential energy will increase.

According to Coulomb's law, the electrostatic force is inversely proportional to the square of the distance between the two charges. Therefore, as the distance between the two protons decreases, the electrostatic force acting between them will increase. As a result, their acceleration will keep decreasing. At the same time, as the protons move closer together, their kinetic energy will keep increasing while their electric potential energy will keep decreasing.

Learn more about Electrostatic force here:

https://brainly.com/question/9774180

#SPJ11

Identify the compound with atoms that have an incomplete octet.A) BF3B) ICl5C) CO2D) COE) Cl2

Answers

(A) BF3 is the compound having atoms that are missing one or more of their octets.

According to the octet rule, atoms typically link together in molecular structures so that each atom has eight electrons in its outermost valence shell. There are, however, several exceptions to this rule. One such example is boron trifluoride (BF3). Boron can only form three bonds since it only possesses three valence electrons. In BF3, boron makes three covalent connections with three fluorine atoms, giving rise to six rather than the anticipated eight electrons in the outer shell of the atom. As a result, boron in BF3 has an unfinished octet. Since the atoms in such compounds are not quite content with their electron arrangement, they are more prone to engage in chemical processes in order to complete their octets.

learn more about octets here:

https://brainly.com/question/10535983

#SPJ4

calculate the percent ionization of a 0.125 m solution of nitrous acid (a weak) acid, with the ph of 2.0

Answers

When the pH of a solution is given and the solution is of a weak acid, you can use the pH to find the percent ionization.

The percent ionization for a weak acid is calculated by the formula:

% ionization = Ka / [HA] x 100.

Ka is the acid dissociation constant, and [HA] is the initial concentration of the weak acid. In this case, we have nitrous acid (HNO2), which is a weak acid with a dissociation constant of 4.5 x 10⁻⁴.

To calculate the percent ionization of a 0.125 M solution of nitrous acid (HNO2) with a pH of 2.0, we can first use the pH to find the concentration of H+ in the solution,

then use that to calculate the concentration of HNO2 (the weak acid), and finally use both of those values to calculate the percent ionization. Step-by-step explanation:

From the pH, we know that: pH = -log[H+]. Rearranging this equation gives us: [H+] = 10⁻⁴ pH. Plugging in the pH of 2.0, we get: [H+] = 10⁻².0 = 0.01 M. Since HNO2 is a weak acid, it does not dissociate completely in the solution.

Instead, it dissociates according to the equation:

HNO₂ + H₂O ↔ H₃O+ + NO₂⁻.

The equilibrium constant expression for this reaction is Ka = [H3O+][NO2-] / [HNO2]. Since HNO2 is a weak acid, we can assume that it does not dissociate completely, so the concentration of HNO2 at equilibrium will be equal to the initial concentration.

Therefore, we can simplify the expression to Ka = [H3O+]² / [HNO2].

Rearranging this equation gives us: [HNO2] = [H3O+]² / Ka. Plugging in the values we found above, we get [HNO2] = (0.01 M)² / 4.5 x 10⁻⁴ = 0.222 M.

Now we can use both the concentration of HNO2 and the dissociation constant to calculate the percent ionization using the formula: % ionization = Ka / [HA] x 100.

Plugging in the values we found above, we get % ionization = 4.5 x 10⁻⁴ / 0.125 M x 100 = 0.36%.

Therefore, the percent ionization of a 0.125 M solution of nitrous acid (HNO2) with a pH of 2.0 is 0.36%.

Learn more about percent ionization at brainly.com/question/14225136

#SPJ11

If 50 grams of water are saturated at 90°C with potassium nitrate and then cooled to 40°C, how much will precipitate?

Answers

Answer:

43.1gramms

Explanation:

change the temperatures to kelvin

90--363

40--313

50grams of water are saturated at 90 degree celcius.

then,

50___363

x_____313

then cross multiply

363x=15650

divide both sides by 363

x=43.1gramms

If a substance is removed from a reaction in equilibrium, the equilibrium will shift toward
the side where the concentration was ________.

Answers

If a substance is removed from a reaction in equilibrium, the equilibrium will shift towards the side where the concentration was higher.

What is substance?

A substance is a category of stuff with certain physical and chemical qualities as well as a set or definite composition. A substance might be an element or a compound. A substance made up of atoms with the same atomic number, or the same number of protons in their atomic nuclei, is referred to as an element.

This is known as the Le Chatelier's principle, which holds that a system in equilibrium would react to any stress by trying to counteract the stress and return to equilibrium. When a drug is removed from the reaction mixture, the system is put under stress due to the substance's lower concentration. The balance will change in a way that increases the production of the substance that was eliminated in order to counteract this drop.

