What is the slope of the line that goes through (-1, – 7) and (3, 9)?

Answer:

201.1 km²

Step-by-step explanation:

Surface area of a sphere= 4πr², where r = radius

so,

4πr²

= 4×π×4²

= 64π

= 201.1 km² (rounded to the nearest tenth)

Answer:

703.7 in²

Step-by-step explanation:

SA = 2πrh+2πr²

= 2×π×7×9+2×π×7²

= 224π

= 703.7 in² (rounded to the nearest tenth)

Answer:

224π

in²

Step-by-step explanation:

The answer is "[tex]\bold{\frac{2}{105}}[/tex]", and the further calculation can be defined as follows:

When the "r" is the greatest common divisor for the two fractions.

So, we will use Euclid's algorithm:  

[tex]\to \bold{(\frac{8}{15}) -(\frac{188}{35})}\\\\\to \bold{(\frac{8}{15} -\frac{188}{35})}\\\\\to \bold{(\frac{56-54}{105})}\\\\\to \bold{(\frac{2}{105})}\\\\[/tex]

this is  [tex]\bold{(\frac{8}{15}) \ \ mod \ \ (\frac{18}{35})}[/tex]

we can conclude that the GCD for [tex]\bold{\frac{54}{105}}[/tex], when divided by [tex]\bold{\frac{2}{105}}[/tex], will be the remainder is 0.  Rational numbers go from [tex]\bold{\frac{2}{105}}[/tex] with the latter being the highest.

So, the final answer is "[tex]\bold{\frac{2}{105}}[/tex]".

Learn more:

greatest rational number:brainly.com/question/16660879

Answer:

[tex]a_{n} = -64(-\frac{1}{4})^{n-1}[/tex]

it seems like the first term is -64, so lets write the formula accordingly:

a_n = a1(r)^(n-1)

where 'n' is the number of terms

a1 is the first term of the sequence

'r' is the ratio

the ratio is [tex]-\frac{1}{4}[/tex] because -64 * [tex]-\frac{1}{4}[/tex] = 16 and so on...

the explicit formula is :

[tex]a_{n}[/tex] = [tex]-64(-\frac{1}{4} )^{n-1}[/tex]

Answer:

The margin of error for a 90% confidence interval for the mean banking fee is of $0.44.

Step-by-step explanation:

We have that to find our [tex]\alpha[/tex] level, that is the subtraction of 1 by the confidence interval divided by 2. So:

[tex]\alpha = \frac{1 - 0.9}{2} = 0.05[/tex]

Now, we have to find z in the Z-table as such z has a p-value of [tex]1 - \alpha[/tex].

That is z with a pvalue of [tex]1 - 0.05 = 0.95[/tex], so Z = 1.645.

Now, find the margin of error M as such

[tex]M = z\frac{\sigma}{\sqrt{n}}[/tex]

In which [tex]\sigma[/tex] is the standard deviation of the population and n is the size of the sample.

Sample of 31:

This means that [tex]n = 31[/tex]

Assume the population standard deviation is $1.50.

This means that [tex]\sigma = 1.5[/tex]

Calculate the margin of error for a 90% confidence interval for the mean banking fee.

[tex]M = z\frac{\sigma}{\sqrt{n}}[/tex]

[tex]M = 1.645\frac{1.5}{\sqrt{31}}[/tex]

[tex]M = 0.44[/tex]

The margin of error for a 90% confidence interval for the mean banking fee is of $0.44.

Answer:

[tex]( {p - q}^{3} ) \\ = {p}^{2} - 3 {p}^{2} q + 3p {q}^{2} - {q}^{3} [/tex]

Step-by-step explanation:

F(n)=|sin(n)|+|sin(n+1)|

then

F(n+π)=|sin(n+π)|+|sin(n+π+1)|=|sin(n)|+|sin(n+1)|=F(n)

and

F(π−n)=|sin(π−n)|+|sin(π−n+1)|=|sinn|+|sin(n−1)|≠F(n)

so we must prove when n∈(0,π), have

F(n)>2sin12

when n∈(0,π−1),then

F(n)=sinn+sin(n+1)=sinn(1+cos1)+sin1cosn

and n∈(π−1,π),then

F(n)=sinn−sin(n+1)

How prove it this two case have F(n)>2sin12? Thank you

and I know this well know inequality

|sinx|+|sin(x+1)|+|sin(x−1)|≥2sin1,x∈R

9514 1404 393

Answer:

  19 years

Step-by-step explanation:

The compound interest formula tells you the future value of principal P invested at annual rate r compounded n times per year for t years is ...

