Answer:
1,103.47 milliliters
Explanation:
The total percentage of alcohol from solution A and solution B is 29. In a solution that is a mixture of solution A and B, the percentage of alcohol that would be contributed by solution A would be:--
11/29 x 100% = 37.93%
--while the percentage of alcohol that would be contributed by solution B would be:
18/29 x 100 = 62.07%
Hence, if a mixture of A and B has 320 milliliters of alcohol, the amount of alcohol contributed by B would be:
320 x 62.07/100 = 198.624 milliliters
Now, remember that solution B is 18% alcohol. This means that the 18% alcohol content of solution B is 198.624 milliliters. Thus, the total volume of solution B would be:
198.624 x 100/18 = 1,103.47 milliliters.
Therefore, the total milliliters of solution B Amanda used would be 1,103.47.
what’s the answer to this?
3. why are fire tornadoes rare ?
Write down the dissolution equation for nickel(II) perchlorate dissolving in water. (Perchlorate is a polyatomic ion with the formula ClO41-.) If four moles of the ionic compound are dissolved, then how many moles of the ANION are present in the solution?
Answer:
Ni(ClO₄)₂(aq) ⇒ Ni²⁺(aq) + 2 ClO₄⁻(aq)
8 mol ClO₄⁻
Explanation:
Let's consider the dissolution equation for nickel(II) perchlorate dissolving in water.
Ni(ClO₄)₂(aq) ⇒ Ni²⁺(aq) + 2 ClO₄⁻(aq)
The molar ratio of Ni(ClO₄)₂ to ClO₄⁻ is 1:2. If 4 moles of Ni(ClO₄)₂ are dissolved, the moles of ClO₄⁻ formed are:
4 mol Ni(ClO₄)₂ × (2 mol ClO₄⁻/ 1 mol Ni(ClO₄)₂) = 8 mol ClO₄⁻
Di- Ethyl zinc is a chemical used in the library to protect books from worms, its composition is 53% Zinc, 38.9% Carbon, and 8.1% Hydrogen (At mass of Zn=65.4, C=12, H=1). Find the empirical formula of a compound
Answer:
ZnC4H10
Explanation:
The empirical formula of a compound refers to the formula that gives the simplest whole number ratio of each atoms of the elements in the compound.
The empirical formula is calculated thus:
The given percentages in the question represent the mass in grams of each element in the compound.
Zinc= 53%, C= 38.9%, H= 8.1% which represents 53g, 38.9g and 8.1g of each element respectively.
Molar Mass of Zn= 65.4 g/mol
Molar Mass of C= 12 g/mol
Molar Mass of H= 1 g/mol
Step 1: Divide the mass of each element by the molar mass given to convert to moles:
Zn= 53/65.4 = 0.81moles
C= 38.9/12 = 3.24moles
H= 8.1/1 = 8.1moles
Step 2: Divide each mole value by the smallest number of moles calculated, which is 0.81moles:
Zn= 0.81/0.81 = 1
C= 3.24/0.81 = 4
H= 8.1/0.81= 10
This is the mole ratio represented in the subscript of each element in the empirical formula:
That is, Zn (1) C (4) H (10)
Empirical formula= ZnC4H10
Define freezing....... Correct and detailed answers will be marked as Brainliest.
The transformation of liquid into solid when it reaches when it's temperature is below freezing point.
Answer:
Freezing:
When liquid is converted to solid, the process is called freezing.
Conditions for freezing:
1) Temperature must be lowered.
2) The temperature should be below 0 degree centigrade.
Example:
The conversion of "liquid water" into "ice".
=> We can use a "freezer" to freeze things.
Chemical change example
Answer: burning paper
Explanation:
The paper burns in air to form smoke and ash. which makes it a chemical change.
Os subníveis mais energéticos de um dado átomo são: ...4s2 3d10 4p5 a) indique o seu número atomico b) quantos electrões de valência apresenta esse átomo c) a que família pertence?
Answer:
A. 35
B. 7
C. halogênios
Explanation:
Aqui, para responder a essa pergunta, precisaremos conhecer o elemento particular em questão.
