5. What distinguishes the noble gases from other elements in the main group?
How does this contribute to the tendency for the various elements to react
with each other?

Answers

Answer 1

Answer:

Noble gases are the least reactive of all known elements. Their outer energy levels are full because they each have eight valence electrons. ... As a result, noble gases cannot become more stable by reacting with other elements and gaining or losing valence electrons.

Explanation:

Answer 2

Noble gases have complete valence shells so they do not participate in the reactions while the other elements in the main group have incomplete valence shells so they participate in the reaction to complete it.

What are noble gases?

Noble gases can be described as the six elements that belong to the 18th  group of the modern periodic table. The elements of group 18 are Helium, Neon, Argon, Krypton, Xenon, and Radon.

Under normal temperature and pressure conditions, all noble gases exist in the gaseous state and exhibit low chemical reactivity hence they are also referred to as inert gas.  All noble gases possess stable electronic configurations because their valence shell is fully filled.

Noble gases are generally found as mono-atomic gases. The general electronic configuration group 18 elements can be written as ‘ns²np⁶’ where n is the principal quantum number.

Therefore, the reactivity of the noble gases can be distinguished from other elements in the main group.

Learn more about noble gases, here:

brainly.com/question/11764545

#SPJ2


Related Questions

what’s the answer to this?

Answers

the mass weight of the rock is 6.8g

Define freezing....... Correct and detailed answers will be marked as Brainliest.

Answers

Freezing:

The transformation of liquid into solid when it reaches when it's temperature is below freezing point.

Answer:

Freezing:

When liquid is converted to solid, the process is called freezing.

Conditions for freezing:

1) Temperature must be lowered.

2) The temperature should be below 0 degree centigrade.

Example:

The conversion of "liquid water" into "ice".

=> We can use a "freezer" to freeze things.

which statement is true about this reaction 14/7n + 1/1h ------> 15/8o
A. it is a practical source of energy on earth
B.it occurs only outside the solar system
C.its product is heavier than each of its reactants
D.it shows the critical mass of an element

Answers

Answer: answer is C

Explanation:

Its product is heavier than each of its reactants is true about this ₇N¹⁴ + ₁H¹ →  ₈O¹⁵ reaction

What is Nuclear reaction ?

A nuclear reaction is a reaction in which one or more than one nuclides are generate and it collides between two atomic nuclei or one atomic nucleus.

The reaction is  

₇N¹⁴ + ₁H¹ →  ₈O¹⁵

Now equating the mass number of both sides

14 + 1 = 15 + a

a = 0

Equating atomic number of both sides

7 + 1 = 8 + x

x = 0

Thus, we can say that its product is heavier than each of its reactants is true about this reaction

Hence, option C is correct answer.

Learn more about Nuclear reaction here: https://brainly.com/question/25387647
#SPJ2

Draw the geometric, linkage, and ionization isomers for [CoCl5CN][CN].

Answers

Answer:

See explanation

Explanation:

The formation of isomers is common to octahedral complexes. Isomers are different compounds with the same molecular formula but different structural formulas. Isomers have different atom to atom connections. Werner's complexes can display; polymerization, ionization, linkage, geometric and optical isomerism among others.

Isomers of coordination compounds are not easily recognizable and not easily separable in the laboratory.

The geometric, linkage and ionization isomers of the complex given in the question are shown below.

What is the product of the reaction of pentanoic acid with ethanol in the presence of a strong acid?

Answers

Answer:

ethylpentanoate

Explanation:

Alkanoic acids react with alkanols in the presence of mineral acids to yield an ester and water. This is the organic analogue of the inorganic neutralization reaction. The reaction his commonly called esterification. It is an acid catalysed reaction.

The reaction of pentanoic acid and ethanol in the presence of a string acid is shown below;

CH3CH2CH2CH2COOH(aq) + CH3CH2OH(aq) ----> CH3CH2CH2CH2COOCH2CH3(aq) + H2O(l)

The name of the compound formed is ethylpentanoate.

Questions
1 Explain why a solid expands when it is heated.
2 Explain how the liquid in a thermometer changes so that it can be used to
measure a temperature.
3 Use particle theory to explain why solids and liquids cannot be compressed
(squashed into a smaller volume).
4 Use particle theory to explain why liquids and gases can flow.​

Answers

Answer:

answer of question 1 is

Explanation:

solids are denser than liquid and gases because solid particles are closely packed and do not have any empty spaces between their particels so when  solid will heated its particles will spread  and there will have more spaces between them  so a solid expand on heating.        