  A = P(1 +r/n)^(nt)

Solving for t, we get ...

  t = log(A/P)/(n·log(1 +r/n))

Using the given values, we find t to be ...

  t = log(2.13022)/(4·log(1 +0.04/4)) ≈ 19.000

The investment will be worth $213,022 after 19 years.

The first three terms of the Arithmetic Progression are 12, 17 and 22.

For an ARITHMETIC PROGRESSION, AP ;

First term = a

Second term = a + d

Third term = a + 2d

Where, d = common difference ;

If third term exceeds smallest by 10 ;

Third term - first term

a + 2d - a = 10

2d = 10

d = 10/2

d = 5

Sum of the three terms :

a + (a + d) + a + 2d = 51

3a + 3d = 51

d = 5

3a + 3(5) = 51

3a + 15 = 51

3a = 51 - 15

3a = 36

a = 12

The AP would be:

First term, a = 12

Second term, a + d = 12 + 5 = 17

Third term = a + 2(d) = 12 + 10 = 22

Therefore , the first three terms of the AP are :

12, 17 and 22

Learn more about ARITHMETIC PROGRESSION :

https://brainly.com/question/12006170

Answer:

The slope will be negative

Step-by-step explanation:

The slope of the regression line tells us about the relationship or behavior of the dependent and independent variables. In the scenario above, where the weight is being compared with the number of days elapsed. What is expected of the weight and quantity of a bar soap each time it is used for a shower is that it will decrease in weight. Therefore, as the number of days increases, and hence, number of showers rise, the weight of soap will decrease. Hence, we'll obtain a negative slope, one in which the increase in a variable leads to decrease in the other.

Answer:

está inglês não dá para entende

Answer:

m<1=145

m<2=35

m<3=35

Step-by-step explanation:

measure one is supplementary(the angles add to 180) to measure four.

so we do 180-35=145

measure 2 is congruent to measure four because they are corresponding angles

so measure 2=35

and measure 3 is also congruent to measure 4 because the are corresponding angles

so m<3=35

9514 1404 393

Answer:

  (-5, 4)

Step-by-step explanation:

The inside corner moves from (2, -2) to (-3, 2). That is 5 is subtracted from the x-coordinate, and 4 is added to the y-coordinate. (x, y) ⇒ (x -5, y +4)

The translation vector can be written horizontally as (-5, 4), or vertically as ...

  [tex]\displaystyle\binom{-5}{4}[/tex]

Step-by-step explanation:

[tex]thank \: you[/tex]

Answer:

20x⁵⁰

Step-by-step explanation:

With the equation √400x¹⁰⁰

we need to take the square root away separately

√400 = √20*20 = 20

Then with x¹⁰⁰

√x¹⁰⁰ = √x⁵⁰*x⁵⁰ = x⁵⁰

So √400x¹⁰⁰ = 20x⁵⁰

hope this helps

Answer:

10 customers

Step-by-step explanation:

Hi!

Each hour has 60 minutes, so two half hour (30 minute) blocks. Thus, 1 hour = 2 half hours, so 40 hours = 80 half hours.

800 customers in 80 half hours, divide that:

800 customers / 80 half hours = 10 customers / half hour

So, your answer is 10 customers every half hour, or 10 customers every 30 minutes.

Average is [tex]10[/tex] customers per hour

Average is a single number taken as representative of a list of numbers, usually the sum of the numbers divided by how many numbers are in the list.

Total number of customers [tex]=800[/tex]

Total number of hours [tex]=40[/tex]

                                      [tex]=40\times 60[/tex]

                                      [tex]=2400[/tex] minutes

Average (in every [tex]30[/tex] minutes)  [tex]=[/tex] Total number of customers [tex]\div[/tex] Total number of hours

                                                   [tex]=\frac{800}{2400 \div 30}[/tex]

                                                   [tex]=10[/tex] customers per hour

For more information:

https://brainly.com/question/19622178?referrer=searchResults                                                  

Let missing side be x

If both polygons are similar

[tex]\\ \sf\longmapsto \dfrac{3}{4}=\dfrac{18}{x}[/tex]

[tex]\\ \sf\longmapsto 3x=4(18)[/tex]

[tex]\\ \sf\longmapsto 3x=72[/tex]

[tex]\\ \sf\longmapsto x=\dfrac{72}{3}[/tex]

[tex]\\ \sf\longmapsto x=24[/tex]

Answer:

TRUE

Step-by-step explanation:

I SEEN SOME ONE ELSE WIT 5 STARS SAY SO(:

The given segment can form triangle. Therefore, the given statement is true.

