Determine the number of hydrogen atoms connected to each carbon atom: The bond-line structure of a compound has a SMILES string of CC1CCN(CC1N(C)C2=NC=NC3=C2C=CN3)C(=O)CC#N. All the carbon atoms of the compound are highlighted and labeled a through p.

Answer:

Explanation:

Your mom

Answer:

B. only formed in laboratories

Explanation:

i know

Isotopes are only formed in Laboratories. hence, Option (B) is correct.

Each of two or more forms of the same element that contain equal numbers of protons but different numbers of neutrons in their nuclei, and hence differ in relative atomic mass but not in chemical properties; in particular, a radioactive form of an element is known as Isotope.

Isotopes are two or more types of atoms that have the same atomic number and position in the periodic table, and that differ in nucleon numbers due to different numbers of neutrons in their nuclei.

Therefore, Isotopes are only formed in Laboratories. hence, Option (B) is correct.

Learn more about Isotopes here ;

https://brainly.com/question/12955625

#SPJ2

Answer:

electric charge

Explanation:

Charged particles are deflected in an electric or a magnetic field. The particles discovered by J.J. Thomson were charged particles.

When these charged particles are passed through electric and magnetic fields, deflection occurs depending on the nature of the charge.

A positive charge is deflected towards the negative part of an electric field or the south pole of a magnetic field.

A negative charge is selected towards the positive end of an electric field or the north pole of a magnetic field.

Explanation:

Sulfuric Acid (H2SO4) is a strong mineral acid that has is colorless when pure. This chemical is used as a chemical intermediate to manufacture other chemicals and cleaning metal surfaces. The formula for sulfuric acid is H2SO4. The molar mass of sulfuric acid is 98.07848 g mol.

Answer: c

Explanation:   Filtration is technically defined as the process of separating suspended solid matter from a liquid

Pulp is a lignocellulosic fibrous material prepared by chemically or mechanically separating cellulose fibers from wood, fiber crops .

Many commercial juices are filtered to remove fiber or pulp.

The correct answer is C, Pulp.

Orange is an example of a citrus fruit. Every citrus fruit has a pulp. The of pulp a citrus fruit is that stringy content in the endocarp of the fruit .

The pulp of a citrus fruit is where its juice is found.

When you want to prepare orange juice, you need to remove the pulp of the citrus fruit. This is done by filtering out the pulp from the juice.

Filtration is the process of removing larger particles. For a liquid juice, filtration is the process of removing solid particles from the orange juice.

https://brainly.com/question/11403039

Answer:

a mixture that doesn't really show the ingredients or things put into the material or food.

Answer:

True

Explanation:

Aromatic rings undergo nucleophillic substitution reactions in the presence of a electron withdrawing group which stabilizes the Meisenheimer complex.

When the nucleophile attacks the ring carbon atom carrying the eventual leaving group. A resonance-stabilized carbanion intermediate called a Meisenheimer complex is formed.

Subsequent loss of the leaving group from the intermediate complex yields the product of the reaction.

Answer:

1.1 × 10²¹ NH₃ molecules

Explanation:

From the given information:

We were being told that the number of the hydrogen (H) atoms present in the sample of NH3 = 3.3 × 10²¹ hydrogen.

However, it signifies that each molecule of ammonia harbors 3hydrogen (H) atoms.

Hence,  the number of  molecules of NH₃ present;

[tex]\mathsf{=\dfrac{3.3\times 10^{21}}{3} \ molecules \ of \ {NH_3}}[/tex]

= 1.1 × 10²¹ NH₃ molecules

Answer:

a. Na(s); b. Al(s); c. Zn(s)

Explanation:

Let's consider the following redox reactions.

a. ZnCl₂ (aq) + 2 Na(s) → Zn(s) + 2 NaCl(aq)

Na is oxidized because its oxidation number increases from 0 to +1 (in NaCl) whereas Zn is reduced because its oxidation number decreases from 2+ (in ZnCl₂) to 0.

b. Al(s) + FeBr₃ (aq) → AlBr₃ (aq) + Fe(s)

Al is oxidized because its oxidation number increases from 0 to +3 (in AlBr₃) whereas Fe is reduced because its oxidation number decreases from 3+ (in FeBr₃) to 0.

c. FeSO₄ (aq) + Zn(s) → Fe(s) + ZnSO₄(aq)

Zn is oxidized because its oxidation number increases from 0 to +2 (in ZnSO₄) whereas Fe is reduced because its oxidation number decreases from 2+ (in FeSO₄) to 0.

Answer:

1)In organic chemistry, the bromine test is a qualitative test for the presence of unsaturation (carbon-to-carbon double or triple bonds), phenols and anilines. ... The more unsaturated an unknown is, the more bromine it reacts with, and the less coloured the solution will appear.

