Answer:
21.6 g
Explanation:
The reaction that takes place is:
CH₄ + 2O₂ → CO₂ + 2H₂OFirst we convert the given masses of both reactants into moles, using their respective molar masses:
9.6 g CH₄ ÷ 16 g/mol = 0.6 mol CH₄64.9 g O₂ ÷ 32 g/mol = 2.03 mol O₂0.6 moles of CH₄ would react completely with (2 * 0.6) 1.2 moles of O₂. As there are more O₂ moles than required, O₂ is the reactant in excess and CH₄ is the limiting reactant.
Now we calculate how many moles of water are produced, using the number of moles of the limiting reactant:
0.6 mol CH₄ * [tex]\frac{2molH_2O}{1molCH_4}[/tex] = 1.2 mol H₂OFinally we convert 1.2 moles of water into grams, using its molar mass:
1.2 mol * 18 g/mol = 21.6 gIf 0.250 L of a 5.90 M HNO₃ solution is diluted to 2.00 L, what is the molarity of the new solution?
Answer:
0.74 M
Explanation:
From the question given above, the following data were obtained:
Molarity of stock solution (M₁) = 5.90 M
Volume of stock solution (V₁) = 0.250 L
Volume of diluted solution (V₂) = 2 L
Molarity of diluted solution (M₂) =?
The molarity of the diluted solution can be obtained by using the dilution formula as illustrated below:
M₁V₁ = M₂V₂
5.90 × 0.250 = M₂ × 2
1.475 = M₂ × 2
Divide both side by 2
M₂ = 1.475 / 2
M₂ = 0.74 M
Thus, the molarity of the diluted solution is 0.74 M
Draw structures corresponding to the following IUPAC names:(a) (Z)-2-Ethyl-2-buten-1-ol (b) 3-Cyclohexen-1-ol(c) trans-3-Chlorocycloheptanol (d) 1,4-Pentanediol(e) 2,6-Dimethylphenol (f ) o-(2-Hydroxyethyl)phenol
Answer:
Draw structures corresponding to the following IUPAC names:(a) (Z)-2-Ethyl-2-buten-1-ol (b) 3-Cyclohexen-1-ol(c) trans-3-Chlorocycloheptanol (d) 1,4-Pentanediol(e) 2,6-Dimethylphenol (f ) o-(2-Hydroxyethyl)phenol
Explanation:
According to IUPAC rules, the name of a compound is:
Prefix+root word+suffix
1) Select the longest carbon chain and it gives the root word.
2) The substituents give the prefix.
3) The functional group gives the secondary suffix and the type of carbon chain gives the primary suffix.
The structure of the given compounds are shown below:
#6 and #7. How many carbon atoms are in a mixture of 7.00 mol c2F2 and 0.400 mol carbon dioxide and also #7
Answer:
#6 8.67x10²⁴ atoms
#7
1. Atom
2. Formula unit
3. Molecule
4. Ion
Explanation:
#6 First we calculate how many carbon moles are there in 7.00 moles of C₂F₂, keeping in mind that there are 2 C moles per C₂F₂ mol:
7.00 mol C₂F₂ * 2 = 14.00 mol CAs for carbon dioxide, there are 0.400 C moles in 0.400 moles of CO₂.
We calculate the total number of C moles:
14.00 mol + 0.400 mol = 14.4 mol CFinally we calculate the number of atoms in 14.4 C moles, using Avogadro's number:
14.4 mol * 6.023x10²³ atoms/mol = 8.67x10²⁴ atoms#7
1. Radon - Atom (Ra)2. Formula unit (It is a crystalline solid, BaBr₂)3. Molecule (NH₃)4. Ion (It has a formal charge, +2)True or false: Boron contains 2s22p1 valence electrons, so only one p orbital is needed to form molecular orbitals.
Answer:
True
Explanation:
The valence orbitals of boron are 2s2 2p1. We have to recall that all the valence orbitals whether full or empty are involved in the formation of molecular orbitals.
The number of molecular orbitals formed is equal to the number of atomic orbitals that are combined.
Since there are two valence orbitals and there is only one p orbital among the valence orbitals, it is true that only one p orbital is needed to form molecular orbitals in boron.
Would 1 pound of peanut butter occupy more or less space than 1 pound of water?
