How many moles of
H
C
l
are in
44.1
mL
of a
1.26
M
H
C
l
solution?

Answer:

0.74 M

Explanation:

From the question given above, the following data were obtained:

Molarity of stock solution (M₁) = 5.90 M

Volume of stock solution (V₁) = 0.250 L

Volume of diluted solution (V₂) = 2 L

Molarity of diluted solution (M₂) =?

The molarity of the diluted solution can be obtained by using the dilution formula as illustrated below:

M₁V₁ = M₂V₂

5.90 × 0.250 = M₂ × 2

1.475 = M₂ × 2

Divide both side by 2

M₂ = 1.475 / 2

M₂ = 0.74 M

Thus, the molarity of the diluted solution is 0.74 M

ummm is that chemistry?

Answer:

is this chem

Explanation:

Answer:

C₃H₆O₃

Explanation:

To solve this question we need to find, as first, the moles of each atom in order to find empirical formula (Simplest whole-number ratio of atoms present in a molecule).

With the molar mass of the substance and the empirical formula we can find the molecular formula as follows:

Moles C -Molar mass:12.0g/mol-

0.24g * (1mol/12.0g) = 0.020 moles C

Moles H = Mass H because molar mass = 1g/mol:

0.040 moles H

Moles O -Molar mass: 16g/mol-

Mass O: 0.60g - 0.24g - 0.040g = 0.32g O

0.32g O * (1mol/16g) = 0.020 moles O

Ratio of atoms (Dividing in moles of C: Lower number of moles):

C = 0.020 moles C / 0.020 moles C = 1

H = 0.040 moles H / 0.020 moles C = 2

O = 0.020 moles O / 0.020 moles C = 1

Empirical formula:

CH₂O.

Molar mass CH2O:

12g/mol + 2*1g/mol + 16g/mol = 30g/mol

As molecular formula has a molar mass 3 times higher than empirical formula, the molecular formula is 3 times empirical formula:

The molecular formula of the organic acid would be C3H6O3

Molecular formula = [empirical formula]n

Where n = molar mass/mass of empirical formula

Empirical formula

C = 0.24/12 = 0.02

H = 0.040/1 = 0.04

O = 0.6 - (0.24+0.04) = 0.32/16 = 0.02

Divide by the smallest

C = 1

H = 2

O = 1

Empirical formula = CH2O

Empirical formula mass = 12 + 2 + 16 = 30

n = 90/30 = 3

Molecular formula = [CH2O]3

                               = C3H6O3

More on molecular formula can be found here: https://brainly.com/question/1247523

Answer:

The major use of sulfuric acid is in the production of fertilizers, e.g., superphosphate of lime and ammonium sulfate. It is widely used in the manufacture of chemicals, e.g., in making hydrochloric acid, nitric acid, sulfate salts, synthetic detergents, dyes and pigments, explosives, and drugs.

The major use of sulfuric acid is in the production of fertilizers, e.g., superphosphate of lime and ammonium sulfate. It is widely used in the manufacture of chemicals, e.g., in making hydrochloric acid, nitric acid, sulfate salts, synthetic detergents, dyes and pigments, explosives, and drugs.

Answer:2C4H10+2C12+12O2 4CO2+CC14+H20

Answer:

e. HCOOH and NaCHOO

Explanation:

For a buffer solution, both an acid and its conjugate base are required.

With the information above in mind, we can discard options a) and c), as those combinations are not of an acid and its conjugate base.

Now it is a matter of comparing the pKa (found in literature tables) of the acids of the remaining three acids:

The acid with the pKa closest to the desired pH is HCOOH, so the correct answer is e. HCOOH and NaCHOO

Answer:

Indicate how the concentration of each species in the chemical equation will change to reestablish equilibrium after reactant or product is added.

[tex]2CO(g) + O2(g) <=> 2CO2[/tex]

Explanation:

When the reactants concentration increases, then the equilibrium will shift towards products and when the concentration of products increases, then equilibrium will shift towards reactants.

So, increases in concentration of carbon monoxide (CO) shifts the equilibrium to favor the formation of carbondioxide.

Similarly increase in concentration of oxygen also favor the formation of product carbon dioxide.

Increase in concentration of CO2 favors the formation of CO and O2.

Decrease in product concentration also favors the formation of product.