2)The equation for incomplete combustion of propane is: 2 C3H8 + 9 O2 → 4 CO2 + 2 CO + 8 H2O + Heat. If not enough oxygen is present for complete combustion, incomplete combustion occurs. The result of incomplete combustion is, once again, water vapour, carbon dioxide and heat. But it also produces carbon monoxide.

Explanation:

3)Propene, also known as propylene, is an unsaturated organic compound with the chemical formula {\displaystyle {\ce {CH3CH=CH2}}}. It has one double bond, and is the second simplest member of the alkene class of hydrocarbons. It is a colorless gas with a faint petroleum-like odor. 

Formula: C3H6

IUPAC ID: Propene

4)Margarines are chemically created during hydrogenation which, until January 1, 2006, relied upon trans fats to solidify their vegetable oils. Food companies have been exploring options for replacing trans fat in partially hydrogenated margarine.

Answer:

boiling point is the physial property of matter

The option that is showing the physical property of the matter is boiling point, the correct option is C.

A physical property is any measurable property whose value describes the state of a physical system.

Changes in a system's physical properties can be used to describe its transitions between momentary states. Physical properties are also known as observables. They do not have modal properties.

Physical properties include color, phase, odor, and boiling point. Since reactivity with oxygen is dependent on the chemical nature of the object, it is not a physical property.

A compound's physical property is one that can be observed and measured. The chemical composition of a compound is unaffected by a physical property.

Thus, the correct option is C.

For more details regarding physical property, visit:

https://brainly.com/question/18327661

#SPJ6

Answer:

a well well well all el well eto eto rup wp will rup ei well dll alsof well po team app app app well piz wmv epic enz

In a REDOX titration, one specie is oxidized while the other is reduced. The concentration of methanol is 0.012  mol L-1. Methanol is the oxidizing agent while permanganate is the reducing agent.

The average titre value is; [tex]\frac{7.95 + 7.10 + 7.00 + 7.10}{4}[/tex] = 7.29 mL

Equation of the reaction is:

[tex]4MnO4- + 12H+ + 5CH3OH ----> 4Mn2+ + 11H2O + 5HCOOH[/tex]

Concentration of oxidizing agent = CA = ?

Concentration of reducing agent = CB = 0.0021 mol L-1

Volume of oxidizing agent =  VA= 7.29 mL

Volume of reducing agent = VB = 50.00 mL

Number of moles of oxidizing agent NA = 4

Number of moles of reducing agent NB = 5

Note that NA and NB are obtained from the balanced reaction equation

CAVA/CBVB = NA/NB

CAVANB = CBVBNA

CA =  CBVBNA/VANB

CA = 0.0021 mol L-1 * 50.00 mL * 4/7.29 mL * 5

CA= 0.012  mol L-1

For a comprehensive definition of redox titration see

https://brainly.com/question/24018439

Answer:

number of moles of gas increases the volume also increases.

Answer:

"[tex]N^+(g) \rightarrow N^{2+}(g) + e^-[/tex]" is the appropriate answer.

Explanation:

Thus the above is the correct answer.

Answer:

A

Explanation:

1-ethyl-4-methylcyclohexane

i believe it is A

hope that helped :)

Explanation:

The given balanced chemical equation is:

[tex]2 HI(g) <--> H_2 (g) + I_2 (g)[/tex]

The value of Kc at 445oC is 0.020.

[HI]=1.5M

[H2]=2.50M

[I2]=0.05M

The value of Qc(reaction quotient ) is calculated as shown below:

Qc has the same expression as the equilibrium constant.

[tex]Qc=\frac{[H_2][I_2]}{[HI]^2} \\Qc=(2.50Mx0.05M)/(1.5M)^2\\Qc=0.055[/tex]

Qc>Kc,

Hence, the backward reaction is favored and the formation of Hi is favored.

Among the given options, the correct answer is option d. Qc is greater than Kc; more HI will be produced.

The kinetic-molecular theory of gases assumes that ideal gas molecules

(1) are constantly moving;

(2) have negligible volume;

(3) have negligible intermolecular forces;

(4) undergo perfectly elastic collisions; and

(5) have an average kinetic energy proportional to the ideal gas's absolute temperature.

The five main postulates of the KMT are as follows:

(1) the particles in a gas are in constant, random motion,

(2) the combined volume of the particles is negligible

(3) the particles exert no forces on one another,

(4) any collisions between the particles are completely elastic.

(5) the average kinetic energy of the particles is proportional to the temperature in kelvins.

Explanation:

Following are the kinetic theory of gases postulates:

1) Space-volume to molecules ratio is negligible.

2)There is no force of attraction between the molecules at normal temperature and pressure. The force of attraction between the molecules build when the temperature decreases and the pressure increases.

3) There is large space between the molecules resulting in continuous motion.

4) The free movement of molecules results in collision which is perfectly elastic.