..... 4s ^ 2 3d ^ 10 4p ^ 5 significa que está a cinco elétrons da configuração eletrônica do último elemento na primeira camada dos metais pesados.
O último elemento da 1ª série do elemento de transição é o zinco, portanto, como está a apenas 5 elementos de distância, o átomo de que estamos falando é o átomo de Bromo de Bromo.
A. O zinco tem um número atômico 30 e como o bromo está a 5 elementos de distância, seu número atômico é 35
B. Uma vez que pertence ao grupo halogênio, tem 7 elétrons de valência como o resto da família
C. Pertence à família dos halogênios
what are the efficient things needed for a village
Answer:
Those aspects which are something a village needs are specified beneath.
Explanation:
Things being equally necessary to make living simpler and therefore more enjoyable. The government has promised to continue providing basic facilities to either an unpopulated location, including such roads, drinkable water, as well as electric power. Therefore, throughout the village, certain things accessible with maximum variety and quality that have become the basic requirements for this human existence.Iron and aluminum are examples of
Answer:
Iron and aluminum are both examples of metals that are used commonly in everyday life.
Which of the following is not an antioxidant _________
1) Sodium benzoate 2) Sulphur dioxide 3) Sulphite salts 4) Citric acid
Answer: 1. Sodium Benzoate
Explanation: An anti-oxidant is a substance that can help prevent or stop the damage done by free radicals. Examples include; Sulphur Dioxide, Sulphite Salts, Citric Acid, e.t.c
Sodium benzoate is a pure preservative.
how scientific inferences can be made from scientific observations
Answer:
The scientific method is applied to inference through the steps taken to make both inductive and deductive inferences. Inductive inference begins with an observation, and then a pattern of such observation develops. One then makes a hypothesis based on the pattern and finally a theory based on the hypothesis
Hope it helps!
Mark it as Brainliest!!
what is the correct electron configuration for an element with five electrons in the third energy level
[tex]1s^2 2s^2 2p^6 3s^2 3p^3[/tex] is the correct electron configuration for an element with five electrons in the third energy level.
What are elements?Elements are the simplest substances which cannot be broken down using chemical methods.
The shell nearest to the nucleus, 1n, can carry two electrons, while the next shell, 2n, can carry eight, and the third shell, 3n, can carry up to eighteen.
The third shell carries 18 electrons; 2 in a 3s orbital; 6 in three 3p orbitals; and 10 in five 3d orbitals. The fourth shell carries 32 electrons; 2 in a 4s orbital; 6 in three 4p orbitals; 10 in five 4d orbitals; and 14 in seven 4f orbitals.
The element would be phosphorus. Its electron configuration is [tex]1s^2 2s^2 2p^6 3s^2 3p^3[/tex]
Learn more about elements here:
brainly.com/question/1896898
#SPJ2
In the image above the ruler is measuring in centimeters. The blue cylinder falls somewhere between 2.7cm and 2.8cm according to the ruler. Since we can estimate the last digit I would say that the length of the cylinder is 2.76cm. Since I am estimating any number 2.72cm or 2.78cm could also be correct.
Why would 2.755 not be a correct measurement according to estimating the last digit?
Answer:
The answer is below
Explanation:
Resolution is the smallest unit of measurement that can be measured by a measuring instrument. Each point on the ruler is 0.1 cm and the difference between any two points, about 0.01 cm cam be measured. The minimum measurement (resolution) that can be measured by the ruler is 0.01 cm (two decimals), therefore it cannot measure up to three decimal places such as numbers like 2.755.
Examine the given reaction. NH4NO3(s) → NH4+(aq) + NO3–(aq) ΔH° = 25.45 kJ/mol ΔS° = 108.7 J/mol·K Which of the given is correct about the ΔG° at 25 °C?
A)+4,360 J
B)−6,942 J
C)−4,360 J
D)+6,942 J
Answer:
B)−6,942 J /mol
Explanation:
At constant temperature and pressure, you cand define the change in Gibbs free energy, ΔG, as:
ΔG = ΔH - TΔS
Where ΔH is enthalpy, T absolute temperature and ΔS change in entropy.