1.rain pours from the sky
2.leaves of the plant dried
3.fluffy clouds form in the sky
4.bathing suit dries after swim
5.water puddles disappear
A.Evaporation
B.Condensation
C.Precipitation
D.Transpiration
Yan po pag pipilian
Answer:
1.Precipitation
2.Transpiration
3.Condensation
4.Evaporation
5.Evaporation
3.Condensation
Explanation:
Rain pours from the sky occurs due to the process of precipitation, leaves of the plant dried due to the process of transpiration in which the water is evaporated from the body of plant, fluffy clouds form in the sky occurs in the process of condensation, bathing suit dries after swim is due to evaporation in which water is removed and goes into the atmosphere and water puddles disappear due to the process of evaporation. Evaporation is the removal of water from the any surface whereas transpiration is the removal of water from plant body parts.
Rank each of the following gases in order of increasing urms assuming equivalent amounts and all gases are at the same temperature and pressure where 1 has the lowest urms and 4 has the highest urms.
a. Gas 1 : H2S
b. Gas: He
c. Gas 3: NF3
d. Gas 4: H2O
The Urms refers to the root mean square speed of the gas. The order of increasing Urms for the gases shown in the question; NF3 < H2S < H2O < He.
What is the Urms?The Urms refers to the root mean square speed of the gas. This is ultimately dependent on the relative molecular mass of the gases when they are maintained at the same temperature.
Now, let us look at the order of increasing Urms for the gases shown in the question; NF3 < H2S < H2O < He.
Learnmore about Urms: https://brainly.com/question/365923
PLEASE HELP!!
How does temperature, agitation, and particle size affect solubility?
Answer:
At higher temperatures, particles move faster and collide more, increasing solubility rates.
Agitation increases solubility rates as well, by bringing fresh solvent into contact with the undissolved solute
The smaller the particle size, the higher (faster) solubility rate. Vice versa, the bigger the particle size, the lower (slower) solubility rate.
Explanation:
In what kind of orbital do the lone-pair electrons on the nitrogen of dimethylacetamide reside, and is it in the same plane as the ch3 groups
Answer:
The lone pairs on nitrogen in dimethylacetamide reside in sp3 orbitals which are coplanar with the methyl groups
Explanation:
The compound dimethylacetamide consists of oxygen bearing two lone pairs of electrons and a nitrogen atom bearing a lone pair of electrons and has two methyl groups attached to the nitrogen atom.
The lone pair on the nitrogen atom is accommodated in an sp3 orbital of nitrogen as shown in the question. This sp3 orbital is coplanar with the two methyl groups.
2- A 0.60 sample an unknown organic acid found in muscle cells is burned in air and found to contain 0.24 grams of carbon, 0.040 grams of hydrogen, with the rest being oxygen. If the molecular weight of the substance is 90 grams/n, what is the molecular formula
Answer:
C₃H₆O₃
Explanation:
To solve this question we need to find, as first, the moles of each atom in order to find empirical formula (Simplest whole-number ratio of atoms present in a molecule).
With the molar mass of the substance and the empirical formula we can find the molecular formula as follows:
Moles C -Molar mass:12.0g/mol-
0.24g * (1mol/12.0g) = 0.020 moles C
Moles H = Mass H because molar mass = 1g/mol:
0.040 moles H
Moles O -Molar mass: 16g/mol-
Mass O: 0.60g - 0.24g - 0.040g = 0.32g O
0.32g O * (1mol/16g) = 0.020 moles O
Ratio of atoms (Dividing in moles of C: Lower number of moles):
C = 0.020 moles C / 0.020 moles C = 1
H = 0.040 moles H / 0.020 moles C = 2
O = 0.020 moles O / 0.020 moles C = 1
Empirical formula:
CH₂O.
Molar mass CH2O:
12g/mol + 2*1g/mol + 16g/mol = 30g/mol
As molecular formula has a molar mass 3 times higher than empirical formula, the molecular formula is 3 times empirical formula:
C₃H₆O₃The molecular formula of the organic acid would be C3H6O3
Molecular formulaMolecular formula = [empirical formula]n
Where n = molar mass/mass of empirical formula
Empirical formula
C = 0.24/12 = 0.02
H = 0.040/1 = 0.04
O = 0.6 - (0.24+0.04) = 0.32/16 = 0.02
Divide by the smallest
C = 1
H = 2
O = 1
Empirical formula = CH2O
Empirical formula mass = 12 + 2 + 16 = 30
n = 90/30 = 3
Molecular formula = [CH2O]3
= C3H6O3
More on molecular formula can be found here: https://brainly.com/question/1247523
4.106
Calculate the moles and the mass of solute in each of the following solutions.