Which of the following is not an antioxidant _________
1) Sodium benzoate 2) Sulphur dioxide 3) Sulphite salts 4) Citric acid

Answers

Answer: 1. Sodium Benzoate

Explanation: An anti-oxidant is a substance that can help prevent or stop the damage done by free radicals. Examples include; Sulphur Dioxide, Sulphite Salts, Citric Acid, e.t.c

Sodium benzoate is a pure preservative.

Is iodine a atom,a molecule,an ion or a formule unit?

Answers

Answer:

It's an atom

Explanation:

It can't be a molecule since it's only one element, the ion would've been Iodide (I-), and it's not a formula

what is the correct electron configuration for an element with five electrons in the third energy level

Answers

That would be phosphorus. It’s electron configuration is 1s^2 2s^2 2p^6 3s^2 3p^3

[tex]1s^2 2s^2 2p^6 3s^2 3p^3[/tex] is the correct electron configuration for an element with five electrons in the third energy level.

What are elements?

Elements are the simplest substances which cannot be broken down using chemical methods.

The shell nearest to the nucleus, 1n, can carry two electrons, while the next shell, 2n, can carry eight, and the third shell, 3n, can carry up to eighteen.

The third shell carries 18 electrons; 2 in a 3s orbital; 6 in three 3p orbitals; and 10 in five 3d orbitals. The fourth shell carries  32 electrons; 2 in a 4s orbital; 6 in three 4p orbitals; 10 in five 4d orbitals; and 14 in seven 4f orbitals.

The element would be phosphorus. Its electron configuration is [tex]1s^2 2s^2 2p^6 3s^2 3p^3[/tex]

Learn more about elements here:

brainly.com/question/1896898

#SPJ2

Di- Ethyl zinc is a chemical used in the library to protect books from worms, its composition is 53% Zinc, 38.9% Carbon, and 8.1% Hydrogen (At mass of Zn=65.4, C=12, H=1). Find the empirical formula of a compound

Answers

Answer:

ZnC4H10

Explanation:

The empirical formula of a compound refers to the formula that gives the simplest whole number ratio of each atoms of the elements in the compound.

The empirical formula is calculated thus:

The given percentages in the question represent the mass in grams of each element in the compound.

Zinc= 53%, C= 38.9%, H= 8.1% which represents 53g, 38.9g and 8.1g of each element respectively.

Molar Mass of Zn= 65.4 g/mol

Molar Mass of C= 12 g/mol

Molar Mass of H= 1 g/mol

Step 1: Divide the mass of each element by the molar mass given to convert to moles:

Zn= 53/65.4 = 0.81moles

C= 38.9/12 = 3.24moles

H= 8.1/1 = 8.1moles

Step 2: Divide each mole value by the smallest number of moles calculated, which is 0.81moles:

Zn= 0.81/0.81 = 1

C= 3.24/0.81 = 4

H= 8.1/0.81= 10

This is the mole ratio represented in the subscript of each element in the empirical formula:

That is, Zn (1) C (4) H (10)

Empirical formula= ZnC4H10

Write down the dissolution equation for nickel(II) perchlorate dissolving in water. (Perchlorate is a polyatomic ion with the formula ClO41-.) If four moles of the ionic compound are dissolved, then how many moles of the ANION are present in the solution?

Answers

Answer:

Ni(ClO₄)₂(aq) ⇒ Ni²⁺(aq) + 2 ClO₄⁻(aq)

8 mol ClO₄⁻

Explanation:

Let's consider the dissolution equation for nickel(II) perchlorate dissolving in water.

Ni(ClO₄)₂(aq) ⇒ Ni²⁺(aq) + 2 ClO₄⁻(aq)

The molar ratio of Ni(ClO₄)₂ to ClO₄⁻ is 1:2. If 4 moles of Ni(ClO₄)₂ are dissolved, the moles of ClO₄⁻ formed are:

4 mol Ni(ClO₄)₂ × (2 mol ClO₄⁻/ 1 mol Ni(ClO₄)₂) = 8 mol ClO₄⁻

Express each of the following in standard form.
3.6 x 101


6.452 x 102


8.77 x 10-1


6.4 x 10-3

Answers

Answer:3.6 x 101 or 8.77 x 10-1

Sulphur dioxide is a common pollutant from burning coal.State two effects caused by this pollutant and also write the chemical equation.

Answers

Heya!

