Answer:
(ii) Ethane and Heptadecane
Explanation:
The separation of all the species listed in the answer options for the question depends on the molar mass of each specie.
Ethane is a low molecular mass gas. It exists in the gaseous state at room temperature. However, heptadecane appears as a liquid because it has a greater relative molecular mass.
It is very easily to distinguish between the gas, ethane and the liquid heptadecane which is a high molecular mass alkane, hence the answer.
write the formula of three compounds which you know and name the elements in them
Answer:
[tex]\boxed{\sf{view \ explanation}}[/tex]
Explanation:
Compound definition:
A compound is a chemical substance formed by two or more chemically bonded elements.
Three compounds:
Water is a compound with the formula [tex]\sf H_2O[/tex].
Two hydrogen atoms and one oxygen atom is present in one molecule of water.
Sodium chloride or table salt is a compound with the formula [tex]\sf NaCl[/tex].
One sodium atom and one chlorine atom is present in one molecule of sodium chloride.
Ammonia is a compound with the formula [tex]\sf NH_3[/tex].
In one molecule of ammonia, one nitrogen atom and three hydrogen atoms are present.
Answer:
See below
Explanation:
Three compounds are:
1) [tex]\mathrm {H_{2}SO{4}}[/tex] [Sulfuric acid]
The elements in this compound are hydrogen (H) , Sulfur (S) and Oxygen (O).
2) [tex]\mathrm {NaOH}[/tex] [Sodium hydroxide]
The elements in this compound are Sodium (Na) , Oxygen (O) and Hydrogen (H).
3) [tex]\mathrm {HCl}[/tex] [Hydrochloric acid]
The elements are Hydrogen (H) and Chlorine (Cl).
Os subníveis mais energéticos de um dado átomo são: ...4s2 3d10 4p5 a) indique o seu número atomico b) quantos electrões de valência apresenta esse átomo c) a que família pertence?
Answer:
A. 35
B. 7
C. halogênios
Explanation:
Aqui, para responder a essa pergunta, precisaremos conhecer o elemento particular em questão.
..... 4s ^ 2 3d ^ 10 4p ^ 5 significa que está a cinco elétrons da configuração eletrônica do último elemento na primeira camada dos metais pesados.
O último elemento da 1ª série do elemento de transição é o zinco, portanto, como está a apenas 5 elementos de distância, o átomo de que estamos falando é o átomo de Bromo de Bromo.
A. O zinco tem um número atômico 30 e como o bromo está a 5 elementos de distância, seu número atômico é 35
B. Uma vez que pertence ao grupo halogênio, tem 7 elétrons de valência como o resto da família
C. Pertence à família dos halogênios
what are the efficient things needed for a village
Answer:
Those aspects which are something a village needs are specified beneath.
Explanation:
Things being equally necessary to make living simpler and therefore more enjoyable. The government has promised to continue providing basic facilities to either an unpopulated location, including such roads, drinkable water, as well as electric power. Therefore, throughout the village, certain things accessible with maximum variety and quality that have become the basic requirements for this human existence.When a substance's particles are packed together tightly and have a definite shape and
volume...it is said to be in what state?
solid
gas
plasma
liquid
Answer:
solid
Explanation:
Which scientist developed a new model of planetary motion?
Answer: Johannes Kepler
Answer:
i believe the answer us kepler
Explanation:
HELP ASAP! 50 POINTS! Which type of electromagnetic radiation has a longer wavelength than visible light? (4 points) Gamma rays Infrared radiation Ultraviolet radiation X‒rays
Answer:Infrared radiation
Explanation:just took the test
The electromagnetic radiation that has a longer wavelength than visible light is Infrared radiation.
The electromagnetic spectrum is an arrangement of of electromagnetic waves in order of increasing frequency and energy. We must note the longer the wavelength, the farther it appears towards the left in the electromagnetic spectrum.
The visible spectrum spans between 400 nm - 700 nm in the electromagnetic spectrum. The electromagnetic radiation that has a longer wavelength than visible light is Infrared radiation.
Learn more: https://brainly.com/question/8592296?