(a) 150.0 mL of 0.245 M CaCl2
molarity = moles of solute / volume of solution
moles of solute = molarity × volume of solution
moles of solute = 0.245 mol/L × 0.1500 L
moles of solute = 0.03675 mol
moles of solute = 0.0368 mol
-----------------------------------------------------------
Solution: (mass of solute)Step 1: Calculate the molar mass of solute.
molar mass of solute = (40.08 g/mol × 1) + (35.45 g/mol × 2)
molar mass of solute = 110.98 g/mol
Step 2: Calculate the mass of solute.
mass of solute = moles of solute × molar mass of solute
mass of solute = 0.03675 mol × 110.98 g/mol
mass of solute = 4.08 g
Note: The volume of solution must be expressed in liters (L).
Answer:
[tex]\boxed {\sf \bold {0.0368 \ mol \ CaCl_2}}}}[/tex]
[tex]\boxed {\sf \bold {4.08 \ g \ CaCl_2}}}}}[/tex]
Explanation:
1. Moles of SoluteMolarity is a measure of concentration in moles per liter.
[tex]molarity= \frac {moles \ of \ solute}{liters \ of \ solution}[/tex]
In this solution, there are 150.0 milliliters of solution and the molarity is 0.245 M CaCl₂ or 0.245 mol CaCl₂ per liter.
First, convert the milliliters to liters. There are 1000 milliliters in 1 liter.
[tex]{150 \ mL * \frac{1 \ L}{1000 \ mL}= \frac{150}{1000} \ L = 0.150 \ L[/tex]Now, substitute the known values (molarity and liters of solution) into the formula. The moles of solution are unknown, so we can use x.
[tex]0.245 \ mol \ CaCl_2 /L= \frac{ x}{0.150 \ L}[/tex]
We are solving for x, so we must isolate this variable. It is being divided by 0.150 L. The inverse of divisions is multiplication, so we multiply both sides by 0.150 L.
[tex]0.150 \ L *0.245 \ mol \ CaCl_2 /L= \frac{ x}{0.150 \ L} * 0.150 L[/tex]
[tex]0.150 \ L *0.245 \ mol \ CaCl_2 /L=x[/tex]
The units of liters cancel.
[tex]0.150 *0.245 \ mol \ CaCl_2 =x[/tex]
[tex]0.03675 \ mol \ CaCl_2[/tex]
The original measurements have 3 significant figures, so our answer must have the same.
We should round to the ten thousandths place. The 5 to the right of this place tells us to round the 7 up to an 8.
[tex]\bold {0.0368 \ mol \ CaCl_2}[/tex]
2. Mass of the SoluteWe can convert mass to moles using the molar mass. These values are found on the Periodic Table. They are the same as the atomic masses, but the units are grams per mole (g/mol) instead of atomic mass units.
The solute is calcium chloride: CaCl₂. Look up the molar masses of the individual elements.
Ca: 40.08 g/mol Cl: 35.45 g/molNotice that chlorine has a subscript of 2. We must multiply the molar mass by 2.
Cl₂: 35.45 *2= 70.9 g/molAdd calcium's molar mass.
CaCl₂: 40.08 + 70.9 =110.98 g/molUse the molar mass as a ratio.
[tex]\frac {110.98 \ g\ CaCL_2}{ 1 \ mol \ CaCl_2}[/tex]
Multiply the moles of calcium chloride we calculated above.
[tex]0.0368 \ mol \ CaCl_2 *\frac {110.98 \ g\ CaCL_2}{ 1 \ mol \ CaCl_2}[/tex]
The units of moles of calcium chloride cancel.
[tex]0.0368 *\frac {110.98 \ g\ CaCL_2}{ 1 }[/tex]
[tex]4.084064 \ g\ CaCl_2[/tex]
Round to 3 significant figures again. For this number, it is the hundredths place. The 4 in the thousandths place tells us to leave the 8.
[tex]\bold {4.08 \ g \ CaCl_2}[/tex]
Que es la actividad física y en qué mejora
What are the uses of Sulphuric acid?
Answer:
The major use of sulfuric acid is in the production of fertilizers, e.g., superphosphate of lime and ammonium sulfate. It is widely used in the manufacture of chemicals, e.g., in making hydrochloric acid, nitric acid, sulfate salts, synthetic detergents, dyes and pigments, explosives, and drugs.
