Answer:
The label may instruct you to shake a liquid medicine before using so that the active ingredients are evenly distributed throughout it.
Explanation:
Answer:
maybe because if somehow the liquids get separated then shaking them up would mix them back to how they are suppose to be originally.
Explanation:
what is transition state
Answer:
transition state is a point in which electrons been removed from the atom
Answer:
The highest energy structure in the reaction coordinate.
Explanation:
How are the vapor pressure and boiling point of alkynes affected as the chain length increases?
Answer:
Answer to the following question is as follows;
Explanation:
Alkynes' vapour pressure and normal boiling points are altered when chain length grows, since vapour pressure rises while boiling point falls.
Vapour pressure always include pressure entered by vapour with its condensed phase, pressure include molecules force of attraction include vapour
Hiii pls help me to write out the ionic equation
Answer:
STEP I
This is the balanced equation for the given reaction:-
[tex] 2KOH_{(aq)} + H_2SO_4{}_{(aq)} \rightarrow K_2SO_4{}_{(aq)} + 2H_2O_{(l)} [/tex]
STEP II
The compounds marked with (aq) are soluble ionic compounds. They must be
broken into their respective ions.
see, in the equation KOH, H2SO4, and K2SO4 are marked with (aq).
On breaking them into their respective ions :-
2KOH -> 2K+ + 2OH-H2SO4 -> 2H+ + (SO4)2-K2SO4 -> 2K+ + (SO4)2-STEP III
Rewriting these in the form of equation
[tex] \underline{\pmb{2K^+} }+ 2OH^- + 2H^+ + \pmb{\underline{{SO_4{}^{2-}}} \: \rightarrow \: \underline{\pmb{2K^+}}} + \underline{\pmb{SO_4{}^{2-}}} + 2H_2O [/tex]
STEP IV
Canceling spectator ions, the ions that appear the same on either side of the equation
(note: in the above step the ions in bold have gotten canceled.)
[tex] \boxed{ \mathfrak{ \red{ 2OH^-{}_{(aq)} + 2H^+{(aq.)} \rightarrow H_2O{}_{(l)}}}} [/tex]
This is the net ionic equation.
____________________________
[tex] \\ [/tex]
[tex]\mathfrak{\underline{\green{ Why\: KOH \:has\: been\: taken\: as\: aqueous ?}}} [/tex]
KOH has been taken as aqueous because the question informs us that we have a solution of KOH. by solution it means that KOH has been dissolved in water before use.[Alkali metal hydroxides are the only halides soluble in water ]
Is FeS iron (ll) sulfide or iron (lll) sulfide?
Answer:
the valence of S is -2. For FeS to be neutral the valence of Fe used must be +2
and since Iron (II) has its valency 2, FeS will be Iron (II) Sulfide.
nguyên tử sắt có điện tích hạt nhân là 26+. trong nguyên tử, số hạt mang điện nhiều hơn số hạt không mang điện là 22. Hãy xác định số khối của nguyên tử sắt
Answer:
I don't know yr language
True or false, The universal gas constant, R, is . 0821 when we use mm Hg as our unit for pressure
Answer:
False
Explanation:
R = gas constant = 0.0821 atm•L/mol•K
Exprese la concentración de una solución de H3PO4 al 30 % en masa y con una densidad de 1.39 g/mL en: M, y N.
Respuesta:
4.26 M; 12.8 N
Explicación:
Primer paso: Calcular la concentración volumétrica (Cv)
Usaremos la siguiente expression.
Cv = Cg × ρ
Cv = 30 g%g × 1.39 g/mL = 41.7 g%mL
Segundo paso: Calcular la molaridad
La concentración volumetrica es 41.7 g%mL, es decir, hay 41.7 gramos de soluto cada 100 mL de solución. Usaremos la siguiente fórmula para molaridad.
M = masa de soluto / masa molar de soluto × litros de solución
M = 41.7 g / 97.99 g/mol × 0.1 L = 4.26 M
Tercer paso: Calcular la normalidad
Usaremos la siguiente fórmula.