To know more about substance, visit:

https://brainly.com/question/24372098

#SPJ1

calculation and give the answers to the correct number of significant figures.
Part A
1.72×10−3/7.9×1021.72×10−3/7.9×102
Express your answer to the correct number of significant figures.
Activate to select the appropriates template from the following choices. Operate up and down arrow for selection and press enter to choose the input value typeActivate to select the appropriates symbol from the following choices. Operate up and down arrow for selection and press enter to choose the input value type
nothing
SubmitRequest Answer
Part B
1.98×10−2+1×10−4−3.5×10−31.98×10−2+1×10−4−3.5×10−3
Express your answer to the correct number of significant figures.
Activate to select the appropriates template from the following choices. Operate up and down arrow for selection and press enter to choose the input value typeActivate to select the appropriates symbol from the following choices. Operate up and down arrow for selection and press enter to choose the input value type
nothing
SubmitRequest Answer
Part C
[(1.38×105)(0.000318)/0.080](115.2)[(1.38×105)(0.000318)/0.080](115.2)
Express your answer to the correct number of significant figures.

Answers

The answer is 2.19×10−2 with three significant figures. The correct number of significant figures is determined by the data with the least amount of significant figures, which in this case is 0.080.

What is figure?

Figure is a term that is used to describe a shape, design, pattern, or form. It can also be used to refer to a diagram or an illustration. Figures are used to explain and illustrate concepts, facts, and phenomena in various fields of study, including mathematics, science, and the humanities. Figures are also used in art, design, and architecture to create visual compositions that have a certain aesthetic appeal. They can be used to represent ideas, concepts, and emotions.

Since 0.080 has three significant figures, the answer must also be rounded to three significant figures.

To learn more about figure
https://brainly.com/question/29827869
#SPJ1

The answer is 2.19×10⁻² with three significant figures. The correct number of significant figures is determined by the data with the least number of significant figures, which in this case is 0.080.

What is figure?

Figure is a term that is used to describe a shape, design, pattern, or form. It can also be used to refer to a diagram or an illustration. Figures are used to explain and illustrate concepts, facts, and phenomena in various fields of study, including mathematics, science, and the humanities. Figures are also used in art, design, and architecture to create visual compositions that have a certain aesthetic appeal. They can be used to represent ideas, concepts, and emotions.

Since 0.080 has three significant figures, the answer must also be rounded to three significant figures.

To learn more about figure, visit:

brainly.com/question/29827869

#SPJ1

Electrons that inhabit different orbitals must have a different value for the:
a. principal quantum number
b. angular momentum quantum number
c. spin quantum number
d. none of the above

Answers

Answer:

D

Explanation:

I had this question before :)

The acceleration of a particle in an electric field depends on the charge-to-mass ratio of the particle.(a) compute e / m for a proton and find its acceleration in a uniform electric field of magnitude 100 n / c. (b) find the time it takes for a proton initially at rest in such a field to reach the speed of 0.01c

Answers

Answer:91

Explanation:because I am just very smart and this is the answer <3

What is the apparent brightness of a star?

Answers

I suppose how dazzling the star appear to a meter here on Earth. On the opposing hand, a star's brightness refers to how much light is emitted from its surface.

What is a star's apparent and absolute brightness?

absolute magnitude: the amount of brightness a star would have at a given distance. The brightness of a galaxy seen from the Earth is known as its apparent magnitude.

What are apparent and actual brightness?

Because of this, the sample's name, "apparent" brightness, refers to the brightness of things as seen from our vantage point rather than their actual or "true" brightness. Astronomers must measure a star's luminosity, or absolute brightness, in to understand the precise amount of heat it emits.

To know more about light  visit:

https://brainly.com/question/14459326

#SPJ1

Now let's try one without any help from the simulation. Write a balanced chemical equation for the combustion reaction of ethane gas (C2H6) and oxygen gas (O2), then answer the following questions:(o) How many moles of carbon dioxide are produced from the combustion of 6.20 moles of ethane gas? (You may assume you have an excess of oxygen gas)(p) How many moles of carbon dioxide are produced from the combustion of 3.92 moles of oxygen gas? (You may assume you have an excess of ethane gas)(q) How many moles of carbon dioxide are produced from the combustion of 6.20 moles of ethane gas with 3.92 moles of oxygen gas?(r) How much excess reactant remains after the reaction described in (q)?(s) How much excess reactant remains after the combustion of 6.10 moles of ethane gas with 5.69 moles of oxygen gas?

Answers

The reaction is given by:C2H6(g) + 3O2(g) → 2CO2(g) + 3H2O(g), o) From the balanced chemical equation, we can see that 1 mole of ethane gas reacts with 3 moles of oxygen gas to produce 2 moles of carbon dioxide gas.  3.92 moles of oxygen gas will react with (1/3) × 3.92 = 1.307 moles of ethane gas. This will produce 1.307 × 2 = 2.614 moles of carbon dioxide gas. q) 6.20 moles of ethane gas will react with 6.20 × 3 = 18.60 moles of oxygen gas. This will produce 6.20 × 2 = 12.40 moles of carbon dioxide gas.r) This means that all the oxygen gas will be consumed in the reaction. Therefore, there will be no excess oxygen gas remaining after the reaction. s) 4.203 moles of ethane gas will be in excess after the reaction.