Decrease in reactant concentration favors the formation of reactants only.

Answer:

True.

Explanation:

The information presented in the question above regarding linoleic acid is true. Linoleic acid is, in fact, found in many oils and fats in the ester form. In addition, linoleic acid is considered a polyunsaturated fatty acid, due to the presence of two unsaturations in its composition. Its chemical formula is CH3-(CH2)4-CH=CH-CH2-CH=CH-(CH2)7COOH and it is an essential fatty acid for the human body, as it is essential in the composition of arachidonic acid that is responsible for building muscle, managing body fat thermogenesis, and regulating core protein synthesis.

Answer:

True

Explanation:

The valence orbitals of boron are 2s2 2p1. We have to recall that all the valence orbitals whether full or empty are involved in the formation of molecular orbitals.

The number of molecular orbitals formed is equal to the number of atomic orbitals that are combined.

Since there are two valence orbitals and there is only one p orbital among the valence orbitals, it is true that only one p orbital is needed to form molecular orbitals in boron.

Answer:

Pharmaceutical laboratory helps in devloping and conducting research, vaccines. Various kinds of drugs and chemical substances used and are produced at a Pharmaceutical laboratory.

The pharmaceutical laboratories performs with various hazardous substances that results in exposure to various chemicals, biological substances and radiation. To avoid any injury or infection labs need to maintain all safety measures.

Spillage and relaseing chemical substances can be lethal during transportaions by safety measures for heling in for manufacturing of such therapeutic agents spillage and avoid wastage.

Maintaining good safety standards in the pharmaceuticals laboratory will help promote the health of technicians and workers which in turn will increase productivity and attain positive outcomes.

Answer:

#6  8.67x10²⁴ atoms

#7  

1. Atom

2. Formula unit

3. Molecule

4. Ion

Explanation:

#6 First we calculate how many carbon moles are there in 7.00 moles of C₂F₂, keeping in mind that there are 2 C moles per C₂F₂ mol:

As for carbon dioxide, there are 0.400 C moles in 0.400 moles of CO₂.

We calculate the total number of C moles:

Finally we calculate the number of atoms in 14.4 C moles, using Avogadro's number:

#7

Answer:

Explanation:

/ means divided by

* means multiply

1. formula is

partial pressure = no of moles(gas 1)/ no of moles(total)

0.30 mol CO/0.60 mol CO2 + 0.30 mol CO + 0.10 mol H20 ->

.3/(.6+.3+.1) =

.3/1 =

.3 =

partial pressure of CO

2.

.3 * .8 atm = .24

khanacademy

quizlet

The partial pressure of the CO is 0.24 atm if the total pressure of the mixture was 0.80 atm.

Dalton's Law of partial pressure states that the total pressure exerted by non reacting gaseous mixture at a constant temperature and given volume is equal to the sum of partial pressure of all gases.

Dalton's Law of partial pressure using mole fraction of gas

Partial pressure of carbon monoxide (CO) = Mole fraction of carbon monoxide (CO) × Total pressure

Now, we have to find the first mole fraction of CO

Mole fraction of carbon monoxide (CO) = [tex]\frac{\text{moles of solute}}{\text{total moles of solute}}[/tex]

                                                                  = [tex]\frac{\text{moles of CO}}{\text{moles of CO}_2 + \text{moles of CO} + \text{moles of H}_{2}O}[/tex]

                                                                  = [tex]\frac{0.30}{0.60 + 0.30 + 0.10}[/tex]

                                                                  = [tex]\frac{0.30}{1}[/tex]

                                                                  = 0.3

Now, put the value in above equation, we get that

Partial pressure of carbon monoxide (CO)

= Mole fraction of carbon monoxide (CO) × Total pressure

= 0.3 × 0.8

= 0.24 atm

Thus, the partial pressure of the CO is 0.24 atm is the total pressure of the mixture was 0.80 atm.

Learn more about the Dalton's Law of partial Pressure here: https://brainly.com/question/14119417

#SPJ2

molarity = moles of solute / volume of solution

moles of solute = molarity × volume of solution

moles of solute = 0.245 mol/L × 0.1500 L

moles of solute = 0.03675 mol

moles of solute = 0.0368 mol

-----------------------------------------------------------

Step 1: Calculate the molar mass of solute.

molar mass of solute = (40.08 g/mol × 1) + (35.45 g/mol × 2)

molar mass of solute = 110.98 g/mol

Step 2: Calculate the mass of solute.

mass of solute = moles of solute × molar mass of solute

mass of solute = 0.03675 mol × 110.98 g/mol

mass of solute = 4.08 g

Note: The volume of solution must be expressed in liters (L).