A polygon has three edges as well as three vertices is called a triangle. It's one of the fundamental geometric shapes. In Euclidean geometry, each and every three points that are not collinear produce a distinct triangle and a distinct plane. In other words, every triangle was contained in a plane, and there is only single plane that encompasses that triangle.

All triangles are enclosed in a single plane if all of geometry is the Euclidean plane, however this is no longer true in higher-dimensional Euclidean spaces. Unless when otherwise specified, this article discusses triangles within Euclidean geometry, namely the Euclidean plane. The given segment can form triangle.

Therefore, the given statement is true.

To know more about triangle, here:

https://brainly.com/question/14712269

#SPJ7

Step-by-step explanation:

here's the answer to your question

Answer:

x = 7 and

y = 4[tex]\sqrt{2}[/tex]

Step-by-step explanation:

as you can see from the image we need to draw a line and when we do so we get a special right triangle with angle measures 90-45-45 and side lengths represented by a-a-a[tex]\sqrt{2}[/tex]

since the line we drew is parallel to the rectangle's length it's = 4 and so the number represented with a is also = 4

from there on we see x = 7 and y = 4[tex]\sqrt{2}[/tex]

Answer:

I can confirm, it is B! x=7 and y=4sqrt2

Step-by-step explanation:

edge

Answer:

9/20

Step-by-step explanation:

450/1000

this is not the answer, because it is not simplified

so here we have to find common factor and simplifying

________________________________________________

450/1000 is simplified to 9/20, and it can no longer be simplified.

0.012 is the answer!

I hope this helps you out! :D

[tex]\\ \sf\longmapsto \dfrac{12}{1000}[/tex]

[tex]\\ \sf\longmapsto 0.012[/tex]

More:-

[tex]\\ \sf\longmapsto \dfrac{1}{10}=0.1[/tex]

[tex]\\ \sf\longmapsto \dfrac{1}{100}=0.01[/tex]

The area bounded by a chord and arc it intercepts is known as a segment of a circle segment of a circle

The area of the circle enclosed by line PL and arc PL is approximately 37.62 square units

The reason the above value is correct is as follows:

The given parameters in the question are;

The radius of the circle, r = 11

The length of the chord PL = 16

The measure of angle ∠PAL = 93°

Required:

The area of part of the circle enclosed by chord PL and arc PL

Solution:

The shaded area of the given circle is the minor segment of the circle enclosed by line PL and arc PL

The area of a segment of a circle is given by the following formula;

Area of segment = Area of the sector - Area of the triangle

Area of segment = Area of minor sector APL - Area of triangle APL

Area of minor sector APL:

Area of a sector = (θ/360)×π·r²

Where;

r = The radius of the circle

θ = The angle of the sector of the circle

Plugging in the the values of r and θ, we get;

Area of the minor sector APL = (93°/360°) × π × 11² ≈ 98.2 square units

Area of Triangle APL:

Area of a triangle = (1/2) × Base length × Height

Therefore;

The area of ΔAPL = (1/2) × 16 × 11 × cos(93°/2) ≈ 60.58 square units

Required shaded area enclosed by line PL and arc PL:

Therefore, the area of shaded segment enclosed by line PL and arc PL is found as follows;

Area of the required segment PL ≈ (98.2 - 60.58) square units = 37.62 square units

The area of the circle enclosed by line PL and arc PL ≈ 37.62 square units

Learn more about the finding the area of a segment can be found here:

https://brainly.com/question/22599425

The area of the circle enclosed by line segment PL and circle arc PL is 37.80 square units.

The calculation of the area between line segment PL and circle arc PL is described below:

1) Calculation of the area of the circle arc.

2) Calculation of the area of the triangle.

3) Subtracting the area found in 2) from the area found in 1).

Step 1:

The area of a circle arc is determined by the following formula:

[tex]A_{ca} = \frac{\alpha\cdot \pi\cdot r^{2}}{360}[/tex] (1)

Where:

[tex]A_{ca}[/tex] - Area of the circle arc.

[tex]\alpha[/tex] - Arc angle, in sexagesimal degrees.

[tex]r[/tex] - Radius.

If we know that [tex]\alpha = 93^{\circ}[/tex] and [tex]r = 11[/tex], then the area of the circle arc is:

[tex]A_{ca} = \frac{93\cdot \pi\cdot 11^{2}}{360}[/tex]

[tex]A_{ca} \approx 98.201[/tex]

Step 2:

The area of the triangle is determined by Heron's formula:

[tex]A_{t} = \sqrt{s\cdot (s-l)\cdot (s-r)^{2}}[/tex] (2)

[tex]s = \frac{l + 2\cdot r}{2}[/tex]

Where:

[tex]A_{t}[/tex] - Area of the triangle.