How are proteins carbohydrates and fats related to the discipline of chemistry
Answer:
Explanation:
The nutrition label on rice lists the amounts of proteins, carbohydrates, and fats in one serving. These substances are important for human nutrition. How are proteins, carbohydrates, and fats related to the discipline of chemistry? All are chemical compounds. All are found in living things. All are needed for nutrition. All are found in non-living things.
The answer for this question would be A) All are chemical compounds.
The answer is All are chemical compounds
Write down the dissolution equation for nickel(II) perchlorate dissolving in water. (Perchlorate is a polyatomic ion with the formula ClO41-.) If four moles of the ionic compound are dissolved, then how many moles of the ANION are present in the solution?
Answer:
Ni(ClO₄)₂(aq) ⇒ Ni²⁺(aq) + 2 ClO₄⁻(aq)
8 mol ClO₄⁻
Explanation:
Let's consider the dissolution equation for nickel(II) perchlorate dissolving in water.
Ni(ClO₄)₂(aq) ⇒ Ni²⁺(aq) + 2 ClO₄⁻(aq)
The molar ratio of Ni(ClO₄)₂ to ClO₄⁻ is 1:2. If 4 moles of Ni(ClO₄)₂ are dissolved, the moles of ClO₄⁻ formed are:
4 mol Ni(ClO₄)₂ × (2 mol ClO₄⁻/ 1 mol Ni(ClO₄)₂) = 8 mol ClO₄⁻
Iron and aluminum are examples of
Answer:
Iron and aluminum are both examples of metals that are used commonly in everyday life.
What is the molarity of a 50.0ml aqueous solution containing 10.0 grams of hydrogen peroxide H2O2
Molarity= No of moles of solute * 1000 / vol solution in ml
No of moles= Given mass / Molar mass
Given Mass of solute (H2O2)= 10g
Molar mass of H2O2=34gmol^-1
No of moles= 10/34= 0.294 moles
Volume of solution=50ml
Molarity = 0.294*1000 / 50
Molarity = 5.8M
Which of these is true about electrons? posses a positive electrical charge of one (+1) have a negative electrical charge of one (-1) indicates the number of protons in each atom equals the sum of protons plus neutrons in each atom
Answer:
have a negative electrical charge of one (-1)
Explanatio
Electrons have an electrical charge of negative one. When you think electron, always think -1
Oil and water do not mix. What can be said about oil?
It is nonpolar.
It is polar.
It is saturated.
It is unsaturated.
Answer:
It is non - polar
Explanation:
Oil is a non-polar chemical substance that is a viscous liquid at ambient temperatures and is both hydrophobic (does not mix with water).
Water and oil do not mix. They are said to be immiscible. This is because water is a polar molecule.
Hope this helps and please mark as the brainliest.
Explain why chlorine is a gas while iodine is a solid yet both are halogens. Select one: a. Both iodine and chlorine differ in strength of metallic bonds b. Chlorine has strong inter molecular forces than iodine c. Iodine molecules are large with strong inter molecular forces than chlorine
Answer:
Chlorine has strong inter molecular forces than iodine
Explanation:
Answer:
Chlorine has strong inter molecular forces than iodine
Explanation:
I2 is a solid while Cl2 is a gas because Iodine molecules are larger and therefore experience stronger intermolecular forces.
HOPE IT HELPS :)
PLEASE MARK IT THE BRAINLIEST!
The table describes how some substances were formed.
Substance
P.
Q
Description
Formed by boiling pure water
Formed by combining three hydrogen atoms to every nitrogen atom
Formed by adding 5 g of sugar to 1 L of water
Formed by compressing carbon under high pressure
R
S
Based on the given descriptions, which substance is most likely a mixture?
P
Q
R
S
Explanation:
Which is a pure substance?
1. soda
2. gasoline
3. salt water
4. carbon dioxide
carbon dioxide
Bromine, a liquid at room temperature, has a boiling point of 58°C and a melting point of -7.2°C. Bromine can be classified as a
1. compound.
2. impure substance.
3. mixture.
4. pure substance.
pure substance.