The equation is now balanced as there are equal numbers of each type of atom on both sides of the equation. 6.20 moles of ethane gas will react with 6.20 × 3 = 18.60 moles of oxygen gas. This will produce 6.20 × 2 = 12.40 moles of carbon dioxide gas. From the balanced chemical equation, we can see that 3 moles of oxygen gas react with 1 mole of ethane gas to produce 2 moles of carbon dioxide gas. Therefore From the balanced chemical equation, we can see that 1 mole of ethane gas reacts with 3 moles of oxygen gas to produce 2 moles of carbon dioxide gas.

From the balanced chemical equation, we can see that 1 mole of ethane gas reacts with 3 moles of oxygen gas to produce 2 moles of carbon dioxide gas. Therefore, 5.69 moles of oxygen gas will react with (1/3) × 5.69 = 1.897 moles of ethane gas. This will produce 1.897 × 2 = 3.794 moles of carbon dioxide gas. This means that 6.10 − 1.897 = 4.203 moles of ethane gas will be in excess after the reaction.

To know more about carbon dioxide gas visit:-

https://brainly.com/question/30615378

#SPJ11

What is the hybridization of the carbon that is attached to the oxygens in CH;COOH (acetic acid)? 4) Which molecule has the greatest dipole moment? A. CCl B. CH,Clz C. CFa D. BrzCClz CH,Fz

Answers

The carbon that is attached to the oxygens in CH₃COOH (acetic acid) is sp2 hybridized. This is because it is attached to three atoms (one oxygen and two hydrogens) and has a trigonal planar geometry.

The molecule with the greatest dipole moment is CH₂Cl₂(dichloromethane) because it has a tetrahedral geometry and the two C-Cl bonds are oriented in opposite directions, creating a net dipole moment. The other molecules (CCl₄, CF₄, and Br₂CCl₂) are all symmetric and have zero dipole moment.

A chemical concept known as hybridization describes the bonding and geometry of molecules. It entails combining atomic orbitals to create hybrid orbitals, which can more accurately capture the bonding in a molecule. The number of hybrid orbitals formed is equal to the number of atomic orbitals combined. Atomic orbitals with similar energy levels are merged to create the hybrid orbitals. An atom's geometry, bond angles, and polarity can all be impacted by hybridization, which can then have an impact on the molecule's reactivity and physical characteristics. Foreseeing the forms and characteristics of molecules as well as explaining their chemical behaviour requires an understanding of atom hybridization.

Learn more about hybridization here:

https://brainly.com/question/30010106

#SPJ4

Is the distance between the electron and the nucleus fixed for an electron in a specific orbit in the Bohr model of the atom? Is this distance fixed for an electron in a specific orbital? Bohr model, fixed; in an orbital, not fixed.

Answers

The distance between an electron and the nucleus for an electron in a certain orbit is set in the Bohr model of the atom. According to Bohr's hypothesis, electrons travel in circular orbits around the nucleus at set distances that represent various energy levels.

These orbits are also known as "energy levels" or "stationary states."

For an electron in a certain orbit, the distance between the electron and the nucleus is set in the Bohr model of the atom. In accordance with Bohr's hypothesis, electrons orbit the nucleus in a circle at regular intervals that correspond to various energy levels. Sometimes these orbits are referred to as "energy levels" or "stationary states." The electron's location is instead defined by a probability distribution known as an orbital in more recent quantum mechanical models of the atom, such as the Schrödinger equation. In contrast to the fixed orbits in the Bohr model, an orbital's size and shape can change depending on the energy of the electron and the arrangement of the atoms.

learn more about Bohr model of the atom here:

https://brainly.com/question/11299441

#SPJ4

calculate the total percent recovery. show calculation with units and correct significant digits. why do we expect that the percent recovery will be less than 100 % for this experiment?

Answers

The percent recovery is the ratio of the actual amount of the desired substance to the original amount present. The total percent recovery can be calculated by using the formula given below.

The units and the correct significant digits should be used in the calculation. We expect that the percent recovery will be less than 100 % for this experiment because of the loss of product due to impurities or mistakes in the experimental procedure. For example, if the product is left on the filter paper while washing, then the actual yield will be less than the theoretical yield.

Calculate the total percent recovery. show calculation with units and correct significant digits. The percent recovery formula is:

Percent recovery = Actual yield ÷ Theoretical yield × 100%

Given, Actual yield = 70 theoretical yield = 80

percentage recovery = Actual yield ÷ Theoretical yield × 100 %

Percentage recovery = 70 ÷ 80 × 100 %

Percentage recovery = 0.875 × 100 %

Percentage recovery = 87.5 %

Therefore, the total percent recovery is 87.5 % with the correct significant digits. Why do we expect that the percent recovery will be less than 100 % for this experiment? We expect that the percent recovery will be less than 100 % for this experiment because of the loss of product due to impurities or mistakes in the experimental procedure.