Answer:

[tex]\boxed {\sf \bold {0.0368 \ mol \ CaCl_2}}}}[/tex]

[tex]\boxed {\sf \bold {4.08 \ g \ CaCl_2}}}}}[/tex]

Explanation:

Molarity is a measure of concentration in moles per liter.

[tex]molarity= \frac {moles \ of \ solute}{liters \ of \ solution}[/tex]

In this solution, there are 150.0 milliliters of solution and the molarity is 0.245 M CaCl₂ or 0.245 mol CaCl₂ per liter.

First, convert the milliliters to liters. There are 1000 milliliters in 1 liter.

Now, substitute the known values (molarity and liters of solution) into the formula. The moles of solution are unknown, so we can use x.

[tex]0.245 \ mol \ CaCl_2 /L= \frac{ x}{0.150 \ L}[/tex]

We are solving for x, so we must isolate this variable. It is being divided by 0.150 L. The inverse of divisions is multiplication, so we multiply both sides by 0.150 L.

[tex]0.150 \ L *0.245 \ mol \ CaCl_2 /L= \frac{ x}{0.150 \ L} * 0.150 L[/tex]

[tex]0.150 \ L *0.245 \ mol \ CaCl_2 /L=x[/tex]

The units of liters cancel.

[tex]0.150 *0.245 \ mol \ CaCl_2 =x[/tex]

[tex]0.03675 \ mol \ CaCl_2[/tex]

The original measurements have 3 significant figures, so our answer must have the same.

We should round to the ten thousandths place. The 5 to the right of this place tells us to round the 7 up to an 8.

[tex]\bold {0.0368 \ mol \ CaCl_2}[/tex]

We can convert mass to moles using the molar mass. These values are found on the Periodic Table. They are the same as the atomic masses, but the units are grams per mole (g/mol) instead of atomic mass units.

The solute is calcium chloride: CaCl₂. Look up the molar masses of the individual elements.

Notice that chlorine has a subscript of 2. We must multiply the molar mass by 2.

Add calcium's molar mass.

Use the molar mass as a ratio.

[tex]\frac {110.98 \ g\ CaCL_2}{ 1 \ mol \ CaCl_2}[/tex]

Multiply the moles of calcium chloride we calculated above.

[tex]0.0368 \ mol \ CaCl_2 *\frac {110.98 \ g\ CaCL_2}{ 1 \ mol \ CaCl_2}[/tex]

The units of moles of calcium chloride cancel.

[tex]0.0368 *\frac {110.98 \ g\ CaCL_2}{ 1 }[/tex]

[tex]4.084064 \ g\ CaCl_2[/tex]

Round to 3 significant figures again. For this number, it is the hundredths place. The 4 in the thousandths place tells us to leave the 8.

[tex]\bold {4.08 \ g \ CaCl_2}[/tex]

Answer:

At higher temperatures, particles move faster and collide more, increasing solubility rates.

Agitation increases solubility rates as well, by bringing fresh solvent into contact with the undissolved solute

The smaller the particle size, the higher (faster) solubility rate. Vice versa, the bigger the particle size, the lower (slower) solubility rate.

Explanation:

Answer:

1.Precipitation

2.Transpiration

3.Condensation

4.Evaporation

5.Evaporation

3.Condensation

Explanation:

Rain pours from the sky occurs due to the process of precipitation, leaves of the plant dried due to the process of transpiration in which the water is evaporated from the body of plant, fluffy clouds form in the sky occurs in the process of condensation, bathing suit dries after swim is due to evaporation in which water is removed and goes into the atmosphere and water puddles disappear due to the process of evaporation. Evaporation is the removal of water from the any surface whereas transpiration is the removal of water from plant body parts.

Answer:

it's atomic number is 5 and total number is 10

The atom has an atomic number of 20 and has a total of 12 p electrons.

The azimuthal quantum number (l) of the 19th electron is 0 and the magnetic quantum number (m) of the 19th electron is 0.