Sulfur dioxide - ( SO2 )

Answer:

Sulfur dioxide is a common pollutant caused due to the burning of coal,Is very harmful for the environment and health.

Effects:

Health effects-Sulfur dioxide effects the respiratory system which includes the functioning of lungs,respiratory track and causes infections,can also effect  and irritate the eyes and causes aggravating conditions such as asthma and chronic bronchitis.As most sulfur dioxide air pollution comes from the burning of coal and oil in power plants. It is a emitted by trains, large ships and other diesel objects that burns alota   sulfur fuel so this also effects the environment like plants and others as the air lacks oxygen ,but with more sulfur dioxide.

Hope this helps!

Have a nice day!:)

Which are the physical properties of water

Answers

Liquids and gas ex. Ponds, rain, vapor

What is atom economy? A. All of these B. The system that determines how much 1 mole of a pure element costs. C. The measure of how much of the reactants end up as products in a chemical reaction. D. The system of exchanging electrons that occurs in atoms.

Answers

Answer:

C

Explanation:

It's the amount of products you get compared to all the reactants you use. It's kind of like economy in that it's profit, and the higher the atom economy the more products/profit you have.

Answer:

C.) The measure of how much of the reactants end up as products in a chemical reaction.

Explanation:

I got it right on founders edtell.


3. why are fire tornadoes rare ?


Answers

True fire tornadoes have only been documented now twice. and once in Canberra, Australia during 2003. of this tornado. Then, updraft is simply a rising current of air.

In the image above the ruler is measuring in centimeters. The blue cylinder falls somewhere between 2.7cm and 2.8cm according to the ruler. Since we can estimate the last digit I would say that the length of the cylinder is 2.76cm. Since I am estimating any number 2.72cm or 2.78cm could also be correct.

Why would 2.755 not be a correct measurement according to estimating the last digit?

Answers

Answer:

The answer is below

Explanation:

Resolution is the smallest unit of measurement that can be measured by a measuring instrument. Each point on the ruler is 0.1 cm and the difference between any two points, about 0.01 cm cam be measured. The minimum measurement (resolution) that can be measured by the ruler is 0.01 cm (two decimals), therefore it cannot measure up to three decimal places such as numbers like 2.755.

which of the following is a scientific question about the cuttlefish?

Answers

Answer:

How does the cuddle fish change its colors?

Please tell me if I'm wrong.

In science class, Jake mixed water with differing amounts of an unknown liquid. After mixing the liquids, he heated 20 milliliters (ml) of each mixture and observed how quickly it boiled. The table shows his results.​

Answers

According to the question,  each mixture decrease the boiling point of the water.

What is boiling point ?

Boiling temperature is defined as the temperature at which liquid change into a vapour at the atmospheric pressure at sea or ocean level.

For example the boiling temperature of water is 100 degree celcius.

Thus, each mixture decrease the boiling point of the water, option "A" is correct.

To learn more about boiling point click here:

https://brainly.com/question/2153588

#SPJ2

3. How many meters above sea level is the base of your landform?

How many meters above sea level is the top of your platform?

Answers

Answer:

Base is 715 and top is 850.

Explanation:

715 meters above sea level is the base of my landform and 850 meters above sea level is the top of my platform. Base of landform from a sea level is a starting point of a city or region having same topography. This region has a specific height where it spreads we called it top of the platform. The starting point of my location is 715 meters above sea level spreads up to 850 meters of elevation.

What is the molarity of a 50.0ml aqueous solution containing 10.0 grams of hydrogen peroxide H2O2

Answers

Molarity= No of moles of solute * 1000 / vol solution in ml

No of moles= Given mass / Molar mass

Given Mass of solute (H2O2)= 10g

Molar mass of H2O2=34gmol^-1

No of moles= 10/34= 0.294 moles

Volume of solution=50ml

Molarity =   0.294*1000 / 50

Molarity = 5.8M

4. The mass of a silver liberty (coin) was measured three times and each measurement was made
to five digits. The mass values were 12.519 9.12.521 g, and 12.496 g. The average mass was
reported as 12.512 g.
Why is the average mass of the gold coin reported to five significant figures, even though you
had to divide by "3" to obtain the average?

Answers

Answer:

The average mass of the gold coin reported to five significant figures, even though you  had to divide by "3" to obtain the average.

Explanation:

Given that,

The mass of a silver liberty was measured three times and each measurement was made  to five digits.