Learn more about  percent recovery at brainly.com/question/14972210

#SPJ4

Can any help with this chemistry question?? I have an exam tomorrow

Answers

Answer:

Explanation:

To calculate the standard enthalpy of formation for TICL(I), we need to use the given thermochemical equations and Hess's law. The equation for the formation of TICL(I) is:

C(s) + TiO₂ (s) + 2Cl(g) → TICL(I) + CO(g)

Using the given equations for the formation of CO(g) and TiO2(s), we can manipulate them to get the necessary reactants for the formation of TICL(I):

Ti(s) + O₂(g) → TiO₂(s) (reverse the equation)

C(s) + 1/2O₂(g) → CO(g) (multiply by 2)

Adding these two equations, we get:

Ti(s) + 2C(s) + O₂(g) → TiO₂(s) + 2CO(g)

This equation is the reverse of the equation given for the formation of TICL(I), so we need to flip its sign to get the correct value for the enthalpy change:

TICL(I) → C(s) + TiO₂ (s) + 2Cl(g) + CO(g)

ΔH° = -(-394 kJ/mol + 286 kJ/mol + 0 + (-221 kJ/mol))

ΔH° = -(-329 kJ/mol)

ΔH° = +329 kJ/mol

Therefore, the correct value for the standard enthalpy of formation for TICL(I) is +329 kJ/mol, which is option D.

Practice Problem 11.15b Propose an efficient synthesis for the following transformation. y The transformation above can be performed with some reagent or combination of the reagents listed below. Give the necessary reagent(s) in the correct order, as a string of letters (without spaces or punctuation, such as "EBF"). If there is more than one correct solution, provide just one answer. A B с Br2 HBr, ROOR cat. OsO4, NMO D HBr E H2, Pd F H2SO4, H2O, HgSO4 I 1) O3; 2) DMS H 1) xs NaNH2, 2) H20 1) R2BH; 2) H2O2, NaOH Practice Problem 11.18d Propose an efficient synthesis for the following transformation. The transformation above can be performed with some reagent or combination of the reagents listed below. Give the necessary reagent(s) in the correct order, as a string of letters (without spaces or punctuation, such as "EBF"). If there is more than one correct solution, provide just one answer. B с HBr, ROOR 1) O3; 2) DMS Br2, hv F D H2S04, H20, HgSO4 E H2, Lindlar's cat. HC=CNa I G HBr H NaOme 1) R2BH; 2) H2O2, NaOH Practice Problem 11.21a X Incorrect. Propose an efficient synthesis for the following transformation. The transformation above can be performed with some reagent or combination of the reagents listed below. Give the necessary reagent(s) in the correct order, as a string of letters (without spaces or punctuation, such as "EBF"). If there is more than one correct solution, provide just one answer. A B HBr, ROOR HC=CNa 1) R2BH; 2) H2O2, NaOH D HBr E CH3CH2Br H2S04, H2O, HgSO4 G NaOH н conc. H2SO4, heat I 1) LiAlH4; 2) H307 Practice Problem 11.21b Propose an efficient synthesis for the following transformation. :- The transformation above can be performed with some reagent or combination of the reag spaces or punctuation, such as "EBF"). If there is more than one correct solution, provide j B с t-BuOK 1) O3; 2) DMS Br2, hv D H2SO4, H20, HgSO4 E H2, Lindlar's cat. F HC=CNa H HBr, ROOR HBr I 1) R2BH; 2) H202, NaOH Practice Problem 11.21c Propose an efficient synthesis for the following transformation. SOH The transformation above can be performed with some reagent or combination of the reagents listed below. Give the necessary reagent(s) in the correct order, as a string of letters (without spaces or punctuation, such as "EBF"). If there is more than one correct solution, provide just one answer. B с HBr, ROOR HC=CNa 1) R2BH; 2) H202, NaOH F D HBr E CH3CH2Br H2SO4, H20, HgSO4 I G NaOH H conc. H2S04, heat 1) 03; 2) H20 Propose an efficient synthesis for the following transformation. - li The transformation above can be performed with some reagent or combination of the reagents listed below. Give the necessary reagent(s) in the correct order, as a string of letters (without spaces or punctuation, such as "EBF"). If there is more than one correct solution, provide just one answer. А B HBr conc. H2S04, heat HC=CNa D HBY, ROOR E Hy, Lindlar's cat. 1) O3; 2) DMS G Brą, hv H dilute H2SO4 I H2, Pt Practice Problem 11.25a Propose an efficient synthesis for the following transformation: % Br The transformation above can be performed with some combination of the reagents listed below. Give the necessary reagents in the correct order for each transformation, as a string of letters (without spaces or punctuation, such as "EBF"). If there is more than one correct solution, provide just one answer. А t-BuOK B OsO4, NMO c 1) O3; 2) DMS D H2, Pt E H2, Lindlar's cat F xs HBr I G 1) BH 3.THF; 2) H202, NaOH H MeONa Br2, hv Reagent(s);

Answers

The reagent(s) for the given transformation is "A B C D E F G H I", which is t-BuOK, OsO4, NMO, O3, DMS, H2, Pt, H2, Lindlar's cat., xs HBr, BH3.THF, H202, NaOH, MeONa, Br2, hv.