Answer:
the answer is
Explanation:
Sugar and water make a homogeneous mixture (the same proportions of its components throughout any given sample).
please help :) How can scientists ensure that their data are reliable? A) by making a single observation B) by recording values without units C) by keeping the results private D) by repeating trials during an experiment
Answer:
D. by repeating trials during an experiment
Explanation:
chile its actually d
Explanation:
Answer in the correct significant figures: 35.6 + 56.27 *
Answer:
101.87
Explanation:
that's the answer
Consider the hypothetical chemical reaction represented by the equation 3 A + 2 B → A 3B 2 Which of the following is a correct interpretation of this equation? i. 3 grams of A react with 2 grams of B to form 1 gram of A 3B 2 ii. 3 atoms of A react with 2 atoms of B to form 1 molecule of A 3B 2 iii. 3 moles of A react with 2 moles of B to form 1 mole of A 3B 2
Answer:
iii. 3 moles of A react with 2 moles of B to form 1 mole of A 3B 2
Explanation:
A + 2 B → A 3B 2
A chemical equation among other things, gives the stoichiometry of the reaction; that is the relationship between reactants and products.
This relationship is basically stated in moles form the coefficients of the reactants and product.
From the reaction above, we can say;
1 mol of A reacts with 2 mol of B to form 1 mol of A3B2
It cannot be grams because the reactants and products all have different molar masses.
The correct interpretation of the equation of the hypothetical chemical reaction is; Choice (iii) 3 moles of A react with 2 moles of B to form 1 mole of A 3B 2.
Definition:
Chemical equations are equations that make use of chemical formulae and symbols to represent chemical reactions. The left-hand side of a chemical equation represents the reactants and the right-hand side represents the products.
Each reacting entity is also assigned its corresponding stoichiometric coefficient.
However, this stoichiometric coefficient is to quantify the no. of moles of the reactants consumed or products formed as the case may be.
Read more:
https://brainly.com/question/12271256
Chemical change example
Answer: burning paper
Explanation:
The paper burns in air to form smoke and ash. which makes it a chemical change.
The melting points of ionic compounds _____
Explanation:
ionic compounds have high melting points
Which of the following is not an antioxidant _________
1) Sodium benzoate 2) Sulphur dioxide 3) Sulphite salts 4) Citric acid
Answer: 1. Sodium Benzoate
Explanation: An anti-oxidant is a substance that can help prevent or stop the damage done by free radicals. Examples include; Sulphur Dioxide, Sulphite Salts, Citric Acid, e.t.c
Sodium benzoate is a pure preservative.
A chemical equation is balanced when Group of answer choices the number of atoms of each element is the same in reactants and products. the charge on each atom is the same in reactants and products. the sum of the coefficients of the reactants is equal to the sum of the coefficients of the products. the total number of ions is the same in reactants and products. the total number of molecules is the same in reactants and products.
Answer:
a
Explanation:
A chemical equation is said to balanced only when the number of atoms of each element is the same in both reactants and products side. Rest all options are absurd. Hence, option a is correct.
Balancing of the reaction has no relation with coefficient, molecules or charge of the elements
In the image above the ruler is measuring in centimeters. The blue cylinder falls somewhere between 2.7cm and 2.8cm according to the ruler. Since we can estimate the last digit I would say that the length of the cylinder is 2.76cm. Since I am estimating any number 2.72cm or 2.78cm could also be correct.
Why would 2.755 not be a correct measurement according to estimating the last digit?
Answer:
The answer is below
Explanation:
Resolution is the smallest unit of measurement that can be measured by a measuring instrument. Each point on the ruler is 0.1 cm and the difference between any two points, about 0.01 cm cam be measured. The minimum measurement (resolution) that can be measured by the ruler is 0.01 cm (two decimals), therefore it cannot measure up to three decimal places such as numbers like 2.755.
How does antifreeze rely on colligative properties to work?
A. It causes the vapor pressure to increase and the increased outward pressure of the gasoline vapors prevents it from solidifying into ice.
B. It causes freezing point elevation which raises the temperature of the gasoline without letting it freeze.
C. It causes freezing point depression which requires the gasoline to reach a much lower temperature before freezing.
D. It causing boiling point elevation, which raises the temperature of the gasoline without letting it boil so that it can resist the cold.