It is an element of group 2

The number of electrons in the neutral atom is equal to the number of protons and is also the atomic number of an atom.

An atom is known to be electrically neutral. This is because the number of electrons in the atom is equal to the number of protons in the neutral atom.

The number of protons in the neutral atom is called the atomic number of the atom.

For an element that has 20 electrons, its electronic configuration is;

1s2 2s2 2p6 3s2 3p6 4s2.

The 19th electron is in the 4s orbital hence both the azimuthal and magnetic quantum numbers are zero.

The element has outermost electron configuration ns2 so it mus belong to group 2 of the periodic table.

https://brainly.com/question/16979660

Answer:

molar heat of combustion = -5156 *10³ kJ/mol

Explanation:

A quantity of 1.435 g of naphthalene , was burned in a constant-volume bomb calorimeter. Consequently, the temperature of the water rose from 20.28oC to 25.95oC If the heat capacity of the bomb plus water was 10.17 kJ/°C, calculate the heat of combustion of naphthalene on a molar basis; that is, find the molar heat of combustion.

Step 1: Data given

Mass of naphthalene = 1.435 grams

Initial temperature of water = 20.28 °C

Final temperature of water = 25.95 °C

heat capacity of the bomb plus water was 10.17 kJ/°C

Molar mass naphtalene = 128.2 g/mol

Step 2:

Qcal = Ccal * ΔT

⇒with Qcal =the heat of combustion

⇒with Ccal = heat capacity of the bomb plus water = 10.17 kJ/°C

⇒with ΔT = the difference in temperature = T2 - T1 = 25.95 - 20.28 = 5.67°C

Qcal = 10.17 kJ/°C * 5.67 °C

Qcal = 57.7 kJ

Step 3: Calculate moles

Moles naphthalene = 1.435 grams / 128.2 g/mol

Moles naphthalene = 0.01119 moles

Step 4: Calculate the molar heat of combustion

molar heat of combustion = Qcal/ moles

molar heat of combustion = -57.7 kJ/ 0.01119 moles

molar heat of combustion = -5156 *10³ kJ/mol

Answer:

Melting-point apparatus

Answer:

9.36 g

Explanation:

The equation of the reaction is;

C8H18(g) + 25/2 O2(g) ----> 8CO2(g) + 9H2O(g)

Number of moles of octane = 10.3g/ 114 g/mol = 0.09 moles

1 mole of octane yields 9 moles of water

0.09 moles of octane yields 0.09 × 9/1 = 0.81 moles of water

Number of moles of oxygen = 23g/32g/mol = 0.72 moles

12.5 moles of oxygen yields 9 moles of water

0.72 moles of oxygen yields 0.72 × 9/12.5 = 0.52 moles of water

Hence oxygen is the limiting reactant;

Maximum mass of water produced = 0.52 moles of water × 18 g/mol = 9.36 g

Answer:

88.9%

Explanation:

Primero convertimos 5.97 g de glucosa a moles, usando su masa molar:

Después calculamos la cantidad máxima de moles de CO₂ que se hubieran podido producir:

Ahora calculamos los moles de CO₂ producidos, usando los datos de recolección dados y la ecuación PV=nRT:

Finalmente calculamos el rendimiento porcentual:

Answer:

the change in the internal energy of the system is 3,752.67 J

Explanation:

Given;

initial volume of the gas, V₁ = 30.6 L

final volume of the gas, V₂ = 1.8 L

constant pressure of the gas, P = 1.8 atm

Energy released by the system, Q = 1.5 kJ = 1,500 J

Apply pressure-volume work equation, to determine the work done on the gas;

w = -PΔV

w = -P(V₂ - V₁)

w = - 1.8 atm(1.8 L - 30.6 L)

w = 51.84 L.atm

w = 51.84 L.atm x 101.325 J/L.atm

w = 5,252.67 J

The change in the internal energy of the system is calculated as;

ΔU = Q + w

Since the heat is given out, Q = - 1,500 J

ΔU = -1,500 J  +  5,252.67 J

ΔU = 3,752.67 J

Therefore, the change in the internal energy of the system is 3,752.67 J

Answer:

Slower

Explanation:

The reaction between alkyl halides and sodium iodide-in-acetone is an SN2 reaction. The rate of reaction depends on the concentration of the alkyl halide as well as the concentration of the sodium iodide. It is a bimolecular reaction.