What is transformation?

Transformation is the process of changing something into a different form or state. It can involve altering the physical characteristics, behaviors, attitudes, or perceptions of an entity. Transformation is a process that occurs in a variety of contexts including business, education, technology, and personal development.

A) t-BuOK - For the given transformation, the initial step is to add an alkoxide, here t-BuOK, to the starting material.
B) OsO4, NMO - After the addition of the alkoxide, the resulting intermediate has to be oxidized by OsO4 and NMO reagents.
C) 1) O3; 2) DMS - The intermediate then has to be ozonolyzed using ozone and dimethyl sulfide (DMS).
D) H2, Pt - The ozonolysis will result in a mixture of aldehyde and ketone. The aldehyde has to be hydrogenated using H2 and Pt.
E) H2, Lindlar's cat. - The ketone has to be hydrogenated using H2 and Lindlar's catalyst.
F) xs HBr - The product of the hydrogenation has to be converted to a tertiary alcohol by an elimination reaction with HBr.
G) 1) BH3.THF; 2) H202, NaOH - The tertiary alcohol has to be oxidized to a tertiary ketone using BH3.THF, H202 and NaOH.
H) MeONa - The tertiary ketone has to be methylated using MeONa.
I) Br2, hv - The product of the methylation has to be brominated using Br2 and heat.
Therefore, the reagent(s) for the given transformation is "A B C D E F G H I", which is t-BuOK, OsO4, NMO, O3, DMS, H2, Pt, H2, Lindlar's cat., xs HBr, BH3.THF, H202, NaOH, MeONa, Br2, hv.

To learn more about transformation
https://brainly.com/question/382594
#SPJ1

a.) Determine whether potassium hydrogen tartrate (KHC4H4O6) is neutral, basic, or acidic. First, what is its Ka when it acts as an acid? The following are for the diprotic acid, H2C4H4O6: Ka1 = 1.0 x 10-3 and Ka2 = 4.6 x 10-5. b.) Second, what is its Kb when it acts as a base? c.) Finally, indicate whether the HC4H4O6- ion is neutral, basic, or acidic in solution.

Answers

a) potassium hydrogen tartrate (KHC4H4O6) is acidic. Ka is calculated for the acidic characteristics of the molecule. When a proton is donated by the molecule to water, it forms the ion HCO4-. b) Kb = [C4H4O6-2][OH-]/[HC4H4O6-], Kb = (1.0 × 10-11) × [C4H4O6-2][OH-]/[HC4H4O6-]. c) As the ion HC4H4O6- is an acidic ion, it will have acidic characteristics in solution. It is because the ion can donate protons and act as an acid.

Kb is calculated for the basic characteristics of the molecule. The balanced chemical equation for the reaction is as follows:HC4H4O6-(aq) + H2O(l) ⇌ C4H4O6-2(aq) + OH-(aq)The Kb is determined using the equation given below : Kb = [C4H4O6-2][OH-]/[HC4H4O6-]The Ka value is calculated as shown below: Kb = [C4H4O6-2][OH-]/[HC4H4O6-]Kb = (1.0 × 10-11) × [C4H4O6-2][OH-]/[HC4H4O6-]

The balanced chemical equation for the reaction is as follows: HC4H4O6(aq) + H2O(l) ⇌ HCO4-(aq) + H3O+(aq)The Ka is determined using the equation given below : Ka = [HCO4-][H3O+]/[HC4H4O6]Ka = (1.0 × 10-3) × [HCO4-][H3O+]/[HC4H4O6]. Therefore, the Ka value is not given.

Know more about potassium hydrogen tartrate here:

https://brainly.com/question/11127999

#SPJ11

What are the best dopants that are added to silicon as a means of creating a quality semiconductor? Elements with the same number of valence electrons as silicon. Elements that are radioactive. Elements with one more or one fewer valence electron than silicon. Elements in the same row of periodic table as silicon.

Answers

Answer:

boron (3 valence electrons = 3-valent) and phosphorus (5 valence electrons = 5-valent).

acid strength decreases in the series: hi (strongest), hbr, hcl hf (weakest) each acid has its conjugate base, i-, br-, cl-, f-, respectively. which is the weakest base?

Answers

The weakest base is F-. The series of acids arranged in the decreasing order of their strengths are H1, HBr, HCl, and HF.

Their corresponding conjugate bases arranged in the decreasing order of their strengths are I-, Br-, Cl-, and F-.Thus, F- is the weakest base. It is because the series arranged in the decreasing order of their basic strengths are I-, Br-, Cl-, and F-. The basic strength of the anion decreases from top to bottom of the periodic table due to the decreasing electronegativity of the element to which the anion is attached.

Learn more about acids: https://brainly.com/question/25148363

#SPJ11

according to the beer-lambert law, as the concentration decreases so should the absorbance. true false

Answers

According to the Beer-lambert law, as the concentration of a substance decreases so should the absorbance of the solution. Thus, the given statement is true.