The mass values are,

[tex]m_{1}=12.519\ g[/tex]

[tex]m_{2}=12.521\ g[/tex]

[tex]m_{3}=12.496\ g[/tex]

The average mass of the gold  coin is 12.512 g.

We know that,

Significant figures :

Significant figures is explained the nonzero, leading zero and zeros between two nonzero digits.

For example,

The digits is 0.003405

In the digit, 345 = nonzero

0.00 = leading zero

The average mass of the gold coin reported to five significant figures because average mass is 12,512. All digits are nonzero.

Nonzero digit are significant.

Hence, The average mass of the gold coin reported to five significant figures, even though you  had to divide by "3" to obtain the average.

The table describes how some substances were formed.
Substance
P.
Q
Description
Formed by boiling pure water
Formed by combining three hydrogen atoms to every nitrogen atom
Formed by adding 5 g of sugar to 1 L of water
Formed by compressing carbon under high pressure
R
S
Based on the given descriptions, which substance is most likely a mixture?
P
Q
R
S

Answers

Explanation:

Which is a pure substance?

1. soda

2. gasoline

3. salt water

4. carbon dioxide

carbon dioxide

Bromine, a liquid at room temperature, has a boiling point of 58°C and a melting point of -7.2°C. Bromine can be classified as a

1. compound.

2. impure substance.

3. mixture.

4. pure substance.

pure substance.

Answer:

the answer is

Explanation:

Sugar and water make a homogeneous mixture (the same proportions of its components throughout any given sample).

All the simple machines make work easier to do by changing the _____ or _____ of a force. A. size; type B. work; type C. size; direction D. type; direction

Answers

Answer:

C. size; direction

Explanation:

By definition, a machine is referred to any device that makes work easier. It takes force to do work, hence, work refers to the application of force over a particular distance. A machine aims at making the work easy by changing how it is done. Simple machines, which include: levers, pulleys, inclined planes etc. all carry out the same thing, which is to make work easier, by changing the size/magnitude and direction of the applied force.

A simple machine tends to change the size of the inputted force by increasing it over a shorter distance. The machine increases the force applied better than it can be done manually e.g. a plier and nutcracker increases/changes the applied force better than it can be done with bare hands.

Also, a simple machine can achieve making work easier by changing the direction at which the force is applied. The machine applies the force on the object in an opposite direction or contrary to the way it was manually applied.

absorption of digested food takes place in the​

Answers

Answer:

Explanation:

Absorption of digested food takes place in the small intestine.

Hope this helps

plz mark as brainliest!!!!!

Answer:

Absorption of digested food takes place in the small intestine.

Explanation:

Give two examples of neutralization

Answers

Answer:examples for neutralization - treating indigestion,treatment for insect bites.hope it help you

Explanation:

which state of matter is Na OH(s)​

Answers

Explanation:

SOLID

Sodium hydroxide exists in the solid phase at room temperature. You would find it in the lab as hemispherical white solid pellets. The phase of a substance depends on temperature and pressure. As you heat a solid, it will melt and change to the liquid phase.

Which of the following sequences describes how a four-stroke engine cycle
powers the engine?

Answers

Answer: Air and fuel intake, compression and ignition, combustion and expansion, exhaust

Explanation:

The primary function of a scuba regulator is to: Reduce high-pressure gas in the scuba cylinder to a more breathable intermediate pressure. Reduce high-pressure gas in the scuba cylinder to ambient (surrounding) pressure. Provide a diver with a continuous flow of oxygenated air. None of the above.

Answers

Answer:

Reduce high-pressure gas in the scuba cylinder to ambient (surrounding) pressure.

Explanation:

The primary function of a scuba regulator would be to reduce high-pressure gas in the scuba cylinder to ambient pressure.

A scuba regulator is a structure found attached to the scuba cylinder usually carried by scuba divers. The structure regulates the pressure of the breathing gas in the cylinder to a safe level before the gas becomes available for the breathing process of divers.

Usually, the gas in a scuba cylinder is at a high level. Hence, what the regulator does is to bring it down to a level that would be safe for the breathing of the diver.

what are the efficient things needed for a village ​

Answers

Answer:

Those aspects which are something a village needs are specified beneath.