Replacing (25°C = 273 + 25 = 298K; 25.45kJ/mol = 25450J/mol):
ΔG = ΔH - TΔS
ΔG = 25450J/mol - 298K×108.7J/molK
ΔG = -6942.6J/mol
Right solution is:
B)−6,942 J /molIn the laboratory, a volume of 100 mL of sulfuric acid (H2SO4) is recorded. How many g are there of the liquid if its density is 1.83 g / cm3?
Answer:
[tex]\large \boxed{\text{183 g}}[/tex]
Explanation:
[tex]\begin{array}{rcl}\text{Density} & = & \dfrac{\text{Mass}}{\text{Volume}}\\\\\rho & = &\dfrac{m}{V}\\\\1.83 \text{ g$\cdot$ cm}^{-3} & = & \dfrac{m}{\text{100 cm}^{3}}\\\\m & = & \text{183 g}\\\end{array}\\\text{There are $\large \boxed{\textbf{183 g}}$ of sulfuric acid.}[/tex]
The melting points of ionic compounds _____
Explanation:
ionic compounds have high melting points
3. How many meters above sea level is the base of your landform?
How many meters above sea level is the top of your platform?
Answer:
Base is 715 and top is 850.
Explanation:
715 meters above sea level is the base of my landform and 850 meters above sea level is the top of my platform. Base of landform from a sea level is a starting point of a city or region having same topography. This region has a specific height where it spreads we called it top of the platform. The starting point of my location is 715 meters above sea level spreads up to 850 meters of elevation.
Which are the physical properties of water
Increasing temperature can
The table describes how some substances were formed.
Substance
P.
Q
Description
Formed by boiling pure water
Formed by combining three hydrogen atoms to every nitrogen atom
Formed by adding 5 g of sugar to 1 L of water
Formed by compressing carbon under high pressure
R
S
Based on the given descriptions, which substance is most likely a mixture?
P
Q
R
S
Explanation:
Which is a pure substance?
1. soda
2. gasoline
3. salt water
4. carbon dioxide
carbon dioxide
Bromine, a liquid at room temperature, has a boiling point of 58°C and a melting point of -7.2°C. Bromine can be classified as a
1. compound.
2. impure substance.
3. mixture.
4. pure substance.
pure substance.
Answer:
the answer is
Explanation:
Sugar and water make a homogeneous mixture (the same proportions of its components throughout any given sample).
which statement is true about this reaction 14/7n + 1/1h ------> 15/8o
A. it is a practical source of energy on earth
B.it occurs only outside the solar system
C.its product is heavier than each of its reactants
D.it shows the critical mass of an element
Answer: answer is C
Explanation:
Its product is heavier than each of its reactants is true about this ₇N¹⁴ + ₁H¹ → ₈O¹⁵ reaction
What is Nuclear reaction ?A nuclear reaction is a reaction in which one or more than one nuclides are generate and it collides between two atomic nuclei or one atomic nucleus.
The reaction is
₇N¹⁴ + ₁H¹ → ₈O¹⁵
Now equating the mass number of both sides
14 + 1 = 15 + a
a = 0
Equating atomic number of both sides
7 + 1 = 8 + x
x = 0
Thus, we can say that its product is heavier than each of its reactants is true about this reaction
Hence, option C is correct answer.
Learn more about Nuclear reaction here: https://brainly.com/question/25387647
#SPJ2
which state of matter is Na OH(s)
Explanation:
SOLID
Sodium hydroxide exists in the solid phase at room temperature. You would find it in the lab as hemispherical white solid pellets. The phase of a substance depends on temperature and pressure. As you heat a solid, it will melt and change to the liquid phase.
What is the product of the reaction of pentanoic acid with ethanol in the presence of a strong acid?
Answer:
ethylpentanoate
Explanation:
Alkanoic acids react with alkanols in the presence of mineral acids to yield an ester and water. This is the organic analogue of the inorganic neutralization reaction. The reaction his commonly called esterification. It is an acid catalysed reaction.
The reaction of pentanoic acid and ethanol in the presence of a string acid is shown below;
CH3CH2CH2CH2COOH(aq) + CH3CH2OH(aq) ----> CH3CH2CH2CH2COOCH2CH3(aq) + H2O(l)
The name of the compound formed is ethylpentanoate.