What is the Beer-lambert law?

The Beer-Lambert Law, also known as Beer's Law, Lambert's Law, or the Beer-Lambert-Bouguer Law, is a linear relationship between the attenuation of light and the properties of the material through which the light is traveling.

The Beer-Lambert Law relates the attenuation of light to the properties of the material it travels through. When light passes through a material, it is absorbed, reflected, or scattered in different amounts. The Beer-Lambert Law explains the attenuation of light as a result of the following factors:

Attenuation of light = Absorption of light + Scattering of light + Reflection of light

The Beer-Lambert Law states that the concentration of a material is directly proportional to the amount of light it absorbs. Absorbance decreases as the concentration of the solution decreases according to the Beer-Lambert Law.

Hence, the given statement is true.

Learn more about Beer-lambert law here:

https://brainly.com/question/30404288


#SPJ11

If a solid piece of shiny sodium metal is exposed to chlorine gas, a large amount of heat is released and the white solid sodium chloride (table salt) forms. Based on this information, which of the following statements is TRUE? A) This process was exothermic_ B) This process represents a physical change: C) Mass is lost during this process_ D) This process was endothermic_

Answers

Option A is the correct statement for the process was exothermic that a large amount of heat is released when sodium metal is exposed to chlorine gas.

What happens when sodium is exposed to chlorine? Sodium metal reacts with chlorine gas to produce sodium chloride. When solid shiny sodium metal is exposed to chlorine gas, a large amount of heat is generated, and the white solid sodium chloride (table salt) is formed. So the process is an exothermic reaction.A chemical reaction in which heat is given out, such as the one between sodium and chlorine, is exothermic. When the products' energy is less than the reactants' energy, energy is given out from the system into the surroundings, resulting in an increase in temperature in the surroundings. Therefore, this process was an exothermic and the correct option is 'A'.

Learn more about sodium chloride: https://brainly.com/question/28106660

#SPJ11

what is BEFORE and AFTER when you put the baking soda in vinegar?​

Answers

When you mix baking soda and vinegar, a chemical reaction occurs that produces carbon dioxide gas, water, and a type of salt called sodium acetate.

What happens at the mixing of baking soda in vinegar?​

Before: Before mixing baking soda and vinegar, they are both in their separate states. Baking soda is a white powder, and vinegar is a clear liquid.

During: When you mix the baking soda and vinegar, the baking soda (sodium bicarbonate) reacts with the vinegar (acetic acid) to produce carbon dioxide gas (CO2), water (H2O), and sodium acetate (NaC2H3O2).

After: After the chemical reaction has taken place, you will see bubbles of carbon dioxide gas being released. The solution will also become cloudy as the sodium acetate precipitates out. The resulting mixture may feel warmer due to the exothermic nature of the reaction (meaning it releases heat).

Learn more about baking soda in vinegar:https://brainly.com/question/2427021

#SPJ1

Which one of the following salts, when 1 mole is dissolved in water, produces the solution with a pH closest to 7.00? A) NH4BR B) NaHSO4 C) NaF D) Ba O E) LiOH

Answers

When NaF is dissolved in water, it undergoes hydrolysis to form Na+ and F- ions. The resulting solution is slightly basic, with a pH slightly greater than 7. The correct answer is C) NaF.

What are salts?

Salts are ionic compounds formed from the reaction between an acid and a base. They are composed of positively charged ions (cations) and negatively charged ions (anions). Salts are typically solid at room temperature and have high melting and boiling points.

When dissolved in water, salts can dissociate into their component ions, allowing them to conduct electricity. Some common examples of salts include table salt (NaCl), baking soda (NaHCO3), and Epsom salt (MgSO4).

When NaF is dissolved in water, it undergoes hydrolysis to form Na+ and F- ions. The F- ions react with water molecules to form HF and OH- ions. The resulting solution is slightly basic, with a pH slightly greater than 7.

Learn more about salts here https://brainly.com/question/13818836

#SPJ1

2. write the mechanism for the nitration of toluene showing explicitly why ortho and para products are favored over meta.

Answers

Nitration of toluene takes place in four steps which include formation of nitronium ion, formation of electrophile, deprotonation, and elimination of  HNO₃.

What is the mechanism of nitration?

The mechanism for the nitration of toluene showing explicitly why ortho and para products are favored over meta is as follows:

Step 1: Formation of the Nitronium Ion

NO₂⁺ is formed by nitric acid's reaction with sulfuric acid.

2HNO₃ + H₂SO₄ → 2 NO₂⁺ + 2HSO₄⁻ + H₃O⁺

The following is the formation of a nitronium ion:

Step 2: Formation of the electrophile

A nitronium ion is created, which is the electrophile. Because of the strong electron-releasing effect of the methyl group, the nitronium ion is drawn to the ring.

Due to the stability of the resulting carbocation, ortho and para products are favored over meta. In this, the bond on the methyl carbon is broken and the electrophile is added to it:

Step 3: Deprotonation: After the nitration reaction, an intermediate is formed in which a proton has been extracted from the methyl group. The formation of this intermediate indicates that the electrophile has been added to the ring's ortho or para positions.