N = M × Z
donde Z para un ácido es igual al número de protones.
N = M × Z
N = 4.26 mol/L × 3 eq/mol = 12.8 N
The table below gives the equilibrium concentrations for this reaction at a certain temperature : N2(g) + O2(g) 2NO(g) what is the equilibrium constant for the reaction?
A. 1 x 10-5
B. 7 x 10-3
C. 70
D. 100
The equilibrium concentrations for the given reaction at a certain temperature will be 100.
What is equilibrium?During a reversible chemical process, chemical equilibrium is the state where there would be no net change in the number of reactants as well as products.
What is the reaction?The reaction is the process in which by the combination of more than one element new kind of element will be formed.
Given data:
The given reaction is [tex]N_{2} (g) + O_{2} (g)[/tex] → [tex]2NO(g)[/tex]
The equilibrium constant (K) = [tex][NO]^{2} /[N_{2}][O_{2}][/tex]
Put the value of the given data in the above equation.
K = [tex]=[0.002 M]^{2} / [0.65M][0.45M]\\=[4*10^{-6} ]/ [0.2950]\\= [4*10^{-6} ] / 2950*10^{-4}\\= 1.35 * 10^{-5}[/tex]
Therefore, the equilibrium constant will be 1.35 × [tex]10^{-5}[/tex]
To know more about reaction and equilibrium
https://brainly.com/question/13463225
#SPJ2
An organic compound has the empirical formula C2H4O. what is the compound?
a. butanoic acid
b. butanol
c. ethanoic acid
d. ethanol
Answer:
The correct answer is - butanoic acid
Explanation:
An empirical formula is the general formula or base formula that is the simplest positive integer ratio of atoms present in a compound. The empirical formula is specific to specific compounds or types of compounds.
Among the given options, the empirical formula C2H4O is butanoic acid as the molecular formula of butanoic acid is - C4H8O2 which is multiple of C2H4O. Other compounds have different than this empirical formula.
Draw the following structures and name them :
I. CH3CH2(OH)
II.CH3CH2CH(CH3)C(Cl)2C(l)2CH(F)OH
III.CH3CH(CH3)CHO
IV.CH2=CH(OH)
V.CH3OCH2CH3
Answer:
hope this helps.answer is in the picture
Please help!!
Chemical reactions and Nuclear reactions cause matter to change in different ways. Witch TWO statements decribe how matter changes only in nuclear reactions.
• A. The automic nuclei change.
• B. Some energy is transformed into mass.
• C. The total mass of the reactions is conserved.
• D. New elements are formed
Answer:
Answer is 2nd
Explanation:
some energy is transformed into mass
On the set of a movie, dry ice (solid carbon dioxide) is used to make the appearance of fog. After the dry ice is taken out of cold storage, it is placed on the ground. As dry ice warms, it converts from a solid directly to a gas. Gaseous carbon dioxide has a density greater than air, thus allowing it to move across the ground as if it were fog. Which statement best describes this process
Answer:
- The dry ice is cooling the ground it rests upon as heat is transferred from the ground to the dry ice.
Explanation:
The above statement correctly elaborates the process of using dry ice to develop the appearance of fog. When the dry ice is placed on the ground, the heat of the ground is transferred to the dry ice. This will result in the increase in the kinetic energy of the CO2 molecules. Thus, the solid will directly convert into gas and it will lead to the formation of gas in the air. Since CO2 possesses a higher density, it will look like fog and thus, giving the perfect shot for the fog scene.
Question 8 of 10
Which of the following is made of matter?
A. Light
B. Energy
C. The sun
D. Heat
Answer: i Choose the sun
because it has mass
Explanation: matter is anything that has mass and occupies space / Volume
and the sun has mass though it is not a solid one, and is made up of matter
HOPE THIS HELPSS!!!!
What is a chemical reaction?