[tex]r[/tex] - Radius.

[tex]l[/tex] - Length of the line segment PL.

If we know that [tex]l = 16[/tex] and [tex]r = 11[/tex], then the area of the triangle is:

[tex]s = \frac{16+2\cdot (11)}{2}[/tex]

[tex]s = 19[/tex]

[tex]A_{t} = \sqrt{19\cdot (19-16)\cdot (19-11)^{2}}[/tex]

[tex]A_{t} \approx 60.399[/tex]

Step 3:

And the area between the line segment PL and the circle arc PL is:

[tex]A_{s} = A_{ca}-A_{t}[/tex]

[tex]A_{s} = 98.201 - 60.399[/tex]

[tex]A_{s} = 37.802[/tex]

The area of the circle enclosed by line segment PL and circle arc PL is 37.80 square units.

Answer:

✔ a strong positive

✔ weaken

✔ decrease

ED2021

Answer:

The scatterplot including only the blue data points shows  

✔ a strong positive

association. Including the orange data point at (86, 0.4) would  

✔ weaken

the correlation and  

✔ decrease

the value of r.

Step-by-step explanation:

Answer:

FH ≈ 6.0

Step-by-step explanation:

Using the sine ratio in the right triangle

sin49° = [tex]\frac{opposite}{hypotenuse}[/tex] = [tex]\frac{FH}{FG}[/tex] = [tex]\frac{FH}{8}[/tex] ( multiply both sides by 8 )

8 × sin49° = FH , then

FH ≈ 6.0 ( to the nearest tenth )

Answer:

6

Step-by-step explanation:

sin = opposite/hypotenuse

opposite = sin * hypotenuse

sin (49) = 0,75471

opposite = 0,75471 * 8 = 6,037677 = 6

Answer:

When time is short and you just want a rough estimate of the standard deviation, turn to the range rule to quickly estimate the standard deviation value. The standard deviation is approximately equal to the range of the data divided by 4. That's it, simple.

Answer:

200000

by 10009

Step-by-step explanation:

nbebsbsbsbbsbsbsbsbBz

66) ten less than a number

Let the number be n

= n - 10

67) the product of x and y

= x × y or xy

68) The algebraic expression for ten less than n

= n - 10

Must click thanks and mark brainliest

We are testing a hypothesis. So, first we identify the null and the alternative hypothesis, then we find the test statistic, and with the test statistic, the p-value is found.

Null and alternative hypothesis:

Claim the the proportion is of 60%, thus, the null hypothesis is:

[tex]H_0: p = 0.6[/tex]

Test if the proportion is greater than 60%, thus, the alternative hypothesis is:

[tex]H_1: p > 0.6[/tex]

And the answer to the first question is given by option c.

Classification:

We are testing if the proportion is greater than a value, so it is a right-tailed test.

Test statistic:

[tex]z = \frac{X - \mu}{\frac{\sigma}{\sqrt{n}}}[/tex]

In which X is the sample mean, [tex]\mu[/tex] is the value tested at the null hypothesis, [tex]\sigma[/tex] is the standard deviation and n is the size of the sample.

0.6 is tested at the null hypothesis:

This means that [tex]\mu = 0.6, \sigma = \sqrt{0.4*0.6}[/tex]

Survey, conducted over a two week period, found that in a sample of 100 people, 69% of them said they are confident of meeting their goals.

This means that [tex]n = 100, X = 0.69[/tex]

Value of the test statistic:

[tex]z = \frac{X - \mu}{\frac{\sigma}{\sqrt{n}}}[/tex]

[tex]z = \frac{0.69 - 0.6}{\frac{\sqrt{0.4*0.6}}{\sqrt{100}}}[/tex]

[tex]z = 1.837[/tex]

The test statistic is z = 1.837.

p-value:

The p-value of the test is the probability of finding a sample proportion above 0.69, which is 1 subtracted by the p-value of z = 1.837.

Looking at the z-table, z = 1.837 has a p-value of 0.9669.

1 - 0.9669 = 0.0331

The p-value is 0.0331.

Decision:

The p-value of the test is 0.0331 > 0.01, and thus:

a. Fail to reject the null hypothesis

For another example of a problem of a test of hypothesis, you can take a look at:

https://brainly.com/question/24166849

Answer:

255,024

Step-by-step explanation:

24 x 23 x 22 x 21

24 options for the first member

23 options for the second member

22 options for the third member

21 options for the last member