Step 4: Elimination of HNO₃: An acid base reaction occurs to complete the nitration process, yielding nitrotoluene, HNO₃, and sulfuric acid. Here the intermediate is used to illustrate that the reaction has occurred with the ortho product. This reaction may also result in a para product in a similar manner.

Learn more about Nitration here:

https://brainly.com/question/26927899

#SPJ11

What procedures can be performed on trials 2 and 3 so that the rate of dissolving is the same as trial 1? A student wants to determine how different factors affect the rate of dissolving solid in water: Trial Size of Particles Rate_of_Dissolving small 10 sec medium 20 sec large 30 sec 2 3 What procedures can be performed on trials 2 and 3 so that the rate of dissolving is the same as trial 1? A_ the student can increase the pressure B. the student can decrease the pressure C the student can decrease the temperature D. the student can increase the temperature'

Answers

The size of particles has an effect on the rate of dissolving, but temperature is also a significant factor that affects how quickly a solid will dissolve in water. Lowering the temperature slows down the movement.

What is the temperature ?

Temperature is a measure of the average kinetic energy of the particles in a substance or system. In simpler terms, it is a measure of how hot or cold something is. The temperature of a substance or system is commonly measured in degrees Celsius (°C) or degrees Fahrenheit (°F), and it can be influenced by various factors such as heat transfer, pressure, and the presence of other substances. Temperature is an important physical property that affects many aspects of daily life, including weather patterns, cooking, and the functioning of electronic devices. It is also a critical factor in many scientific processes, such as chemical reactions, phase transitions, and the behavior of materials at the atomic and molecular level.

To know more about temperature visit:

https://brainly.com/question/11464844

#SPJ1

The ability of an atom during bond formation to attract electrons from its bonding partner
-The higher it is, the stronger the atom's electron attracting ability
-Nonmetals are higher (gain electrons while metals lose them)
-Electronegativities increase from left to right across periodic table rows and decrease as you move down a column
-Fluorine is the most electronegative element, Francium is the least

Answers

The ability of an atom during bond formation to attract electrons from its bonding partner is called electronegativity. The higher the electronegativity of an atom, the stronger its electron-attracting ability.

Let's understand this in detail:

Electronegativity is the power of an atom or molecule to attract electrons to itself in a covalent bond. An atom's electronegativity is influenced by its atomic number, the number of protons in the atom's nucleus.

The electronegativity of an atom is higher when its valence shell is nearly empty or nearly full.

Electronegativity increases from left to right across a period because of the increasing effective nuclear charge, which is the force of attraction between the positively charged atomic nucleus and the negatively charged electrons.

Electronegativity decreases down a group due to the increasing distance between the valence electrons and the positively charged nucleus.

Francium has the lowest electronegativity, while fluorine has the highest electronegativity.

Learn more about electronegativity: What is electronegativity and how can it be used in determining the polarity of nonpolar​? https://brainly.com/question/18258838

#SPJ11

vinegar is a solution of acetic acid, hc2h3o2, dissolved in water. a 5.54-g sample of vinegar was neutralized by 30.10 ml of 0.100 m naoh. what is the percent by weight of acetic acid in the vinegar?

Answers

The percent by weight of acetic acid in the vinegar is  3.27% for the given 5.54-g sample of vinegar was neutralized by 30.10 ml of 0.100 m NaOH.

What is the percent of weight of acetic acid?

Vinegar is a solution of acetic acid, HC₂H₃O₂, dissolved in water. A 5.54-g sample of vinegar was neutralized by 30.10 mL of 0.100 M NaOH. Find the percentage of acetic acid by weight in vinegar. As per the question, vinegar is a solution of acetic acid, HC₂H₃O₂, dissolved in water.

A 5.54-g sample of vinegar was neutralized by 30.10 mL of 0.100 M NaOH.

Since NaOH and HC₂H₃O₂ reacts in a 1:1 molar ratio, moles of NaOH used = moles of HC₂H₃O₂ in vinegar

So,0.100 mol/L solution of NaOH = 0.100 mol/L solution of HC₂H₃O₂ in vinegar (as they react in 1:1 ratio).

Also, Volume of NaOH = 30.10 mL = 30.10/1000 = 0.0301L

Thus, Amount of HC₂H₃O₂ in vinegar = 0.100 mol/L × 0.0301 L = 0.00301 mol.

Molar mass of HC₂H₃O₂ = 60.05 g/mol.

Weight of HC₂H₃O₂ in 5.54 g vinegar = 0.00301 mol × 60.05 g/mol = 0.18086 g.

Percentage by weight of acetic acid in the vinegar = 0.18086 / 5.54 × 100 = 3.27%.