The major use of sulfuric acid is in the production of fertilizers, e.g., superphosphate of lime and ammonium sulfate. It is widely used in the manufacture of chemicals, e.g., in making hydrochloric acid, nitric acid, sulfate salts, synthetic detergents, dyes and pigments, explosives, and drugs.
what is the machine used to check melting point called?
Answer:
Melting-point apparatus
You are asked to prepare a buffer solution with a pH of 3.50. The following solutions, all 0.100 M, are available to you: HCOOH, CH3COOH, H3PO4 , NaCHOO, NaCH3COO, and NaH2PO4. What would be the best combination to make the required buffer solution? Select one:
a. NaH2PO4 and NaCHOO
b. H3PO4 and NaH2PO4
c. NaH2PO4 and HCOOH
d. CH3COOH and NaCH3COO e. HCOOH and NaCHOO
can someone helo me with this
Answer:
e. HCOOH and NaCHOO
Explanation:
For a buffer solution, both an acid and its conjugate base are required.
With the information above in mind, we can discard options a) and c), as those combinations are not of an acid and its conjugate base.
Now it is a matter of comparing the pKa (found in literature tables) of the acids of the remaining three acids:
H₃PO₄ pKa = 2.12CH₃COOH pKa = 2.8HCOOH pKa = 3.74The acid with the pKa closest to the desired pH is HCOOH, so the correct answer is e. HCOOH and NaCHOO
Which of the following is a physical change?
A sample of oxygen gas is compressed from 30.6 L to 1.8 L at constant temperature pressure of 1.8 atm. Calculate the amount of energy in joules when the system releases 1.5 KJ of heat?
Answer:
the change in the internal energy of the system is 3,752.67 J
Explanation:
Given;
initial volume of the gas, V₁ = 30.6 L
final volume of the gas, V₂ = 1.8 L
constant pressure of the gas, P = 1.8 atm
Energy released by the system, Q = 1.5 kJ = 1,500 J
Apply pressure-volume work equation, to determine the work done on the gas;
w = -PΔV
w = -P(V₂ - V₁)
w = - 1.8 atm(1.8 L - 30.6 L)
w = 51.84 L.atm
w = 51.84 L.atm x 101.325 J/L.atm
w = 5,252.67 J
The change in the internal energy of the system is calculated as;
ΔU = Q + w
Since the heat is given out, Q = - 1,500 J
ΔU = -1,500 J + 5,252.67 J
ΔU = 3,752.67 J
Therefore, the change in the internal energy of the system is 3,752.67 J
A scientific hypothesis is
ANSWER:
predictive.
testable.
explanatory.
all of the above.
Answer:
All of the above.
Explanation:
For a scientific hypothesis to be considered a hypothesis, it has to be testable. When conducting a lab experiment, it also allows the tester to predict what might occur during and after the experimentation. They are also explanatory. For example, theories are hypotheses that have been verified and can explain why something in nature takes place.
Linoleic acid is a polyunsaturated fatty acid found, in ester form, in many fats and oils. Its doubly allylic hydrogens are particularly susceptible to abstraction by radicals, a process that can lead to the oxidative degradation of the fat or oil.
a. True
b. Flase
Answer:
True.
Explanation:
The information presented in the question above regarding linoleic acid is true. Linoleic acid is, in fact, found in many oils and fats in the ester form. In addition, linoleic acid is considered a polyunsaturated fatty acid, due to the presence of two unsaturations in its composition. Its chemical formula is CH3-(CH2)4-CH=CH-CH2-CH=CH-(CH2)7COOH and it is an essential fatty acid for the human body, as it is essential in the composition of arachidonic acid that is responsible for building muscle, managing body fat thermogenesis, and regulating core protein synthesis.
Please please help help please
Liquid octane will react with gaseous oxygen to produce gaseous carbon dioxide and gaseous water . Suppose 10.3 g of octane is mixed with 23. g of oxygen. Calculate the maximum mass of water that could be produced by the chemical reaction. Round your answer to significant digits.