Answer:
A chemical reaction is a process in which one or more substances, also called reactants, are converted to one or more different substances, known as products. ... A chemical reaction rearranges the constituent atoms of the reactants to create different substances as products.Explanation:
hyy can you my friend lol ,, ☺️is SrO a conductor of electricity
Answer:
No and Yes
Explanation:
it depends bc its an ionic compound, therefore can't conduct electricity when SOLID, BUT unless it DISSOLVES in water it can conduct
make a 450 gram solution with the mass by mass concentration of 7% how much salt and water do you need to mix
What is the total pressure in millimeters of mercury,
exerted by the gas mixture
P= _______ units?
Answer:
87059.50558 pa
Explanation:
Dalton's law of partial pressure states that Ptotal=P1 +P2+ P3
417mmHg + 150mmHg +86mmHg =653 mmHg
convert it to Pa, your answer is 87059.50558Pa.
I hope I'm of help to you
how much energy is required to melt 2kg of aluminium
option with explaination
Answer:
B. it's water of crystallization.
the water of crystallization, that is the number of molecules of water attached to One Copper atom gives blue color to the hydrated salt (CuSO4.5H2O)
PLEASE HELP QUICK!!! How many molecules are there in 4.00 L of
glucose, C6H1206? Please show your work!!
What is the pH of a 1.0 x 10-3 M KOH solution?
A. 10
B. 4.0
C. 11
D. 3.0
Answer:
Option C. 11
Explanation:
We'll begin by calculating the concentration of the hydroxide ion [OH¯] in the solution. This can be obtained as follow:
In solution, KOH will dissociate as follow:
KOH (aq) <=> K⁺(aq) + OH¯(aq)
From the balanced equation above,
1 mole of KOH reacted to produce 1 mole of OH¯.
Therefore, 1×10¯³ M KOH will also react to produce 1×10¯³ M OH¯.
Thus, the concentration of hydroxide ion [OH¯] in the solution is 1×10¯³ M
Next, we shall determine the pOH of the solution. This can be obtained as follow:
Concentration of hydroxide ion [OH¯] = 1×10¯³ M
pOH =?
pOH = –Log [OH¯]
pOH = –Log 1×10¯³
pOH = 3
Finally, we shall determine the pH of the solution. This can be obtained as follow:
pOH = 3
pH =?
pH + pOH = 14
pH + 3 = 14
Collect like terms
pH = 14 – 3
pH = 11
Below is a picture of two blocks made of different materials. Block A Block B grams grams If Block A is located on the Moon and Block B is located on Earth, which of the following is true about the two blocks?
a: they have the same density.
b: they have the same volume.
c: they have the same mass.
d: they have the same weight.
Answer:
A
Explanation:
this is because density is the mass per unit volume of an object
If Block A is located on the Moon and Block B is located on Earth, then the truth about the two blocks will be they have the same mass, and they have the same density. The correct option is a and c.
What is mass?Mass is a physical body's total amount of matter. By multiplying the object's volume and density, it can be determined.
Density, volume, mass, and weight are the four entities that are supplied. The volume and weight of the object on the moon will alter as a result of these entities. They will be different in the universe if he goes to Earth.
The location and gravitational field of an object do not affect its density or mass.
Thus, the correct options are a: they have the same density, and c. they have the same mass.
To learn more about mass, refer to the link:
https://brainly.com/question/20195594
#SPJ2
Which element has 2 valence electrons in the 2s sublevel?
Answer:
beryllium is the answer.
I hope this will help you
Is this population more likely to grows slowly or quickly in the next 10 years
nobody can say it is uncertain but in my opinion it will grow quickly in the next 10 years
Which diagram represents this molecule
Answer:
I think it is C
Explanation:
Hope this helps!! :)
If I'm wrong, then greatest apologies
draw the structure of iso -pentylpropanoate
How much heat must be transferred to 55 g of ice to change the ice's
temperature from -13°C to -5.0°C? (The specific heat capacity of ice is 2.11
J/g.°C)
Name each compound. Do not capitalize element names. An example can be seen
below.