Sulphur dioxide is a common pollutant from burning coal.State two effects caused by this pollutant and also write the chemical equation.
Heya!
Sulfur dioxide - ( SO2 )
Answer:
Sulfur dioxide is a common pollutant caused due to the burning of coal,Is very harmful for the environment and health.Effects:
Health effects-Sulfur dioxide effects the respiratory system which includes the functioning of lungs,respiratory track and causes infections,can also effect and irritate the eyes and causes aggravating conditions such as asthma and chronic bronchitis.As most sulfur dioxide air pollution comes from the burning of coal and oil in power plants. It is a emitted by trains, large ships and other diesel objects that burns alota sulfur fuel so this also effects the environment like plants and others as the air lacks oxygen ,but with more sulfur dioxide.Hope this helps!
Have a nice day!:)
Three determinations were made of the following percentage of oxygen in mercuric oxide. The results were 7.40%, 7.43%, and 7.35%. What was the average percentage?
Perform the forlowing
mathematical operation, and
report the answer to the correct
number of significant figures.
4568/13 = [?]
Answer:
[tex]\large \boxed{350}[/tex]
Explanation:
In multiplication and division problems, the answer can have no more significant figures than the number with the fewest significant figures.
My calculator gives the result:
[tex]\dfrac{4568}{13} = 351.3846154[/tex]
4658 has four significant figures.
13 has two significant figures.
You must round to two significant figures.
That is, you drop all the digits to the right of the 5 — the red line in Fig. 1 below. You are rounding to the nearest ten.
To round a number to the nearest ten, you look at the number in the ones place (1). See Fig. 2.
If the number to be dropped — the digit in the ones place — is less than 5, you drop the digit in the ones place (Fig. 3). It becomes a zero.
The number in the tens place is a trailing zero. It is not significant.
[tex]\text{The quotient of $\dfrac{4658}{13}$ is $\large \boxed{\mathbf{350}}$}[/tex]
What is atom economy? A. All of these B. The system that determines how much 1 mole of a pure element costs. C. The measure of how much of the reactants end up as products in a chemical reaction. D. The system of exchanging electrons that occurs in atoms.
Answer:
C
Explanation:
It's the amount of products you get compared to all the reactants you use. It's kind of like economy in that it's profit, and the higher the atom economy the more products/profit you have.
Answer:
C.) The measure of how much of the reactants end up as products in a chemical reaction.
Explanation:
I got it right on founders edtell.
What is the molarity of a 50.0ml aqueous solution containing 10.0 grams of hydrogen peroxide H2O2
Molarity= No of moles of solute * 1000 / vol solution in ml
No of moles= Given mass / Molar mass
Given Mass of solute (H2O2)= 10g
Molar mass of H2O2=34gmol^-1
No of moles= 10/34= 0.294 moles
Volume of solution=50ml
Molarity = 0.294*1000 / 50
Molarity = 5.8M
The primary function of a scuba regulator is to: Reduce high-pressure gas in the scuba cylinder to a more breathable intermediate pressure. Reduce high-pressure gas in the scuba cylinder to ambient (surrounding) pressure. Provide a diver with a continuous flow of oxygenated air. None of the above.
Answer:
Reduce high-pressure gas in the scuba cylinder to ambient (surrounding) pressure.
Explanation:
The primary function of a scuba regulator would be to reduce high-pressure gas in the scuba cylinder to ambient pressure.
A scuba regulator is a structure found attached to the scuba cylinder usually carried by scuba divers. The structure regulates the pressure of the breathing gas in the cylinder to a safe level before the gas becomes available for the breathing process of divers.
Usually, the gas in a scuba cylinder is at a high level. Hence, what the regulator does is to bring it down to a level that would be safe for the breathing of the diver.
why is an element considered a pure substance
Answer:
Because they cannot be separated into more then one type of substance.
Explanation:
Answer:
Elements are made of only one kind of atom. The particles can be a single atom or a molecule made of only one kind of atom. There is no physical change that can separate elements into more than one kind of substance. This makes an element a pure substance.An element is made up of only one type of atom. An element cannot be broken down into a simpler form.