Answer:
9.36 g
Explanation:
The equation of the reaction is;
C8H18(g) + 25/2 O2(g) ----> 8CO2(g) + 9H2O(g)
Number of moles of octane = 10.3g/ 114 g/mol = 0.09 moles
1 mole of octane yields 9 moles of water
0.09 moles of octane yields 0.09 × 9/1 = 0.81 moles of water
Number of moles of oxygen = 23g/32g/mol = 0.72 moles
12.5 moles of oxygen yields 9 moles of water
0.72 moles of oxygen yields 0.72 × 9/12.5 = 0.52 moles of water
Hence oxygen is the limiting reactant;
Maximum mass of water produced = 0.52 moles of water × 18 g/mol = 9.36 g
once a recrystallization is completed and filtered, what solvent would be suitable for transferring the leftover solids to filtration funnel
Answer:
To transfer leftover solids to the filtration funnel and wash out crystals after recrystallization, ice cold methanol should be used (the mother liquor used for recrystallization).
Explanation:
Hope this helped
write any two things that should be remembered while writing chemical equation
Answer:
the product and the reactant must be balanced
if u are required to give the mechanism if the reaction it must be written
An atom has 20 electrons. Find out
i. It’s atomic numbers and total number of p-electrons
ii. The value of azimuthal quantum number (l) and magnetic quantum number (m) of the 19th electron of the atom.
iii. It’s group position in the periodic table.
Answer:
it's atomic number is 5 and total number is 10
The atom has an atomic number of 20 and has a total of 12 p electrons.
The azimuthal quantum number (l) of the 19th electron is 0 and the magnetic quantum number (m) of the 19th electron is 0.
It is an element of group 2
The number of electrons in the neutral atom is equal to the number of protons and is also the atomic number of an atom.
An atom is known to be electrically neutral. This is because the number of electrons in the atom is equal to the number of protons in the neutral atom.
The number of protons in the neutral atom is called the atomic number of the atom.
For an element that has 20 electrons, its electronic configuration is;
1s2 2s2 2p6 3s2 3p6 4s2.
The 19th electron is in the 4s orbital hence both the azimuthal and magnetic quantum numbers are zero.
The element has outermost electron configuration ns2 so it mus belong to group 2 of the periodic table.
https://brainly.com/question/16979660
4. What is the percent yield of a reaction that produces 12.5 g CF2Cl2 from 32.9 g of CCl4 and excess HF
Answer:
Percent yield = 48.3%
Explanation:
The reaction is:
CCl₄ + 2HF → CF₂Cl₂ + 2HCl
1 mol of CCl₄ reacts with 2 moles of hydrofluoric acid in order to produce 1 mol of CF₂Cl₂ and 2 moles of hydrogen chloride.
HF is in excess, so the limiting reagent is the CCl₄.
We convert mass to moles:
32.9 g . 1mol / 153.8g = 0.214 moles
Ratio is 1:1. In conclussion: 0.0813 moles of CCl₄ can produce 0.0813 moles of CF₂Cl₂. We convert moles to mass, to determine the theoretical yield:
0.214 mol . 120.91g /mol = 25.8 g
Percent yield = (Yield produced /Theoretical yield) . 100
Percent yield = (12.5 g/ 25.8g) . 100 = 48.3%
Which of the following is the correct way to balance the following chemical question:
2SnO2 + 4H2 -> 2Sn + 4H2O
SnO2 + 2H2 -> Sn + 2H2O
a. Both equation I and II are balanced, but equation I is the correct way to write the balanced equation.
b. Can you divide equation II by another factor and still have it be correct? Why or why not?
c. In a complete sentence, write down a method you could use to determine if an equation is written in the correct way.
Answer:
i have no answer for part A
part B
the one that has a 4 can be divided by 2 because reducing
part c
you can determine if an equation is written in the correct way by balancing the equation as if it had not been done already.
Based upon the intermolecular forces present, rank the following substances according to the expected boiling point for the substance.
a. HCl
b. NaCl
c. N2
d. H2O
which straight-chain alkane would you predict to be the most viscous? all are liquids exhbiting the general bonding pattern ch3-(ch2)n-ch3
The question is incomplete, the complete question his;
Which straight chain alkane below would you predict to be the most viscous? Why? All are liquids exhibiting the general bonding pattern CH3-(CH2)n-CH3
C9H20
C10H22
C5H12
C6H14
C12H26
Answer:
C12H26
Explanation:
Generally, the viscosity of a liquid increases with increase in molecular mass of the substance.
Liquids of high molecular mass do not flow easily. This means that they posses high viscosity.
Thus, since C12H26 has the highest molecular mass among the options given in the question, C12H26 exhibits the greatest viscosity.
Post-Lab Questions
1. A beverage company is having trouble with the production of the dye in their drinks. The color of their drink mix is supposed to be a pale green color, but they often get different results. For each unwanted result, choose the most plausible explanation to help the company improve the formula.