Read more about moles here:

https://brainly.com/question/15356425

#SPJ11

Other Questions
See the image posted We revisit a probabilistic model for a fault diagnosis problem from an earlier homework. The class variable C represents the health of a disk drive: C = 0 means it is operating normally; and C = 1 means it is in failed state. When the drive is running it continuously monitors itself using temperature and shock sensor, and records two binary features, X and Y. X =lif the drive has been subject to shock (e.g;, dropped) , and X = 0 otherwise Y =1if the drive temperature has ever been above 70*C, and Y = 0 otherwise. The following table defines the joint probability mass function of these three random variables: pxyc(r,y, c) 0.1 0.2 0.2 0 0 0 0 0 0 0.05 0.25 Leo Technologies, a software firm, has appointed a team of five members to work on an important project. The project involves the development of a high security program for a client. For the project to be successful, the members need to collaborate. Which of the following steps should the members take to ensure collaboration in the team? The members should be very polite and not say anything critical. The members should provide and receive critical feedback. The members should resist putting forward unpopular ideas. The members should avoid entering into difficult conversations. Desktop computers are a better option for students than laptops, which usually have less power and lower-resolution displays.A. Students need top-notch equipment to excel, and desktop computers don't fit the bill because they are completely out of date.B. Laptop computers fit in most backpacks and bags, so they are better option for busy students who need computers at home and at school.C. Laptops may have less power and shorter lives than desktops, but their popularity and higher prices prove that they are the better option. To comply with the regulations regarding customer identification programs, the minimum identifying information that must be obtained from each customer before opening an account includes:I-name.II-verbal assurance that the customer is of legal age.III- a street address, unless the primary mailing address is a post office box located in the state of residence.IV-a taxpayer identification number.A)I and IV.B)III and IV.C)II and III.D)I and II. Look at Tribute Money from the Brancacci Chapel. Which of these is a feature of the painting that illustrates the Renaissance fascination with the Classical world? what is the liquid part of blood and consists of water and dissolved substances? Math question please help Suppose you are constructing a 95% confidence interval for the mean of a single sample, whose population standard deviation is known to be = 5. You calculate the sample size with some specified width (error) E. (a) Reducing your confidence level to 80%, and reducing your original width (error) E by a third ( 1 3 ), how much bigger will the new sample size be compared to the first sample size above? (Hint: find the scaled size using algebra). b) Suppose instead that your increase the sample size by a factor of 10 and you allow the confidence level to be 85%, how will the width (error) have scaled in size compared to the original width (error) E? What is [Al(H2O)5(OH) 2+] in a 0. 15 M solution of Al(NO3)3 that contains enough of the strong acid HNO3 to bring [H3O +] to 0. 10 M? Using a standard deck of cards, a gamer drew one card and recorded its value. They continued this for a total of 100 draws. The table shows the frequency of each card drawn.Card A 2 3 4 5 6 7 8 9 10 JQKFrequency 4 7 5 6 7 6 8 10 7 10 8 12 10Based on the table, what is the experimental probability that the card selected was a K or 6? 1. Given the following information for a one-year project, answer the following questions. Recall that PV is the planned value, EV is the earned value, AC is the actual cost, and BAC is the budget at completion. PV=$22,000 EV = $20,000 AC= $25,000 BAC=$120,000 a. What is the cost variance, schedule variance, cost performance index (CPI), and schedule performance index (SPI) for the project? b. How is the project doing? Is it ahead of schedule or behind schedule? Is it under budget or over budget? c. Use the CPI to calculate the estimate at completion (EAC) for this project. Is the project performing better or worse than planned? d. Use the SPI to estimate how long it will take to finish this project. TRUE/FALSE.Lack of trust in online sellers is one of the most frequently cited reasons that some consumers are not willing to purchase online. two advantages of a small business The pH of a 0.74 M solution of alloxanic acid (HC4H3N2O5) is measured to be 3.39.Calculate the acid dissociation constant Ka of alloxanic acid.Be sure your answer has the correct number of significant digits. Place the following structures in the order that an electrical impulse would travel beginning with the post-synaptic membrane.1. axon terminals2. dendrites3. node of ranvier4. axon hillock5. terminal arborization6. soma7. internode 5) What is the probability of picking a vowel, replacing itand then picking a consonant from the word "SLEEP"? Determine the area of the shaded regions in the figures below. Write the final polynomial in standard It is possible for a cell to make proteins that last for months; hemoglobin in red blood cells is a good example. However, many proteins are not this long-lasting. They may be degraded in days or even hours. What is the advantage of short-lived proteins?A). Most cells have a short life span.B). Short-lived proteins enable the cells to adjust (control) gene expression when this is critical to their well-being.C). Long-lasting proteins are likely to make the cell cancerous.D). Cells lack the raw materials to make most of the proteins they need.E). Most proteins are used only once. The Ford F-150 is the best selling truck in the United States.The average gas tank for this vehicle is 23 gallons. On a longhighway trip, gas is used at a rate of about 3.2 gallons per hour.The gallons of gas g in the vehicle's tank can be modeled by theequation g(t)=23 -3.2t where t is the time (in hours).a) Identify the domain and range of the function. Then graphthe function.b) At the end of the trip there are 6.4 gallons left. How longwas the trip?