Explanation:

Things being equally necessary to make living simpler and therefore more enjoyable. The government has promised to continue providing basic facilities to either an unpopulated location, including such roads, drinkable water, as well as electric power. Therefore, throughout the village, certain things accessible with maximum variety and quality that have become the basic requirements for this human existence.
Other Questions
Can somebody explain how these would be done? The selected answer is incorrect, and I was told "Nice try...express the product by first multiplying the coefficients...then adding your "like term" angles...for instance, cos (2pi/5) + cos (-pi/2) = cos (2pi/5 + -pi/2)...then use the calculator in RADIAN mode to evaluate." Doing those steps, I got the correct constant but a coefficient that was completely off. For the second one, I was told "Good effort...express the quotient by first dividing the coefficients...then subtract your "like term" angles...for instance, cos (2pi/5) - cos (-pi/2) = cos (pi/6 - pi/3)...Finally, use the calculator (in radian MODE) to evaluate." Priya, Han, and Mai each measured one of the circular objects from earlier. Priya says that the bike wheel is 24 inches. Han says that the yo-yo trick is 24 inches. Mai says that the glow necklace is 24 inches. 1. Do you think that all these circles are the same size? 2. What part of the circle did each person measure? Explain your reasoning. What event would most likely occur if earth did not retain the heat from its formation? Culture affects the way people conduct which of the following activities? i. Practicing important traditions. ii. Creating political organizations. iii. Meeting basic needs for survival. A. i. only B. i. and ii. C. i. and iii. D. i., ii., and iii. Please select the best answer from the choices provided A B C D when a 200 g solution A and 400g of saline solution B are mixed a 6% salt solution is created also when a 400g of saline solution A and 200g of solution B are mixed 7% salt is created find what percent concentration of saline and saline b solution are Which of the following pairs of plants are rhizomes?A. Cocoyam and CassavaB. Canna lily and gingerC. Onion and GarlicD. Banana and plantain while jeff was replacing the obstruction of light on a cell tower, he accidentally dropped his cell phone. If he was 150 ft up at the time, approximately how long did it take the phone to reach the ground What is the true solution to the equation below? 2 in e in2-in e in 10= in 30 A x=30 B x=75 C x=150 D x=300 In one of the cases in the textbook, Michael Weinstein was the head of Coated Sales, Inc., a company that coated fabrics for use in producing things like parachutes, helmet liners, and camouflage suits. By engaging in financial shenanigans, Coated Sales moved to the top of its industry, but ultimately the good times turned into bad times, and the company declared bankruptcy. What happened to Weinstein Hey everyone good morning...... if u would start a business.what kind of business would u start?and why?FAST I NEED IT ASAP The function gx) = x^2is transformed to obtain function hr.h(x) = g(x-3).Which statement describes how the graph of h is different from the graph of g?A. The graph of his the graph of g vertically shifted down 3 units.B. The graph of his the graph of ghorizontally shifted left 3 units.C. The graph of h is the graph of g vertically shifted up 3 units.D. The graph of h is the graph of g horizontally shifted right 3 units. What is the historical context of Herbert Morrisons account? Whats the time,place and mood? 24. After a vertical reflection across the x-axis, f(x) is Options: A. f(x) B. f(x 1) C. f(x) D. f(x) What is the area of polygon EFGH? 5 more than 2 times a number You are arvind/anushka sharma, secretary of the eco club of your school.The school is celebrating " ban the plastic week" to create awareness regarding the harm caused due plastic. Draft a suitable notice in not more than 50 wordsBody......... Ban the plasticThe eco club is observing a Plastic Ban Week from 12 August,2020 in our school. Several activities including songs, short plays and poster making competitions will be held to create awareness about the ill-effects of plastics on our environment. For futher details, contact the undersigned.Plssssss answer fast its veryy urgent please Identify the image tag attribute being described.The v attribute is used to tell the browserwhere the desired image can be found.The v attribute is used to provide tool tip textto display when a user pauses over an image withthe mouse pointer.The attribute is used to provide the text todisplay (or read) if the browser cannot find thedesignated image. CIWhich of the following statements is INCORRECT?(1)(2)the compound contains a o molecular orbital formed by the overlap of one carbonsp2 hybrid orbital and one hydrogen sp3 hybrid orbitalthe compound contains a T molecular orbital formed by the overlap of twounhybridized carbon p atomic orbitalsthe compound contains a polar C-Cl bondeach carbon atom of the C=C bond is sp2 hybridized(3)(4) Find the mean of the data summarized in the given frequency distribution. Compare the computed mean to the actual mean of 51.1 degrees. Low Temperature (F) 4044 4549 5054 5559 6064 Frequency 3 6 13 7 help me plzzzz the physical and human characteristics of a location help us to answer which of the following questions? "How far away is it?" "How do I get there?" "Where is it?" "What is it like?"