This means that if the concentration of any of the reactants is halved, the rate of reaction decreases accordingly.

Therefore, if the iodide solution is half as concentrated, the reaction is observed to be slower in accordance with the rate law;

Rate = k[alkyl halide] [iodide]

Explanation:

Esterification occurs when a carboxylic acid reacts with an alcohol. This reaction can only occur in the presence of an acid catalyst and heat. It takes a lot of energy to remove the -OH from the carboxylic acid, so a catalyst and heat are needed to produce the necessary energy.

Answer:

The Esterification ProcessEsterification occurs when a carboxylic acid reacts with an alcohol. This reaction can only occur in the presence of an acid catalyst and heat. It takes a lot of energy to remove the -OH from the carboxylic acid, so a catalyst and heat are needed to produce the necessary energy.

The Esterification ProcessEsterification occurs when a carboxylic acid reacts with an alcohol. This reaction can only occur in the presence of an acid catalyst and heat. It takes a lot of energy to remove the -OH from the carboxylic acid, so a catalyst and heat are needed to produce the necessary energy.Once the -OH has been removed, the hydrogen on the alcohol can be removed and that oxygen can be connected to the carbon. Because the oxygen was already connected to a carbon, it is now connected to a carbon on both sides, and an ester is formed.

The Esterification ProcessEsterification occurs when a carboxylic acid reacts with an alcohol. This reaction can only occur in the presence of an acid catalyst and heat. It takes a lot of energy to remove the -OH from the carboxylic acid, so a catalyst and heat are needed to produce the necessary energy.Once the -OH has been removed, the hydrogen on the alcohol can be removed and that oxygen can be connected to the carbon. Because the oxygen was already connected to a carbon, it is now connected to a carbon on both sides, and an ester is formed.The methyl acetate that was formed is an ester. In this image, the green circle represents what was the carboxylic acid (in this case acetic acid), and the red circle represents what was the alcohol (in this case methanol):

This reaction lost an -OH from the carboxylic acid and a hydrogen from the alcohol. These two also combine to form water. So any esterification reaction will also form water as a side product.

Answer:

1.88 A

Explanation:

Let's consider the reduction of copper in an electrolytic cell.

Cu²⁺ + 2 e⁻ ⇒ Cu

We can calculate the charge used to deposit 12.3 g of Cu using the following relations.

The charge used is:

[tex]12.3 g \times \frac{1 molCu}{63.55gCu} \times \frac{2molElectron}{1molCu} \times \frac{96486C}{1molElectron} = 3.73 \times 10^{4} C[/tex]

We can convert 5.50 h to seconds using the conversion factor 1 h = 3600 s.

5.50 h × 3600 s/1 h = 1.98 × 10⁴ s

The current used is:

I = q/t = 3.73 × 10⁴ C/1.98 × 10⁴ s = 1.88 A

Answer:

All of the above.

Explanation:

For a scientific hypothesis to be considered a hypothesis, it has to be testable. When conducting a lab experiment, it also allows the tester to predict what might occur during and after the experimentation. They are also explanatory. For example, theories are hypotheses that have been verified and can explain why something in nature takes place.

Answer: Molar mass of the unknown gas is 73.153 g/mol.

Explanation:

Given: Mass of each gas = 8.7 g

Volume = 17.28 L

Let us assume that the molar mass of gas is m g/mol.

Molar mass of Ar is 40 g/mol and Ne is 20 g/mol.

Hence, total moles of each gas are as follows.

[tex](\frac{8.7}{40} + \frac{8.7}{20} + \frac{8.7}{m}) mol[/tex]

At STP, the total volume of these gases is as follows.

[tex](\frac{8.7}{40} + \frac{8.7}{20} + \frac{8.7}{m}) mol \times 22.4 L = 17.28 L\\(\frac{8.7}{40} + \frac{8.7}{20})22.4 L + \frac{8.7}{m} \times 22.4 L = 17.28 L\\14.616 + \frac{8.7}{m} \times 22.4 L = 17.28 L\\\frac{8.7}{m} \times 22.4 L = (17.28 L - 14.616)\\\frac{8.7}{m} \times 22.4 L = 2.664 \\m = 73.153 g/mol[/tex]

Thus, we can conclude that molar mass of the unknown gas is 73.153 g/mol.