(1pts)
The color of the drink is too pale after adding the dye to the drink because
Choose...too much dye was added to the drink.the water in the drink is evaporating.not enough dye was added to the drink.the wrong dye was added to the drink.
(1pts)
The color of the dye is appearing as red, instead of green because
Choose...too much dye was added to the drink.the water in the drink is evaporating.not enough dye was added to the drink.the wrong dye was added to the drink.
(1pts)
The drink started out the correct color but it is getting darker over time, even though nothing has been added to the drink, because
Choose...too much dye was added to the drink.the water in the drink is evaporating.not enough dye was added to the drink.the wrong dye was added to the drink.
(1pts)
2. Beer's Law states that A=εbc, where A is the absorbance, ε is the molar absorptivity of the solute, b is the path length, and c is the concentration. Identify the experimental evidence from the activity that you have for the dependence of absorbance on each variable.
The evidence for the dependence of absorbance on the variable ε is
increasing the cuvette width increases the absorbance.
changing the compound changes the absorbance behavior.
adding more water decreases the absorbance.
Choose...ABC
(1pts)
The evidence for the dependence of absorbance on the variable b is
increasing the cuvette width increases the absorbance.
changing the compound changes the absorbance behavior.
adding more water decreases the absorbance.
Choose...ABC
(1pts)
The evidence for the dependence of absorbance on the variable c is
increasing the cuvette width increases the absorbance.
changing the compound changes the absorbance behavior.
adding more water decreases the absorbance.
Choose...ABC
(1pts)
3. Describe how you could use the Beer's Law simulation to experimentally determine the best wavelength at which to perform an experiment.
Measure the absorbance for solutions of multiple different solutes and find the minimum absorbance.
Measure the absorbance for solutions with different concentrations and find the slope of the trendline.
Measure the absorbance for the same solution at different wavelengths and find the maximum absorbance.
Measure the absorbance for the same solution in different cuvette sizes and find the y-intercept.
Answer:
1. not enough dye was added to the drink.
The wrong dye was added to the drink
the water in the drink is evaporating
2. Changing the compound changes the absorbance behavior.
3. Measure the absorbance for the same solution in different cuvette sizes and find the y-intercept.
Explanation:
When the beverage company adds dye to the drink, there should be standard quantity added to the drink so that the color of the drink remains constant. When too much dye is added to the drink, the color will get dark brown or black. When the color of drink get lighter than green this means dye is not added in required quantity.
State two conditions necessary for an esterification reaction to take place
Explanation:
Esterification occurs when a carboxylic acid reacts with an alcohol. This reaction can only occur in the presence of an acid catalyst and heat. It takes a lot of energy to remove the -OH from the carboxylic acid, so a catalyst and heat are needed to produce the necessary energy.
Answer:
The Esterification ProcessThe Esterification ProcessEsterification occurs when a carboxylic acid reacts with an alcohol. This reaction can only occur in the presence of an acid catalyst and heat. It takes a lot of energy to remove the -OH from the carboxylic acid, so a catalyst and heat are needed to produce the necessary energy.
The Esterification ProcessEsterification occurs when a carboxylic acid reacts with an alcohol. This reaction can only occur in the presence of an acid catalyst and heat. It takes a lot of energy to remove the -OH from the carboxylic acid, so a catalyst and heat are needed to produce the necessary energy.Once the -OH has been removed, the hydrogen on the alcohol can be removed and that oxygen can be connected to the carbon. Because the oxygen was already connected to a carbon, it is now connected to a carbon on both sides, and an ester is formed.
The Esterification ProcessEsterification occurs when a carboxylic acid reacts with an alcohol. This reaction can only occur in the presence of an acid catalyst and heat. It takes a lot of energy to remove the -OH from the carboxylic acid, so a catalyst and heat are needed to produce the necessary energy.Once the -OH has been removed, the hydrogen on the alcohol can be removed and that oxygen can be connected to the carbon. Because the oxygen was already connected to a carbon, it is now connected to a carbon on both sides, and an ester is formed.The methyl acetate that was formed is an ester. In this image, the green circle represents what was the carboxylic acid (in this case acetic acid), and the red circle represents what was the alcohol (in this case methanol):
This reaction lost an -OH from the carboxylic acid and a hydrogen from the alcohol. These two also combine to form water. So any esterification reaction will also form water as a side product.