WILL GIVE BRAINLIEST FOR CORRECT!!!
It causes freezing point depression which requires the gasoline to reach a much lower temperature before freezing. Hence, option C is correct.
What is the freezing point?Whenever a solute is added to a solution/solvent, it leads to depression in the freezing point of that solution/solvent. Depression in the freezing point of a solution on the addition of a solute is a colligative property.
A colligative property is a physical property which depends upon the number of solutes added not on the nature of solutes which means it does not matter whether we are adding 1000 particles of sugar or salt in water, the depression in the freezing point will occur by the same °C. Also, the more a solute is added the more will be the depression at the freezing point.
The formula for depression at the freezing point is mentioned as under:
Δ T = K x m
where Δ T = freezing point depression;
K = cryoscopic constant;
m = molality of the solution.
For example, The freezing point of water is 0 °C but as soon as we add a 92 gm solute like NaCl (common salt) in 1000 gm of water, its freezing point will be lower to −3.72 °C.
Hence, option C is correct.
Learn more about freezing point here:
https://brainly.com/question/12940710
#SPJ5
What is the product of the reaction of pentanoic acid with ethanol in the presence of a strong acid?
Answer:
ethylpentanoate
Explanation:
Alkanoic acids react with alkanols in the presence of mineral acids to yield an ester and water. This is the organic analogue of the inorganic neutralization reaction. The reaction his commonly called esterification. It is an acid catalysed reaction.
The reaction of pentanoic acid and ethanol in the presence of a string acid is shown below;
CH3CH2CH2CH2COOH(aq) + CH3CH2OH(aq) ----> CH3CH2CH2CH2COOCH2CH3(aq) + H2O(l)
The name of the compound formed is ethylpentanoate.
Examine the given reaction. NH4NO3(s) → NH4+(aq) + NO3–(aq) ΔH° = 25.45 kJ/mol ΔS° = 108.7 J/mol·K Which of the given is correct about the ΔG° at 25 °C?
A)+4,360 J
B)−6,942 J
C)−4,360 J
D)+6,942 J
Answer:
B)−6,942 J /mol
Explanation:
At constant temperature and pressure, you cand define the change in Gibbs free energy, ΔG, as:
ΔG = ΔH - TΔS
Where ΔH is enthalpy, T absolute temperature and ΔS change in entropy.
Replacing (25°C = 273 + 25 = 298K; 25.45kJ/mol = 25450J/mol):
ΔG = ΔH - TΔS
ΔG = 25450J/mol - 298K×108.7J/molK
ΔG = -6942.6J/mol
Right solution is:
B)−6,942 J /molDescribe the reaction of an acid with an alkali.?
Your question has been heard loud and clear.
The reaction of an acid with an alkali is neutralization reaction. It is a neutralization reaction because , they both neutralize each other (means it makes them chemically inactive after reacting) and produce a salt , and maybe water too.
An example: hydrochloric acid + sodium hydroxide → sodium chloride + water
Thank you
it will neutralise because if you add both of them together with a matching Ph such as 5 and 9 equally then it will neutralise and have a Ph of 7
could you please make me brainliest
what’s the answer to this?
how many primary carbon are in 2,3 dimethylpentane
Answer:
There are 7 carbons in 2,3 dimethylpentane
Explanation:
Because 2,3-dimethlypentane is an organic compound of carbon and hydrogen with formula C7H16
You are pushing a box with 20 N of force that has
a mass of 10 kg, solve for acceleration
Answer:
Force=mass ×acceleration.
20=10×acceleration.
20=10a.
a=2m/s^2.
Lab Safety Rule #3 says to always add acids or bases to the solvent and NEVER the other way around true or false?
Answer:
true
Explanation:
The standard laboratory rule is to always add acids or bases to solvent and not the other way round.
The dissolution of concentrated acids/bases in solvents (water) generates heat energy. Thus, if the solvent is added to them, a layer of hot weak acid or base will be formed and this will boil and spray around, causing an explosion.
On the other hand, if acid/base is added to solvents, they flow into the solvents and get diluted immediately without any boiling taking place. Hence, it is safe to add acid/base to solvents and not the other way round.