5) The molecules have kinetic energy due to random movement. But the average kinetic energy of these molecules differs with temperature.

6) Molecules exert pressure on the walls of the container.

Answer:

Tapeworm, also called cestode, any member of the invertebrate class Cestoda (phylum Platyhelminthes), a group of parasitic flatworms containing about 5,000 species. ... Tapeworms also lack a circulatory system and an organ specialized for gas exchange.

Answer:

the rate of a reaction is measured by how fast a REACTANT is used up or how fast a PRODUCT is formed

Answer:

5.20 grams of Br₂

Explanation:

From our previous knowledge;

We understand that:

The number of moles of a given element = mass of the element divided by its molar mass.

Mathematically:

[tex]\mathbf{no \ of \ moles =\dfrac{ mass}{ molar \ mass}}[/tex]

From the given information, let's assume that the 0.065 moles of liquid -bromine partake in the reaction.

From the periodic table, the molar mass of Bromine is = 79.9 g/mol

As such, the mass of liquid that partakes is calculated as:

0.065 mol  = mass/ 79.9 g/mol

mass = 0.065 mol × 79.9 g/mol

mass of liquid that partakes in the reaction = 5.20 grams of Br₂

Answer:

c. 29 J

Explanation:

Step 1: Given data

Step 2: Calculate the temperature change

ΔT = 37 °C - 22 °C = 15 °C

Step 3: Calculate the heat (Q) required to raise the temperature of the lead piece

We will use the following expression.

Q = c × m × ΔT

Q = 0.13 J/g.°C × 15 g × 15 °C = 29 J

Answer:

a. 4.41 g of Urea

b. 1.5 g of Urea

Explanation:

To start the problem, we define the reaction:

2NH₃ (g) +  CO₂ (g) → CH₄N₂O (s)  +  H₂O(l)

We only have mass of ammonia, so we assume the carbon dioxide is in excess and ammonia is the limiting reactant:

2.6 g . 1mol / 17g = 0.153 moles of ammonia

Ratio is 2:1. 2 moles of ammonia can produce 1 mol of urea

0.153 moles ammonia may produce, the half of moles

0153 /2 = 0.076 moles of urea

To state the theoretical yield we convert moles to mass:

0.076 mol . 58 g/mol = 4.41 g

That's the 100 % yield reaction

If the percent yield, was 34%:

4.41 g . 0.34 = 1.50 g of urea were produced.

Formula is (Yield produced / Theoretical yield) . 100 → Percent yield

Answer:

[tex]\%diff=24.0\%[/tex]

Explanation:

Hello there!

In this case, according to the given information, it turns out firstly necessary for us to set up the van der Waals' equation as shown below:

[tex]p=\frac{RT}{v-b}-\frac{a}{v^2}[/tex]

Thus, we secondly calculate the molar volume as:

[tex]v=\frac{0.8311L}{9.998mol} =0.083L/mol[/tex]

Then, we plug in the entire variables in the vdW equation to get such pressure:

[tex]p=\frac{0.08206\frac{atm*L}{mol*K}*502.7K}{0.08313L/mol-0.03219L/mol}-\frac{1.345L*atm/mol}{(0.08313L/mol)^2}\\\\p=615.2atm[/tex]

And the ideal gas pressure:

[tex]p=\frac{0.08206\frac{atm*L}{mol*K}*502.7K}{0.08313L/mol}\\\\p=496.2atm[/tex]

Finally, the percent difference:

[tex]\%diff=\frac{|496.2atm-615.2atm|}{496.2atm} *100\%\\\\\%diff=24.0\%[/tex]

Regards!

Answer: The thermal energy that would be released by 276.0g of sodium acetate trihydrate is 71.8kJ.

Explanation:

Supercooling is the process of lowering the temperature a liquid below its freezing point, without it becoming solid. A liquid below its freezing point will crystallize in the presence of a seed crystal because it serves as a structure for formation of crystals. From the question,

The given mass of sodium acetate trihydrate

(CH3COONa.3H2O)= 276.0g

Molar mass of sodium acetate

trihydrate= 136.08g/mol

Thermal heat of fusion of sodium acetate

trihydrate = 35.9 kJ/mol

From the given mass the number of moles present= 276.0/ 136.08

= 2.0moles

Therefore the heat (thermal) energy of the given mass of sodium acetate

trihydrate = 2.0 × 35.9

= 71.8kJ

Therefore, upon addition of a small seed crystal, the solution temperature increases as sodium acetate trihydrate crystallizes.

Answer:

Sr is the more metallic element

Bi is the more metallic element

O is the more metallic element

As is the more metallic element

Explanation:

One thing should be clear; metallic character increases down the group but decreases across the period.

Hence, as we move across the period, elements become less metallic. As we move down the group elements become more metallic.

This is the basis upon which decisions were made about the metallic character of each of the elements listed above.