Ex. SF6: sulfur hexfluoride
a. H2O:
b. PC15:
C. SiF4:
d. N20
Answer:
a. H2O: dihydrogen monoxide
b. PCl5: Phosphorus pentachloride
c. SiF4: Silicon tetrafluoride
d. N20: dinitrogen oxide
TIMED HELP ASAP
19.11 g of MgSO₄ is placed into 100.0 mL of water. The water's temperature increases by 6.70°C. Calculate ∆H, in kJ/mol, for the dissolution of MgSO₄. (The specific heat of water is 4.184 J/g・°C and the density of the water is 1.00 g/mL). You can assume that the specific heat of the solution is the same as that of water.
Answer:
TIMED HELP ASAP
19.11 g of MgSO₄ is placed into 100.0 mL of water. The water's temperature increases by 6.70°C. Calculate ∆H, in kJ/mol, for the dissolution of MgSO₄. (The specific heat of water is 4.184 J/g・°C and the density of the water is 1.00 g/mL). You can assume that the specific heat of the solution is the same as that of water.
Answer:
-21.03 kJ/mol
Explanation:
∆H is enthalpy. Enthalpy is the total heat content of a system.
So we can establish that ∆H = q (heat)
The formula for heat (q)
q = cm∆T
c = specific heat capacity
m = mass of substance
∆T= change of temperature
Since we are calculating the enthalpy of the SOLUTION. We must account for both the mass of water and the mass of MgSO₄ in our q formula.
All you gotta do is plug and chug at this stage.
∆H = q = cm∆T = (4.184)(19.11+100.0)(6.70) = 3338.986808 Joules
We have now calculated the heat (aka enthalpy) of the solution.
BUT
Remember! The problem asked for enthalpy in kj....
Use this conversion factor.
1000 J = 1 kJ
3338.986808 Joules * 1kJ/1000 J = 3.338986808 kJ
We were asked to find ∆H for the dissolution of MgSO4 in units of kj/mol so we are not finished.
Take the grams of MgSO4 in the problem and convert it into moles using its molar mass.
MgSO4 molar mass = 120.3676 g
1 mol = 120.3676 g MgSO4 <---- Use this as a conversion factor
19.11 g MgSO4 * 1 mol MgSO4/120.3676 g = 0.15876365 mol MgSO4
Now that you've calculated the moles of MgSO4 in this solution. You can divide your heat by it.
q dissolution = 3.338.986808 kJ/ 0.15876365 mol = 21.03 kj/mol
Note that the problem tells us that the temperature of water increases.
This means that the water is experiencing an endothermic process (heat is being absorbed from MgSO4) . Mathematically, this would be indicated by a positive sign. ---> +q
We can assume MgSO4 is losing heat as it is placed into the water. It is experiencing an exothermic process (heat is being lost). Mathematically, this would be indicated by a negative sign. ----> -q
So if we're calculating the enthalpy for the dissolution of MgSO₄ ....the value we've arrived at must be negative.
Answer
∆H = 21.03 kj/mol :)))))
I hope that helped...I feel like my explanation was a bit convoluted.
name and describe four different types of chemical reactions and explain how you can predict which type might occur
Answer:
1. Combination (Synthesis) reaction
A + B → AB
2. Decomposition reaction
AB → A + B
3. Displacement reaction
A + BC → AB + C
4. Double displacement reaction
AB + CD → AD + BC
5. Combustion reaction
[tex]CH_{4} + 20_{2} → CO_{2} 2Hx_{2} O[/tex]
A combination reaction, also known as a synthesis reaction, is a reaction in which two or more substances combine to form a single new substance. Combination reactions can also be called synthesis reactions.
A decomposition reaction is a reaction in which a compound breaks down into two or more simpler substances.
A single-replacement reaction is a reaction in which one element replaces a similar element in a compound.
A double-replacement reaction is a reaction in which the positive and negative ions of two ionic compounds exchange places to form two new compounds.
A combustion reaction is a reaction in which a substance reacts with oxygen gas, releasing energy in the form of light and heat. Combustion reactions must involve O2 as one reactant. The combustion of hydrogen gas produces water vapor
Explanation: Hope this helps and good luck :))